Notes :
Blends well with rose bases.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 1-cyclohexylethanone | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | KWOLFJPFCHCOCG-UHFFFAOYAT | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)C1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2914.30.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | sweet pungent hawthorn mimosa almond chemical | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 3.50 - 10.00 ppm. Powdery, bitter almond cherry pit-like with coumarinic and fruity nuances | |||||||||||||||||||||||||||||||||||
| substantivity : | 7 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid but solid at low temps | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.02500 - 1.03200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.529 to 8.587 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.53300 - 1.53600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 19.00 - 20.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 202.00 - 203.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 114.00 - 115.00 °C. @ 50.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 1.58 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 815.00 mg/kg 26(8),53,1982 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 15900.00 ul/kg 26(8),53,1982 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 179.00 °F. TCC ( 81.67 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for acetophenone usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for acetophenone usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 20.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-759-4 | |||||||||||||||||||||||||||||||||||
| rtecs : | AM5250000 for 98-86-2 | |||||||||||||||||||||||||||||||||||
| toxnet : | 98-86-2 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 98-86-2 | |||||||||||||||||||||||||||||||||||
| pubchem : | 98-86-2 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 26, No. 2, 40, (2001)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| acetophenone | |
| acetyl benzene | |
| acetyl benzol | |
| benzoyl methide | |
| benzoylmethide | |
| methyl phenyl ketone | |
| 1- | phenyl ethanone |
| phenyl methyl ketone | |
| 1- | phenyl-1-ethanone |
| 1- | phenylethanone |
| soluble in : | |
| chloroform | |
| diethyl phthalate | |
| essential oils | |
| ether | |
| ethyl alcohol, 5 volumes of 50% alcohol | |
| glycerol | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| amyris wood oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| anise seed oil | |
| benzoin resinoid | |
| benzophenone | |
| benzyl acetate | |
| bergamot oil | |
| iso | bornyl acetate |
| caramel furanone | |
| cassia bark oil | |
| castoreum absolute | |
| cedarwood oil atlas | |
| cinnamaldehyde | |
| citral | |
| citronella oil | |
| coumarin | |
| dihydroanethol | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl phenyl acetate | |
| frankincense oil | |
| guaiacwood oil | |
| heliotropin | |
| heliotropyl acetone | |
| immortelle absolute | |
| labdanum resinoid | |
| maltol | |
| methyl benzoate | |
| methyl phenyl acetate | |
| 2- | methyl undecanal |
| musks | |
| myrrh oil | |
| gamma- | octalactone |
| patchouli oil | |
| rose bases | |
| alpha- | terpineol |
| tonka bean absolute | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond | |
| amber | |
| beef roasted beef | |
| bubblegum | |
| butterscotch | |
| cassie acacia farnesiana | |
| castoreum | |
| cherry | |
| chocolate cocoa | |
| cranberry | |
| fern fougere | |
| floral | |
| hawthorn | |
| hay new mown hay foin coupe | |
| herbal | |
| labdanum | |
| lavender | |
| leather russian leather | |
| lemon | |
| lilac lilas syringa | |
| mimosa wattle | |
| nut | |
| orris iris | |
| rose | |
| strawberry | |
| tea green tea | |
| tobacco tabac tabaco | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| natural occurrence in : | |
| beef roasted beef 401 ppm | |
| castoreum absolute | |
| castoreum extract | |
| cocoa 463 ppm | |
| cranberry 5 ppm | |
| elsholtzia argyi var. nipponica | |
| elsholtzia citiata | |
| grape concord grape | |
| labdanum | |
| o. citraliferum | |
| o. linalooliferum var. laerolinalooliferum | |
| o. sabinotiferum var. taiwanense | |
| orris | |
| orthodon species | |
| pea green pea | |
| populus balsaifera | |
| raspberry | |
| stirlingia latifolia 90% | |
| strawberry 11 ppm | |
| tea green tea | |