Notes :
dilute to 10% with benzyl or phenethyl alcohol for best results.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-phenylpropanal | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | IQVAERDLDAZARL-UHFFFAOYAN | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(C=O)C1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| IUPAC name : | (2R)-2-phenylpropanal | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3/t8-/m0/s1 | |||||||||||||||||||||||||||||||||||
| InChIKey : | IQVAERDLDAZARL-QMMMGPOBBE | |||||||||||||||||||||||||||||||||||
| SMILES : | C[C@@H](C=O)C1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| IUPAC name : | (2S)-2-phenylpropanal | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H10O/c1-8(7-10)9-5-3-2-4-6-9/h2-8H,1H3/t8-/m1/s1 | |||||||||||||||||||||||||||||||||||
| InChIKey : | IQVAERDLDAZARL-MRVPVSSYBG | |||||||||||||||||||||||||||||||||||
| SMILES : | C[C@H](C=O)C1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| export tariff code : | 2912.29.5000 | |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||||
| Fleurchem : | hydratropic aldehyde | |||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | 2-Phenyl propionaldehyde
≥95%, FCC, Kosher, FG | |||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | fresh sharp green hyacinth leaf lilac | |||||||||||||||||||||||||||||||||||
| substantivity : | 24 Hour(s) | |||||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 97.00 to 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.00100 to 1.00900 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.329 to 8.396 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.00200 to 1.01000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.347 to 8.414 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.51800 to 1.52300 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 92.00 to 94.00 °C. @ 12.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 222.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 1.98 | |||||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2800.00 mg/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg NTIS** OTS0572460 | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 110.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-USA) : | 6.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 169.00 °F. TCC ( 76.11 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for 2-phenyl propionaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for 2-phenyl propionaldehyde usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 1.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-255-5 | |||||||||||||||||||||||||||||||||||
| RTECS : | CY1460000 for 93-53-8 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000093538 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 93-53-8 | |||||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 93-53-8 | |||||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 93-53-8 | |||||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 93-53-8 | |||||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 93-53-8 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 5231 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 1340-11-0 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 1340-11-0 | |||||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 1340-11-0 | |||||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 1340-11-0 | |||||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 1340-11-0 | |||||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 1340-11-0 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 34713-70-7 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 34713-70-7 | |||||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 34713-70-7 | |||||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 34713-70-7 | |||||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 34713-70-7 | |||||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 34713-70-7 | |||||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 1467 | |||||||||||||||||||||||||||||||||||
| fl. number : | 05.038 | |||||||||||||||||||||||||||||||||||
| pubchem : | 150184 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 831065283 | |||||||||||||||||||||||||||||||||||
| pubchem : | 43760044 | |||||||||||||||||||||||||||||||||||
| pubchem : | 588475 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| cumene aldehyde | |
| alpha- | formyl ethyl benzene |
| hyacinthal | |
| hydratropa aldehyde | |
| hydratropaldehyde | |
| hydratropic aldehyde | |
| hydrotropic aldehyde | |
| alpha- | methyl benzene acetaldehyde |
| alpha- | methyl phenyl acetaldehyde |
| alpha- | methyl tolualdehyde |
| alpha- | methyl-alpha-toluic aldehyde |
| 2- | phenyl propanal |
| alpha- | phenyl propanal |
| 2- | phenyl propionaldehyde |
| alpha- | phenyl propionaldehyde |
| 2- | phenyl-1-propanal |
soluble in : | |
| alcohol | |
| fixed oils | |
insoluble in : | |
| water | |
| glycerin | |
stability : | |
| alkalis | |
| bath foam | |
| hair spray | |
| non-discoloring in most media | |
| powder | |
| soap | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl propionate | |
| benzyl salicylate | |
| bois de rose oil | |
| cinnamyl alcohol | |
| citronellol | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclohexyl ethyl alcohol | |
| 9- | decen-1-ol |
| dimethyl benzyl carbinol | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| ethyl laurate | |
| ethyl vanillin | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| green acetate | |
| heliotropin | |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nonanal | |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| 3- | phenyl propionaldehyde |
| rhodinol | |
| rose butanoate | |
| 10- | undecen-1-al |
(odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| artichoke | |
| blackberry | |
| broom genet genista | |
| carnation dianthus oeillet | |
| cherry | |
| cherry blossom | |
| chocolate cocoa | |
| cinq fleurs forvil | |
| crabapple blossom | |
| elderberry | |
| evergreen | |
| flower | |
| frangipanni plumeria | |
| fresh | |
| gardenia | |
| grapefruit | |
| green | |
| honey miel | |
| hyacinth jacinthe | |
| jasmin | |
| jonquil narcissus jonquilla | |
| leaf | |
| lilac lilas syringa | |
| lily | |
| magnolia | |
| mushroom | |
| narcissus narcisse | |
| neroli | |
| nut walnut | |
| orange | |
| peach | |
| pear | |
| powder | |
| pumpkin | |
| raspberry | |
| rose | |
| rose leaf | |
| sweet pea pois de senteur | |
| tamarind | |
| tea | |
| tea green tea | |
| tobacco tabac tabaco | |
| verbena verveine | |
| wallflower giroflee | |
natural occurrence in : | |
| not found in nature | |