| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | (4-formyl-2-methoxyphenyl) acetate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H10O4/c1-7(12)14-9-4-3-8(6-11)5-10(9)13-2/h3-6H,1-2H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | PZSJOBKRSVRODF-UHFFFAOYAK | |||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)OC1=C(C=C(C=C1)C=O)OC | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2916.35.1500 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | vanilla | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | sweet creamy vanilla powdery heliotropin | |||||||||||||||||||||||||||||||||
| taste description³ : | at 40.00 ppm. Sweet, vanilla, creamy, powdery with a balsamic beany nuance | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystals | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| melting point : | 77.00 - 79.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 287.00 - 288.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 1.10 | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 256.00 °F. TCC ( 124.44 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for vanillyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for vanillyl acetate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 40.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 212-920-1 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000881685 | |||||||||||||||||||||||||||||||||
| epa-srs : | 881-68-5 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 8499 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 197492 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4144441378 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 19, No. 2, 55, (1994)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| acetovanillin | |
| 4- | acetoxy-3-methoxybenzaldehyde |
| 4-( | acetyl oxy)-3-methoxybenzaldehyde |
| acetyl vanillin | |
| acetylvanillin | |
| 4- | formyl-2-methoxyphenol acetate |
| 4- | formyl-2-methoxyphenyl acetate |
| 3- | methoxy-4-acetoxybenzaldehyde |
| vanillin acetate | |
| vanillyl acetate | |
| soluble in : | |
| alcohol | |
| ethyl ether | |
| water, slightly | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| acetophenone | |
| 2- | acetyl furan |
| allspice oil | |
| amber carbinol | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzophenone | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl benzoate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl propionate | |
| benzyl salicylate | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl benzoate |
| iso | butyl cinnamate |
| caramel furanone | |
| carnation absolute | |
| cassia bark oil | |
| chocolate pyrazine | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| coconut absolute | |
| coffee furanone | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| eugenol | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| alpha- | hexyl cinnamaldehyde |
| ho leaf oil | |
| hyacinth ether | |
| hydroxycitronellal | |
| immortelle absolute | |
| ionones | |
| labdanum resinoid | |
| lavender absolute | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl acetophenone | |
| methyl cedryl ketone | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| methyl phenyl acetate | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| gamma- | nonalactone |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| orange oil | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenethyl phenyl acetate | |
| phenethyl propionate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| santall | |
| strawberry furanone | |
| strawberry glycidate 1 | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| absinthe | |
| acorn | |
| agate | |
| almond | |
| almond blossom | |
| amber | |
| amyris | |
| apple crabapple | |
| apricot | |
| arnica | |
| azalea | |
| balsam | |
| banana | |
| beeswax cire d'abeille | |
| benzoin | |
| blackberry | |
| blueberry | |
| boysenberry | |
| bramble arctic bramble blackberry | |
| bread | |
| briar sweet briar eglantine | |
| broom genet genista | |
| bubblegum | |
| butterscotch | |
| cabreuva | |
| candy cotton candy | |
| cappuccino | |
| caramel | |
| carnation dianthus oeillet | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| cedar forest | |
| champaca champak | |
| cherry | |
| cherry black cherry | |
| cherry blossom | |
| chocolate cacao | |
| chocolate cocoa | |
| christmas blends | |
| chypre | |
| clove | |
| clove blossom | |
| coconut | |
| coconut tropical coconut | |
| coffee | |
| cookie | |
| coronilla | |
| crabapple blossom | |
| cream | |
| cream ice cream | |
| cream soda | |
| currant | |
| cyclamen | |
| dahlia | |
| daisy | |
| daphne | |
| date | |
| deertongue | |
| dillenia | |
| elderberry | |
| fagonia | |
| fantasy blends | |
| fenugreek | |
| fern fougere | |
| fig | |
| fir balsam | |
| flouve blossom | |
| forest | |
| frangipanni plumeria | |
| fruit tropical fruit | |
| ginger white ginger | |
| gingerbread | |
| gooseberry | |
| graham cracker | |
| grape | |
| grass sweet grass | |
| guaiacwood | |
| guava | |
| habuba | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heather | |
| heliotrope | |
| hibiscus | |
| honey miel | |
| huckleberry bilberry | |
| immortelle helichrysum everlasting | |
| incense | |
| jackfruit | |
| kiwi blossom | |
| kumquat | |
| labdanum | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| litsea cubeba | |
| loganberry dewberry | |
| lychee soapberry | |
| malt | |
| mango | |
| mango blossom | |
| marshmallow | |
| mastic | |
| meadow | |
| melon watermelon muskmelon cantaloupe | |
| milk malted milk | |
| mint | |
| molasses | |
| moss | |
| mulberry | |
| musk | |
| myrrh | |
| nectarine | |
| neroli | |
| opoponax | |
| orange | |
| orange blossom fleur d'oranger | |
| oriental | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| peach blossom | |
| pear | |
| pear blossom | |
| petunia | |
| phlox | |
| pina colada | |
| pineapple | |
| plum | |
| plum blossom | |
| pomegranate | |
| popcorn | |
| poppy | |
| powder | |
| praline | |
| prune | |
| pumpkin | |
| quince | |
| raisin | |
| raspberry | |
| redwood | |
| rootbeer | |
| rose d'orient | |
| rose moss rose | |
| rose tea rose | |
| rose white rose | |
| rose wild rose | |
| rum | |
| sandalwood | |
| sarsaparilla | |
| starfruit | |
| stephanotis | |
| stock evening scented stock | |
| straw | |
| strawberry | |
| sweet | |
| tamarind | |
| tangerine | |
| toasted | |
| tobacco tabac tabaco | |
| toffee | |
| tonka | |
| vanilla | |
| verbena verveine | |
| whiskey | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| found in nature | |