Notes :
Delute with two parts diacetyl to 1000 parts linalool
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | butane-2,3-dione | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C4H6O2/c1-3(5)4(2)6/h1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | QSJXEFYPDANLFS-UHFFFAOYAX | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)C(=O)C | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 184.1278 | h. number : | 2914.19.00 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | buttery | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in propylene glycol. | strong butter sweet creamy pungent caramel | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 50.00 ppm. Sweet, buttery, creamy, milky | |||||||||||||||||||||||||||||||||||
| substantivity : | 44 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | yellow to yellow green clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.97900 - 0.98500 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.146 to 8.196 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.39300 - 1.39700 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 87.00 - 88.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | -1.34 | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1580.00 gm/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 17,765,1979 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 45.00 °F. TCC ( 7.22 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for diacetyl usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 0.3000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for diacetyl usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 50.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 207-069-8 | |||||||||||||||||||||||||||||||||||
| rtecs : | EK2625000 for 431-03-8 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000431038 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 431-03-8 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 8750 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 153111 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3847408412 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 16, No. 6, 43, (1991)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| biacetyl | |
| 2,3- | butadione |
| 2,3- | butane dione |
| diacetyl | |
| 2,3- | diketobutane |
| dimethyl diketone | |
| dimethyl glyoxal | |
| 2,3- | dioxobutane |
| soluble in : | |
| alcohol | |
| fixed oils | |
| glycerin | |
| propylene glycol | |
| water, 200000 mg/L @ 15C | |
| insoluble in : | |
| paraffin oil | |
| (odor and/or flavor) blends with : | |
| dilute with two parts diacetyl to 1000 parts linalool | |
| (odor and/or flavor) used in : | |
| angelica | |
| azalea | |
| banana | |
| bay | |
| beer | |
| butter | |
| butterscotch | |
| caramel | |
| caraway | |
| champaca champak | |
| cheese cheddar cheese | |
| cheese swiss cheese | |
| chicory root | |
| citronella | |
| clary sage | |
| coffee | |
| cranberry | |
| cream | |
| custard | |
| cypress | |
| dairy | |
| gardenia | |
| geranium | |
| jasmin | |
| lavandin | |
| lavender | |
| lilac lilas syringa | |
| magnolia | |
| narcissus narcisse | |
| nutmeg | |
| orris iris | |
| patchouli | |
| sandalwood | |
| savin | |
| strawberry | |
| sugar brown sugar | |
| tomato | |
| tulip | |
| vetiver | |
| vinegar | |
| ylang ylang cananga | |
| yogurt | |
| natural occurrence in : | |
| bilberry | |
| blackberry | |
| butter | |
| cabbage | |
| cheese cheddar cheese | |
| chicory root | |
| citronella oil java | |
| coffee | |
| cranberry | |
| currant | |
| geranium oil | |
| grape | |
| lavandin oil | |
| lavender oil | |
| data page | lavender oil spike spain @ 0.331% |
| milk | |
| pear | |
| pineapple | |
| raspberry fruit | |
| strawberry | |
| tomato | |
| vinegar | |
| yogurt | |