| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | di(phenyl)methanone | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H | |||||||||||||||||||||||||||||||||
| InChIKey : | RWCCWEUUXYIKHB-UHFFFAOYAX | |||||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 177.2600 |
h. number : | 2914.39.90 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | balsam rose metallic powdery geranium | |||||||||||||||||||||||||||||||||
| substantivity : | 394 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystalline solid | |||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| melting point : | 47.00 - 51.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 305.00 - 307.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 170.00 - 171.00 °C. @ 15.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 3.18 | |||||||||||||||||||||||||||||||||
| shelf life : | 36.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >10.00 gm/kg FCTXAV 11,873,1973 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 3535.00 mg/kg FCTXAV 11,873,1973 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for benzophenone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for benzophenone usage levels up to : | ||||||||||||||||||||||||||||||||||
| 2.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-337-6 | |||||||||||||||||||||||||||||||||
| rtecs : | DI9950000 for 119-61-9 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000119619 | |||||||||||||||||||||||||||||||||
| epa-srs : | 119-61-9 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 8077 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 151552 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1073705171 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| benzophenone | |
| diphenyl ketone | |
| alpha-oxo | diphenyl methane |
| diphenyl methanone | |
| alpha- | oxoditane |
| soluble in : | |
| alcohol | |
| fixed oils | |
| paraffin oil | |
| water, 137 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| bath foam | |
| non-discoloring in most media | |
| powder | |
| shampoo | |
| (odor and/or flavor) blends with : | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| atractylis absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | bornyl acetate |
| camphor oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| chamomile oil | |
| cistus oil | |
| citronellol | |
| costus valerolactone | |
| decanal | |
| decanol | |
| dimethyl benzyl carbinol | |
| dodecanal | |
| ethyl cinnamate | |
| ethyl laurate | |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| geranium oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropin | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| methyl cedryl ketone | |
| methyl ionones | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| gamma- | nonalactone |
| nonanol | |
| ocean propanal | |
| patchouli ethanone | |
| phenethyl phenyl acetate | |
| phenyl acetaldehyde | |
| rose absolute | |
| santall | |
| tonka bean absolute | |
| 10- | undecen-1-al |
| vanillin | |
| verymoss | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| agate | |
| amber | |
| apricot | |
| baby powder | |
| balsam | |
| bayberry | |
| berry | |
| bouquet | |
| butterscotch | |
| cedar forest | |
| christmas blends | |
| clean | |
| fir balsam | |
| fixer | |
| floral | |
| freesia | |
| fruit | |
| geranium | |
| ginger white ginger | |
| heather | |
| herbal | |
| hollyberry | |
| hyacinth jacinthe | |
| juniperberry | |
| lavender | |
| mimosa wattle | |
| moss | |
| muguet lily of the valley | |
| musk | |
| new car | |
| nut | |
| oriental | |
| patchouli | |
| peach | |
| pine | |
| pomegranate | |
| rain | |
| rose | |
| rose white rose | |
| sweet pea pois de senteur | |
| tea green tea | |
| tide | |
| vanilla | |
| woody | |
| natural occurrence in : | |
| found in nature | |