Notes :
Blend with 7 parts anisyl alcohol and 5 parts heliotropin to remove the custard note. Imparts a lasting sweetness whenever used.
sandalwood enhancer - santall and heliotropin.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 1,3-benzodioxole-5-carbaldehyde | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H6O3/c9-4-6-1-2-7-8(3-6)11-5-10-7/h1-4H,5H2 | |||||||||||||||||||||||||||||||||
| InChIKey : | SATCULPHIDQDRE-UHFFFAOYAS | |||||||||||||||||||||||||||||||||
| SMILES : | C1OC2=C(O1)C=C(C=C2)C=O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 182.60 | h. number : | 2932.93.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | heliotrope flower sweet powdery coconut vanilla | |||||||||||||||||||||||||||||||||
| taste description³ : | at 15.00 ppm. Benzaldehyde, cherry, vanilla and spicy | |||||||||||||||||||||||||||||||||
| substantivity : | 212 Hour(s) | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystalline powder | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| melting point : | 38.50 - 39.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 263.00 - 265.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 144.00 - 145.00 °C. @ 15.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 1.05 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2700.00 mg/kg TXAPA9 6,378,1964 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg NTIS** OTS0535062 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for heliotropin usage levels up to : | ||||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for heliotropin usage levels up to : | ||||||||||||||||||||||||||||||||||
| 40.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-409-7 | |||||||||||||||||||||||||||||||||
| rtecs : | TO1575000 for 120-57-0 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000120570 | |||||||||||||||||||||||||||||||||
| epa-srs : | 120-57-0 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 26826 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 151589 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2588095605 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 21, No. 5, 49, (1996)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| 1,3- | benzodioxole-5-carboxaldehyde |
| 3,4- | dihydroxybenzaldehyde methylene ketal |
| 3,4- | dimethylene dioxybenzaldehyde |
| dioxymethylene procatechuic aldehyde | |
| dioxymethylene protocatechuic aldehyde | |
| formaldehyde protechualdehyde-3,4-cyclic acetal | |
| 5- | formyl-1,3-benzodioxole |
| geliotropin | |
| heliotropin | |
| 3,4- | methylene dioxy) benzaldehyde |
| 3,4-bis( | methylene dioxy) benzaldehyde |
| 3,4-( | methylene dioxy)-1,3-benzodioxole-5-benzaldehyde |
| 3,4- | methylene dioxybenzaldehyde |
| 3,4- | methylene protocatechuic aldehyde |
| piperonal | |
| piperonaldehyde | |
| piperonyl aldehyde | |
| protocatechuic aldehyde methylene ether | |
| soluble in : | |
| alcohol | |
| benzyl benzoate | |
| dipropylene glycol | |
| fixed oils | |
| isopropyl myristate | |
| propylene glycol | |
| insoluble in : | |
| paraffin oil | |
| water | |
| glycerin | |
| stability : | |
| bath foam | |
| hair spray | |
| powder | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| allspice oil | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| amyl isoeugenol | |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| anthocephalus cadamba oil | |
| beeswax absolute | |
| benzaldehyde | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| bergamot oil | |
| blend with 7 parts anisyl alcohol and 5 parts piperinal removes the custard note | |
| blood orange oil | |
| iso | butyl cinnamate |
| cadamba oil | |
| caramel furanone | |
| cardamom seed oil | |
| cassia bark oil | |
| cassis absolute | |
| chloranthus spicatus absolute | |
| cinnamyl alcohol | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| copaiba balsam oil | |
| costus valerolactone | |
| coumarin | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanal | |
| decanol | |
| decyl acetate | |
| deertongue absolute | |
| dihydrojasmone | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| dodecanol | |
| elecampane absolute | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| (E)- | geranyl acetone |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl propionate |
| alpha- | hexyl cinnamaldehyde |
| hexyl isovalerate | |
| hyacinth ether | |
| hydroxycitronellal | |
| immortelle absolute | |
| indole | |
| ionones | |
| karo-karounde absolute | |
| labdanum resinoid | |
| lavender absolute | |
| linalool oxide | |
| maltol | |
| methyl acetophenone | |
| para- | methyl anisole |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| musks | |
| myrrh oil | |
| beta- | naphthyl ethyl ether |
| neroli oil | |
| nerolidol | |
| gamma- | nonalactone |
| gamma- | octalactone |
| octyl methyl ketone | |
| orris pyridine | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenyl acetic acid | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rhodinol | |
| rose absolute | |
| rose butanoate | |
| santall | |
| strawberry furanone | |
| alpha- | terpineol |
| tobacco dodecane | |
| tolu balsam | |
| tonka bean absolute | |
| tuberose absolute | |
| turmeric root oil | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| vanilla absolute | |
| vanillin | |
| vanillyl acetate | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| abronia | |
| acacia | |
| aimant | |
| aldehydic | |
| amber | |
| ambrene | |
| amour-amour | |
| angel | |
| apple blossom | |
| arpege | |
| arrack | |
| baby powder | |
| balsam | |
| banana | |
| bayberry | |
| blackberry | |
| bluebell | |
| blueberry | |
| bouquet | |
| broom genet genista | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coconut tropical coconut | |
| crabapple blossom | |
| cream | |
| decumaria | |
| dillenia | |
| fern fougere | |
| fetes | |
| fir needle | |
| fixer | |
| floral | |
| florida breeze | |
| forest pine forest | |
| fresh | |
| gardenia | |
| ginger white ginger | |
| gingerbread | |
| habuba | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| honeysuckle chevrefeuille | |
| hops houblon | |
| hugonia | |
| hyacinth jacinthe | |
| japan flowers | |
| je reviens | |
| leather russian leather | |
| lemon | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| lotus | |
| magnolia | |
| meadow | |
| mimosa wattle | |
| mint | |
| monimia | |
| muguet lily of the valley | |
| musk | |
| my sin | |
| narcissus narcisse | |
| nemesia | |
| neroli | |
| nut pistachio | |
| ophira | |
| orchid | |
| oriental | |
| orris iris | |
| passion blossom | |
| patchouli | |
| peach | |
| pina colada | |
| powder | |
| pumpkin | |
| rain | |
| rose | |
| sandalwood | |
| scandal | |
| spice | |
| sweet pea pois de senteur | |
| tide | |
| tobacco tabac tabaco | |
| tonka | |
| tuberose tubereuse | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| woody | |
| natural occurrence in : | |
| blueberry | |
| camphor wood | |
| chicken | |
| dill | |
| melon | |
| pepper black pepper | |
| sherry | |
| spirea ulmaria | |
| vanilla | |
| violet flower | |