| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||||
| IUPAC name : | butanoic acid | |||||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C4H8O2/c1-2-3-4(5)6/h2-3H2,1H3,(H,5,6)/f/h5H | |||||||||||||||||||||||||||||||||||||
| InChIKey : | FERIUCNNQQJTOY-JSWHHWTPCW | |||||||||||||||||||||||||||||||||||||
| SMILES : | CCCC(=O)O | |||||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||||
| fda reg : | 182.60 | h. number : | 2915.60.0000 | |||||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||||
| odor type : | cheesy | |||||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in dipropylene glycol. | sharp dairy cheese butter fruit | |||||||||||||||||||||||||||||||||||||
| taste description³ : | at 250.00 ppm. Acidic sour, cheesy, dairy, creamy with a fruity nuance | |||||||||||||||||||||||||||||||||||||
| substantivity : | 24 Hour(s) | |||||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||||
| specific gravity : | 0.85200 - 0.95600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.089 to 7.955 | |||||||||||||||||||||||||||||||||||||
| refractive index : | 1.39700 - 1.39900 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||||
| melting point : | -7.00 - -5.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||||
| boiling point : | 162.00 - 164.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||||
| boiling point : | 90.00 - 91.00 °C. @ 50.00 mm Hg | |||||||||||||||||||||||||||||||||||||
| logp : | 0.79 | |||||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | C - Corrosive. | |||||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2.00 gm/kg | |||||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 530.00 ul/kg | |||||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 167.00 °F. TCC ( 75.00 °C. ) | |||||||||||||||||||||||||||||||||||||
| recommendation for butyric acid usage levels up to : | ||||||||||||||||||||||||||||||||||||||
| 0.0500 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||||
| recommendation for butyric acid usage levels up to : | ||||||||||||||||||||||||||||||||||||||
| 270.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-532-3 | |||||||||||||||||||||||||||||||||||||
| rtecs : | ES5425000 for 107-92-6 | |||||||||||||||||||||||||||||||||||||
| chemidplus : | 000107926 | |||||||||||||||||||||||||||||||||||||
| epa-srs : | 107-92-6 | |||||||||||||||||||||||||||||||||||||
| dtp/nci : | 8415 | |||||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||||
| pubchem : | 151005 | |||||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2589720300 | |||||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 19, No. 2, 55, (1994)³ | |||||||||||||||||||||||||||||||||||||
| synonyms : | |
| butanic acid | |
| butanoic acid | |
| N- | butanoic acid |
| butyric acid | |
| 1- | butyric acid |
| N- | butyric acid |
| ethyl acetic acid | |
| 1- | propane carboxylic acid |
| propyl formic acid | |
| soluble in : | |
| alcohol | |
| fixed oils | |
| propylene glycol | |
| water, 60000 mg/L @ 25C | |
| insoluble in : | |
| paraffin oil | |
| (odor and/or flavor) used in : | |
| apple | |
| banana | |
| barley | |
| beef roasted beef | |
| beer | |
| bramble arctic bramble | |
| bread white bread | |
| butter | |
| butterscotch | |
| castoreum | |
| cheese blue cheese | |
| cheese cheddar cheese | |
| cheese swiss cheese | |
| cherry | |
| chocolate cocoa | |
| cider | |
| citronella | |
| cloudberry bakeapple | |
| coffee | |
| currant | |
| eucalyptus | |
| fish | |
| grape | |
| honey miel | |
| hops houblon | |
| mace | |
| melon watermelon muskmelon cantaloupe | |
| mushroom | |
| natural | |
| nut | |
| nut peanut | |
| nut pistachio | |
| nut walnut | |
| nutmeg | |
| onion | |
| papaya | |
| passion fruit | |
| peach | |
| pear | |
| pineapple | |
| plum brandy | |
| sauerkraut | |
| sherry | |
| soybean | |
| tea green tea | |
| tomato | |
| trassi | |
| valerian | |
| yogurt | |
| natural occurrence in : | |
| anise seed | |
| apple | |
| arctic bramble | |
| banana | |
| barley roasted barley | |
| beef heated beef | |
| beer | |
| bergamot plant wild | |
| blackberry | |
| brandy grape brandy | |
| brandy pear brandy | |
| brandy plum brandy | |
| bread | |
| bread white bread | |
| butter | |
| cajuput | |
| cheese bleu cheese | |
| cheese cheddar cheese | |
| cheese swiss cheese | |
| cherry | |
| cider | |
| citronella ceylon | |
| cloudberry | |
| cocoa | |
| coffee | |
| coffee roasted coffee | |
| currant | |
| dairy products | |
| eucalyptus globulus | |
| fish | |
| fish | |
| fruits | |
| grape | |
| honey | |
| hop | |
| lavender | |
| meat | |
| milk | |
| morello | |
| mushroom | |
| niaouli | |
| nutmeg | |
| nuts | |
| onion roasted onion | |
| data page | osmanthus absolute @ trace% |
| papaya | |
| passion fruit | |
| peach | |
| peanut roasted peanut | |
| pear | |
| pennyroyal | |
| pork heated pork | |
| potato chip | |
| raspberry fruit | |
| rum | |
| sauerkraut | |
| sherry | |
| soya bean | |
| strawberry | |
| tea | |
| tomato | |
| trassi cooked trassi | |
| valerian | |
| vegetables | |
| whiskey | |
| wine | |
| yogurt | |