| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | methyl 2-[(4-methoxyphenyl)methylideneamino]benzoate | |||||||||||||||||||||||
| InChI : | InChI=1/C16H15NO3/c1-19-13-9-7-12(8-10-13)11-17-15-6-4-3-5-14(15)16(18)20-2/h3-11H,1-2H3/b17-11+ | |||||||||||||||||||||||
| InChIKey : | VYSXJKIBCGUXTM-GZTJUZNOBL | |||||||||||||||||||||||
| SMILES : | COC1=CC=C(C=C1)C=NC2=CC=CC=C2C(=O)OC | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | unspecified | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 50.00 % solution or less | |||||||||||||||||||||||
| odor description : at 50.00 % in dipropylene glycol. | sweet hawthorn mimosa sweet powdery | |||||||||||||||||||||||
| substantivity : | 204 Hour(s) | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | yellow viscous liquid to solid | |||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 1.14300 - 1.15060 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 9.511 to 9.574 | |||||||||||||||||||||||
| refractive index : | 1.57510 - 1.58430 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 437.00 - 438.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| logp : | 3.81 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | 230.00 °F. TCC ( 110.00 °C. ) | |||||||||||||||||||||||
| recommendation for para-anisaldehyde / methyl anthranilate schiff's base usage levels up to : | ||||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for para-anisaldehyde / methyl anthranilate schiff's base usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 238-796-9 | |||||||||||||||||||||||
| chemidplus : | 014735729 | |||||||||||||||||||||||
| epa-srs : | 14735-72-9 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| pubchem : | 661501 | |||||||||||||||||||||||
| synonyms : | |
| acaciol | |
| para- | anisaldehyde / methyl anthranilate schiff's base |
| N-((4- | methoxyphenyl)methylene)-2-carbomethoxybenzenamine |
| methyl (para-methoxybenzylidene) anthranilate | |
| methyl anthranilate / para-anisaldehyde schiff's base | |
| methyl N-(para-methoxybenzylidene) anthranilate | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetanisole | |
| acetoin | |
| acetophenone | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| anethol | |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| iso | bornyl acetate |
| cassia bark oil | |
| celery seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| costus valerolactone | |
| coumarin | |
| cuminaldehyde | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl salicylate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropin | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| ionones | |
| lilyall | |
| alpha- | methyl cinnamaldehyde |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| neroli oil | |
| nerolidol | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| petitgrain oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| storax resinoid | |
| alpha- | terpineol |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond | |
| amber | |
| ambrene | |
| angel | |
| anise | |
| apple | |
| apres l'ondee | |
| apricot | |
| balsam | |
| banana | |
| benzoinett | |
| bluebell | |
| boronia | |
| bouquet | |
| broom genet genista | |
| buchu | |
| butterscotch | |
| cassia | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chypre | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| crabapple blossom | |
| decumaria | |
| elder blossom | |
| fennel | |
| fern fougere | |
| floral | |
| gardenia | |
| ginger white ginger | |
| gooseberry | |
| grape | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hops houblon | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| linden blossom limeflower tilleul | |
| magnolia | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| modern | |
| nut walnut | |
| orange | |
| orchid | |
| oriental | |
| pear | |
| peppermint | |
| pineapple | |
| powder | |
| raspberry | |
| sassafras | |
| spearmint | |
| strawberry | |
| sweet pea pois de senteur | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| ylang ylang cananga | |
| natural occurrence in : | |
| not found in nature | |