| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-methoxybenzaldehyde | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H8O2/c1-10-8-5-3-2-4-7(8)6-9/h2-6H,1H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | PKZJLOCLABXVMC-UHFFFAOYAR | |||||||||||||||||||||||||||||||||
| SMILES : | COC1=CC=CC=C1C=O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | unspecified | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | anisic | |||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description¹ : at 10.00 % in propylene glycol. | sweet powdery hawthorn guaiacol vanilla acetophenone almond | |||||||||||||||||||||||||||||||||
| taste description² : | at 50.00 ppm in water. sweet powdery guaiacol musty vanilla floral almond | |||||||||||||||||||||||||||||||||
| substantivity : | 18 hour(s) at 10.00 % in propylene glycol | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to cream amber crystalline powder | |||||||||||||||||||||||||||||||||
| assay : | 97.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| specific gravity : | 1.17000 - 1.13260 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.736 to 9.424 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.46000 - 1.56000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| melting point : | 37.00 - 38.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 243.00 - 244.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 122.00 °C. @ 20.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 1.72 | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2500.00 mg/kg FCTXAV 17,855,1979 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5000.00 mg/kg FCTXAV 17,855,1979 | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 244.00 °F. TCC ( 117.78 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for ortho-anisaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | ||||||||||||||||||||||||||||||||||
| publication number : 22. | ||||||||||||||||||||||||||||||||||
| 4077 | average usual ppm | average maximum ppm | ||||||||||||||||||||||||||||||||
| baked goods : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||||||
| beverages(nonalcoholic) : | 1.00000 | 10.00000 | ||||||||||||||||||||||||||||||||
| beverages(alcoholic) : | 3.00000 | 30.00000 | ||||||||||||||||||||||||||||||||
| breakfast cereal : | - | - | ||||||||||||||||||||||||||||||||
| cheese : | - | - | ||||||||||||||||||||||||||||||||
| chewing gum : | 30.00000 | 50.00000 | ||||||||||||||||||||||||||||||||
| condiments / relishes : | - | - | ||||||||||||||||||||||||||||||||
| confectionery froastings : | 5.00000 | 20.00000 | ||||||||||||||||||||||||||||||||
| egg products : | - | - | ||||||||||||||||||||||||||||||||
| fats / oils : | - | - | ||||||||||||||||||||||||||||||||
| fish products : | - | - | ||||||||||||||||||||||||||||||||
| frozen dairy : | 5.00000 | 20.00000 | ||||||||||||||||||||||||||||||||
| fruit ices : | 1.00000 | 10.00000 | ||||||||||||||||||||||||||||||||
| gelatins / puddings : | - | - | ||||||||||||||||||||||||||||||||
| granulated sugar : | - | - | ||||||||||||||||||||||||||||||||
| gravies : | - | - | ||||||||||||||||||||||||||||||||
| hard candy : | 10.00000 | 20.00000 | ||||||||||||||||||||||||||||||||
| imitation dairy : | - | - | ||||||||||||||||||||||||||||||||
| instant coffee / tea : | 5.00000 | 50.00000 | ||||||||||||||||||||||||||||||||
| jams / jellies : | 1.00000 | 10.00000 | ||||||||||||||||||||||||||||||||
| meat products : | - | - | ||||||||||||||||||||||||||||||||
| milk products : | 5.00000 | 20.00000 | ||||||||||||||||||||||||||||||||
| nut products : | - | - | ||||||||||||||||||||||||||||||||
| other grains : | - | - | ||||||||||||||||||||||||||||||||
| poultry : | - | - | ||||||||||||||||||||||||||||||||
| processed fruits : | - | - | ||||||||||||||||||||||||||||||||
| processed vegetables : | - | - | ||||||||||||||||||||||||||||||||
| reconstituted vegetables : | - | - | ||||||||||||||||||||||||||||||||
| seasonings / flavors : | - | - | ||||||||||||||||||||||||||||||||
| snack foods : | - | - | ||||||||||||||||||||||||||||||||
| soft candy : | 5.00000 | 20.00000 | ||||||||||||||||||||||||||||||||
| soups : | - | - | ||||||||||||||||||||||||||||||||
| sugar substitutes : | - | - | ||||||||||||||||||||||||||||||||
| sweet sauces : | - | - | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 205-171-7 | |||||||||||||||||||||||||||||||||
| rtecs : | BZ2610000 for 135-02-4 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000135024 | |||||||||||||||||||||||||||||||||
| epa-srs : | 135-02-4 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 58960 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 000135024 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1492675823 | |||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (2006)¹ | |||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (2006)² | |||||||||||||||||||||||||||||||||
| synonyms : | |
| 2- | anisaldehyde |
| ortho- | anisaldehyde |
| ortho- | anisic aldehyde |
| ortho- | formyl anisole |
| 2- | methoxybenzaldehyde |
| 6- | methoxybenzaldehyde |
| ortho- | methoxybenzaldehyde |
| 2- | methoxybenzene carboxaldehyde |
| 2- | methoxyphenyl formaldehyde |
| salicylaldehyde methyl ether | |
| soluble in : | |
| alcohol | |
| propylene glycol | |
| water, 2950 mg/L @ 25C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetanisole | |
| acetoin | |
| acetophenone | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| anethol | |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl cinnamate | |
| iso | bornyl acetate |
| cassia bark oil | |
| celery seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| coumarin | |
| cuminaldehyde | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| dimethyl hydroquinone | |
| ethyl cinnamate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl salicylate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropin | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hydroxycitronellal | |
| ionones | |
| lilyall | |
| alpha- | methyl cinnamaldehyde |
| methyl isoeugenol | |
| musks | |
| beta- | naphthyl ethyl ether |
| beta- | naphthyl methyl ether |
| neroli oil | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| petitgrain oil | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| storax resinoid | |
| alpha- | terpineol |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| woody acetate | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond | |
| amber | |
| ambrene | |
| anise | |
| apple | |
| apricot | |
| balsam | |
| banana | |
| bouquet | |
| broom genet genista | |
| cassia | |
| cassie acacia farnesiana | |
| cherry | |
| cherry blossom | |
| chypre | |
| cinnamon | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| crabapple blossom | |
| elder blossom | |
| fennel | |
| fern fougere | |
| floral | |
| gardenia | |
| ginger white ginger | |
| gooseberry | |
| grape | |
| grass sweet grass | |
| hawthorn | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hibiscus | |
| honey miel | |
| honeysuckle chevrefeuille | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| linden blossom limeflower tilleul | |
| magnolia | |
| melon watermelon muskmelon cantaloupe | |
| mimosa wattle | |
| moss | |
| nut walnut | |
| orange | |
| orchid | |
| oriental | |
| pear | |
| peppermint | |
| pineapple | |
| powder | |
| raspberry | |
| sassafras | |
| spearmint | |
| spice | |
| strawberry | |
| sweet pea pois de senteur | |
| tuberose tubereuse | |
| tutti frutti | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| woody | |
| ylang ylang cananga | |
| natural occurrence in : | |
| cassia oil | |
| cinnamon bark | |
| data page | cinnamon bark oil (cinnamomum zeylanicum blume) sri lauka @ 0.09-0.15% |