undecanoic acid (Click)
IUPAC Name: undecanoic acid
Std.InChI: InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)
InChI: InChI=1/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)
Std.InChIKey: ZDPHROOEEOARMN-UHFFFAOYSA-N
InChIKey: ZDPHROOEEOARMN-UHFFFAOYAS
SMILES: CCCCCCCCCCC(=O)O
|
CAS Number: | 112-37-8 |
|
ECHA EINECS - REACH Pre-Reg: | 203-964-2 |
FDA UNII: | 138ON3IIQG |
Nikkaji Web: | J1.993C |
Beilstein Number: | 1759287 |
MDL: | MFCD00002730 |
CoE Number: | 696 |
XlogP3: | 3.70 (est) |
Molecular Weight: | 186.29474000 |
Formula: | C11 H22 O2 |
BioActivity Summary: | listing |
NMR Predictor: | Predict (works with chrome or firefox) |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Appearance: | colorless crystals (est) |
Assay: | 97.00 to 100.00 %
|
Food Chemicals Codex Listed: | No |
Melting Point: | 28.00 to 31.00 °C. @ 760.00 mm Hg
|
Boiling Point: | 228.00 °C. @ 160.00 mm Hg
|
Boiling Point: | 164.00 to 165.00 °C. @ 15.00 mm Hg
|
Congealing Point: | 27.00 °C.
|
Vapor Pressure: | 0.002000 mm/Hg @ 25.00 °C. (est) |
Flash Point: | > 230.00 °F. TCC ( > 110.00 °C. )
|
logP (o/w): | 4.420 |
Soluble in: |
| alcohol | | water, 52.2 mg/L @ 30 °C (exp) |
Insoluble in: |
| water |
Organoleptic Properties:
Odor Type: | waxy |
Odor Strength: | medium |
| waxy creamy cheesy fatty coconut |
Odor Description: at 100.00 %. | waxy creamy cheese fatty coconut |
| waxy creamy cheesy fatty coconut |
Odor Description:
| Waxy, creamy, cheese-like, with a fatty coconut nuance Mosciano, Gerard P&F 16, No. 6, 43, (1991) |
| waxy creamy cheesy fatty dairy |
Taste Description: at 20.00 ppm. | Waxy, creamy, cheese-like with a fatty dairy mouthfeel Mosciano, Gerard P&F 16, No. 6, 43, (1991) |
| |
Cosmetic Information:
Suppliers:
Safety Information:
Preferred SDS: View |
European information : |
Most important hazard(s): | Xi - Irritant |
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
|
Hazards identification |
|
Classification of the substance or mixture |
GHS Classification in accordance with 29 CFR 1910 (OSHA HCS) |
None found. |
GHS Label elements, including precautionary statements |
|
Pictogram | |
|
Hazard statement(s) |
None found. |
Precautionary statement(s) |
None found. |
Oral/Parenteral Toxicity: |
intravenous-mouse LD50 140 mg/kg Acta Pharmacologica et Toxicologica. Vol. 18, Pg. 141, 1961.
|
Dermal Toxicity: |
Not determined
|
Inhalation Toxicity: |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
Recommendation for undecanoic acid usage levels up to: | | 0.5000 % in the fragrance concentrate.
|
|
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 4 |
Click here to view publication 4 |
| average usual ppm | average maximum ppm |
baked goods: | - | 2.00000 |
beverages(nonalcoholic): | - | - |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | - | - |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | - | - |
fruit ices: | - | - |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | - | - |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
acidic |
acidic |
iso | butyric acid | FL/FR |
| cyclohexyl acetic acid | FL/FR |
balsamic |
| cinnamyl benzoate | FL/FR |
bready |
| coffee furanone | FL/FR |
buttery |
| acetoin | FL/FR |
| acetyl butyryl | FL/FR |
| acetyl isobutyryl | FL/FR |
| acetyl propionyl | FL/FR |
| butyl butyryl lactate | FL/FR |
| butyl octanoate | FL/FR |
2,3- | heptane dione | FL/FR |
3,4- | hexane dione | FL/FR |
caramellic |
alpha,alpha- | dimethyl anisyl acetone | FL/FR |
cheesy |
| butyric acid | FL/FR |
2- | methyl hexanoic acid | FL/FR |
2- | methyl valeric acid | FL/FR |
(R)-gamma- | nonalactone | FL/FR |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
delta- | octalactone | FL/FR |
delta- | undecalactone | FL/FR |
creamy |
| creamy lactone | FL/FR |
| waxy lactone | FL/FR |
fatty |
| butter esters | FL/FR |
| butyl undecylenate | FL/FR |
(Z)- | dairy lactone | FL/FR |
(S)-gamma- | heptalactone | |
| lauric acid | FL/FR |
4- | methyl octanoic acid | FL/FR |
| octanoic acid | FL/FR |
floral |
| benzyl lactate | FL/FR |
| jasmin pyranone | FL/FR |
| linalyl butyrate | FL/FR |
fruity |
| acetoin acetate | FL/FR |
gamma- | decalactone | FL/FR |
| ethyl lactate | FL/FR |
| octen-1-yl cyclopentanone | FL/FR |
| prenyl isobutyrate | FL/FR |
2- | undecanone | FL/FR |
green |
3- | heptanone | FL/FR |
(Z)-4- | heptenal | FL/FR |
(Z)-3- | hexen-1-yl butyrate | FL/FR |
(E)-2- | hexenal | FL/FR |
mushroom |
1- | octen-3-yl butyrate | FL/FR |
musk |
iso | ambrettolide | FL/FR |
nutty |
2- | ethyl pyrazine | FL/FR |
oily |
| butter acids | FL/FR |
soapy |
| ethyl undecanoate | FL/FR |
sulfurous |
| methyl mercaptan | FL/FR |
tropical |
delta- | dodecalactone | FL/FR |
waxy |
9- | decenoic acid | FL/FR |
| ethyl myristate | FL/FR |
2- | methyl heptanoic acid | FL/FR |
| methyl laurate | FL/FR |
| myristic acid | FL/FR |
| octyl isobutyrate | FL/FR |
| palmitic acid | FR |
delta- | tetradecalactone | FL/FR |
|
For Flavor |
|
No flavor group found for these |
| benzyl lactate | FL/FR |
| butyl octanoate | FL/FR |
| cinnamyl benzoate | FL/FR |
6- | decenoic acid | FL |
alpha,alpha- | dimethyl anisyl acetone | FL/FR |
(E,E)-2,4- | heptadien-1-ol | FL |
2,4- | heptadien-1-ol | FL |
(S)-gamma- | heptalactone | |
| lauric acid | FL/FR |
S- | methyl 4-methyl pentane thioate | FL |
5- | methyl hexanoic acid | FL |
3-( | methyl thio) hexanal | FL |
(R)-gamma- | nonalactone | FL/FR |
| prenyl isobutyrate | FL/FR |
| sodium 4-methyl-2-oxovalerate | FL |
acidic |
iso | butyric acid | FL/FR |
(E)-2- | hexenoic acid | FL |
alliaceous |
3- | tetrahydrothiophenone | FL |
bitter |
| glyceryl tributyrate | FL |
buttery |
| butyroin | FL |
| diacetyl | FL |
2,3- | heptane dione | FL/FR |
3,4- | hexane dione | FL/FR |
2- | methyl valeric acid | FL/FR |
(E)-2- | pentenoic acid | FL |
delta- | tetradecalactone | FL/FR |
caramellic |
3- | methyl butyl 2-furyl butyrate | FL |
cheesy |
(E)-2,4- | dimethyl-2-pentenoic acid | FL |
coconut |
gamma- | nonalactone (aldehyde C-18 (so-called)) | FL/FR |
delta- | octalactone | FL/FR |
creamy |
| acetoin | FL/FR |
| acetyl butyryl | FL/FR |
| acetyl isobutyryl | FL/FR |
| butter esters | FL/FR |
| butter fat enzyme modified with added butyric acid | FL |
| butyl butyryl lactate | FL/FR |
cream | cheese flavor | FL |
| creamy lactone | FL/FR |
5,5- | dibutyl dihydrofuran-2(3H)-one | FL |
delta- | dodecalactone | FL/FR |
| jasmin pyranone | FL/FR |
| octyl isobutyrate | FL/FR |
delta- | undecalactone | FL/FR |
| waxy lactone | FL/FR |
fatty |
| butter acids | FL/FR |
(Z)- | dairy lactone | FL/FR |
| diacetyl trimer | FL |
4- | methyl octanoic acid | FL/FR |
2,4- | octadien-1-ol | FL |
(E,E)-2,4- | undecadienal | FL |
floral |
| linalyl butyrate | FL/FR |
fruity |
| acetoin acetate | FL/FR |
| acetyl isovaleryl | FL |
gamma- | decalactone | FL/FR |
| ethyl lactate | FL/FR |
| octen-1-yl cyclopentanone | FL/FR |
green |
(Z)-4- | heptenal | FL/FR |
(Z)-3- | hexen-1-yl butyrate | FL/FR |
(E)-2- | hexenal | FL/FR |
ketonic |
3- | heptanone | FL/FR |
mushroom |
1- | octen-3-yl butyrate | FL/FR |
musk |
iso | ambrettolide | FL/FR |
nutty |
| coffee furanone | FL/FR |
2- | ethyl pyrazine | FL/FR |
oily |
2- | methyl hexanoic acid | FL/FR |
soapy |
| octanoic acid | FL/FR |
sour |
| butyric acid | FL/FR |
sulfurous |
| methyl mercaptan | FL/FR |
sweet |
| cyclohexyl acetic acid | FL/FR |
toasted |
| acetyl propionyl | FL/FR |
waxy |
| butyl undecylenate | FL/FR |
9- | decenoic acid | FL/FR |
| ethyl myristate | FL/FR |
| ethyl undecanoate | FL/FR |
2- | methyl heptanoic acid | FL/FR |
| methyl laurate | FL/FR |
| myristic acid | FL/FR |
2- | undecanone | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
1- | decane carboxylic acid | 1- | decanecarboxylic acid | | hendecanoic acid | N- | undecanoic acid | | undecoic acid | N- | undecoic acid | | undecylic acid | N- | undecylic acid | | undekansaeure |
Articles:
|