| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||
| IUPAC name : | 1-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)ethanone | |||||||||||||||||||||||||||||
| InChI : | InChI=1/C17H24O/c1-10-8-14-15(9-13(10)11(2)18)17(6,7)12(3)16(14,4)5/h8-9,12H,1-7H3 | |||||||||||||||||||||||||||||
| InChIKey : | VDBHOHJWUDKDRW-UHFFFAOYAE | |||||||||||||||||||||||||||||
| SMILES : | CC1C(C2=C(C1(C)C)C=C(C(=C2)C)C(=O)C)(C)C | |||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||
| export tariff code : | 2914.39.9000 | |||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||
| John D. Walsh : | Phantolid Crystals | |||||||||||||||||||||||||||||
| Penta : | fixolide | |||||||||||||||||||||||||||||
| PFW : | PHANTOLID® CRYSTALS
≥95% (sum of isomers) Odor: has a clean sweet musk odour | |||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in dipropylene glycol. | strong sweet musk amber powdery dry fruity | |||||||||||||||||||||||||||||
| odor sample from : | PFW Aroma Chemicals | |||||||||||||||||||||||||||||
| substantivity : | 384 Hour(s) | |||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||
| appearence : | off-white crystals or solid | |||||||||||||||||||||||||||||
| assay : | 97.00 to 100.00 % sum of isomers | |||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||
| melting point : | 37.00 to 58.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||
| boiling point : | 393.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||
| vapor pressure : | 0.02400 mm/Hg @ 25.00 °C. | |||||||||||||||||||||||||||||
| flash point : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||
| logP (o/w) : | 5.80 | |||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||
| IFRA critical Effect : | Phototoxicity | |||||||||||||||||||||||||||||
| IFRA fragrance material specification : | ||||||||||||||||||||||||||||||
| For applications on areas of skin exposed to sun, excluding bath preparations, soaps and other rinse-off products, limit use to 2% in the finished cosmetic product. Based on the phototoxic potential showing no effects at 10% in human photo-toxicity tests (IFRA guidelines). | ||||||||||||||||||||||||||||||
| limits in the finished product for - "leave on the skin contact" : | ||||||||||||||||||||||||||||||
| 2.0000 % Restriction. | ||||||||||||||||||||||||||||||
| limits in the finished product for - "wash off the skin contact" : | ||||||||||||||||||||||||||||||
| 6.0000 % Recommendation. | ||||||||||||||||||||||||||||||
| limits in the finished product for - "no skin contact" : | ||||||||||||||||||||||||||||||
| 10.0000 % Recommendation. | ||||||||||||||||||||||||||||||
| recommendation for musk indane usage levels up to : | ||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||
| recommendation for musk indane usage levels up to : | ||||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||
| IFRA : | IFRA - ( Found under : 5-Acetyl-1,1,2,3,3,6-hexamethyl indan ) | |||||||||||||||||||||||||||||
| Chemical Carcinogenesis Research Information System : | Search | |||||||||||||||||||||||||||||
| Cancer Citations : | Search | |||||||||||||||||||||||||||||
| Toxicology Citations : | Search | |||||||||||||||||||||||||||||
| Env. Mutagen Info. Center : | Search | |||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||
| SCCNFP : | opinion | |||||||||||||||||||||||||||||
| WGK Germany : | 3 | |||||||||||||||||||||||||||||
| 1-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)ethanone | ||||||||||||||||||||||||||||||
| (EINECS) number : | 239-360-0 | |||||||||||||||||||||||||||||
| chemidplus : | 015323350 | |||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 15323-35-0 | |||||||||||||||||||||||||||||
| dtp/nci : | 16827 | |||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||
| 1-(1,1,2,3,3,6-hexamethyl-2H-inden-5-yl)ethanone | ||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 647494464 | |||||||||||||||||||||||||||||
| pubchem : | 668348 | |||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||
| Cosmetic uses : |
perfuming agents | |||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1985)¹ | |||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||
| Household Products : | Search | |||||||||||||||||||||||||||||
| synonyms : | |
| acetyl hexamethyl indan | |
| 6- | acetyl-1,1,2,3,3,5-hexamethyl indan |
| 5- | acetyl-1,1,2,3,3,6-hexamethyl indan |
| 1-(2,3- | dihydro-1,1,2,3,3,6-hexamethyl-1H-inden-5-yl) ethanone |
| ganolide | |
| 1-(1,1,2,3,3,6- | hexamethyl-2H-inden-5-yl)ethanone |
| INCI acetyl hexamethyl indan | |
| phantolid | |
soluble in : | |
| alcohol | |
| diethyl phthalate | |
| most solvents | |
| paraffin oil | |
| water, 0.027 mg/L @ 25C | |
insoluble in : | |
| water | |
stability : | |
| acids | |
| alcohol, good | |
| alkalis | |
| bar soap, good | |
| cream rinse, excellent | |
| deo pump spray, good | |
| fabric softener, good | |
| hand cream, good | |
| liquid detergent, good | |
| non-discoloring in most media | |
| oxidizing agents | |
| reducing agents | |
(odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| amber carbinol | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | butyl cinnamate |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clover nitrile | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| para- | cresyl phenyl acetate |
| cyclamen aldehyde | |
| decanol | |
| 9- | decen-1-ol |
| decyl acetate | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl maltol | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| ho leaf oil | |
| hyacinth ether | |
| hydroxycitronellal | |
| indole | |
| ionones | |
| labdanum resinoid | |
| laevo- | linalool |
| linalool oxide | |
| marine pyridine | |
| methyl acetophenone | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| muguet octadienol | |
| musks | |
| myrrh oil | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| pepper oil black | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| santall | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanol | |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
(odor and/or flavor) used in : | |
| acacia | |
| allspice | |
| amber | |
| ambergris | |
| ambrette | |
| amyris | |
| angelica | |
| animal | |
| burberry | |
| cabreuva | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| cedar forest | |
| christmas blends | |
| clean | |
| cloth clean cloths | |
| clove blossom | |
| cyclamen | |
| dusty | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| fir needle | |
| fixer | |
| flouve blossom | |
| foliage | |
| forest | |
| frangipanni plumeria | |
| ginger white ginger | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hawthorn | |
| heather | |
| heliotrope | |
| hollyberry | |
| hugonia | |
| incense | |
| iris blossom | |
| kewda | |
| lavender | |
| leather | |
| lemon | |
| lily | |
| magnolia | |
| maja | |
| meadow | |
| moss | |
| muguet lily of the valley | |
| musk | |
| new car | |
| oakwood | |
| ocean sea | |
| petunia | |
| phlox | |
| powder | |
| rain | |
| rose white rose | |
| sandalwood | |
| spice | |
| spicewood | |
| tobacco tabac tabaco | |
| tonka | |
| vanilla | |
| verbena verveine | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| not found in nature | |