| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||
| IUPAC name : | 4-methoxybenzonitrile | |||||||||||||||||||||||||
| InChI : | InChI=1/C8H7NO/c1-10-8-4-2-7(6-9)3-5-8/h2-5H,1H3 | |||||||||||||||||||||||||
| InChIKey : | XDJAAZYHCCRJOK-UHFFFAOYAA | |||||||||||||||||||||||||
| SMILES : | COC1=CC=C(C=C1)C#N | |||||||||||||||||||||||||
|
| |||||||||||||||||||||||||
| export tariff code : | 2926.90.0000 | |||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet floral hawthorn hay coumarin | |||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||
| assay : | 95.00 - 100.00 % | |||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||
| melting point : | 61.00 - 62.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| boiling point : | 256.00 - 257.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||
| logp : | 1.87 | |||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 135.00 °F. TCC ( 57.22 °C. ) | |||||||||||||||||||||||||
| recommendation for para-anisyl nitrile usage levels up to : | ||||||||||||||||||||||||||
| 0.6000 % in the fragrance concentrate. | ||||||||||||||||||||||||||
| recommendation for para-anisyl nitrile usage levels up to : | ||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||
| (EINECS) number : | 212-871-6 | |||||||||||||||||||||||||
| chemidplus : | 000874908 | |||||||||||||||||||||||||
| epa-srs : | 874-90-8 | |||||||||||||||||||||||||
| dtp/nci : | 3777 | |||||||||||||||||||||||||
| EPI System : | Click here | |||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||
| pubchem : | 212310 | |||||||||||||||||||||||||
| NIST Chemistry WebBook : | 22806658 | |||||||||||||||||||||||||
| synonyms : | |
| anisonitrile | |
| para- | anisonitrile |
| para- | anisyl nitrile |
| aubepine nitrile | |
| 4- | cyanoanisole |
| para- | cyanoanisole |
| 4- | methoxybenzonitrile |
| para- | methoxybenzonitrile |
| para- | methoxyphenyl cyanide |
| soluble in : | |
| alcohol | |
| water, 1720 mg/L @ 25C | |
| insoluble in : | |
| water | |
| stability : | |
| alkalis | |
| (odor and/or flavor) blends with : | |
| acetanisole | |
| acetoin | |
| acetophenone | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| anethol | |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| iso | bornyl acetate |
| cassia bark oil | |
| celery seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| costus valerolactone | |
| coumarin | |
| cuminaldehyde | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl salicylate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropin | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| ionones | |
| lilyall | |
| alpha- | methyl cinnamaldehyde |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| neroli oil | |
| nerolidol | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| petitgrain oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| storax resinoid | |
| alpha- | terpineol |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond | |
| amber | |
| ambrene | |
| angel | |
| anise | |
| apple | |
| apres l'ondee | |
| apricot | |
| balsam | |
| banana | |
| bluebell | |
| bouquet | |
| broom genet genista | |
| buchu | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| crabapple blossom | |
| decumaria | |
| elder blossom | |
| fennel | |
| fern fougere | |
| floral | |
| gardenia | |
| ginger white ginger | |
| gooseberry | |
| grape | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| linden blossom limeflower tilleul | |
| magnolia | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| nut walnut | |
| orange | |
| orchid | |
| oriental | |
| pear | |
| peppermint | |
| pineapple | |
| powder | |
| raspberry | |
| sassafras | |
| spearmint | |
| strawberry | |
| sweet pea pois de senteur | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| ylang ylang cananga | |
| natural occurrence in : | |
| not found in nature | |