| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 1-(3,3-dimethylcyclohexyl)ethyl acetate | |||||||||||||||||||||||
| InChI : | InChI=1/C12H22O2/c1-9(14-10(2)13)11-6-5-7-12(3,4)8-11/h9,11H,5-8H2,1-4H3 | |||||||||||||||||||||||
| InChIKey : | YWVSYRJWCROMKO-UHFFFAOYAD | |||||||||||||||||||||||
| SMILES : | CC(C1CCCC(C1)(C)C)OC(=O)C | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| export tariff code : | 2915.39.9050 | |||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||
| International Flavors & Fragrances : | Rosamusk | |||||||||||||||||||||||
| ≥85% (sum of isomers) | ||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description : at 100.00 %. | floral rose musk fruity geranium | |||||||||||||||||||||||
| substantivity : | 3 hour(s) at 100.00 % | |||||||||||||||||||||||
properties : | ||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||
| assay : | 85.00 - 100.00 % sum of isomers | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 0.92200 - 0.93200 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 7.672 to 7.755 | |||||||||||||||||||||||
| specific gravity : | 0.92300 - 0.93300 @ 20.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 7.689 to 7.773 | |||||||||||||||||||||||
| refractive index : | 1.44500 - 1.45100 @ 20.00 °C. | |||||||||||||||||||||||
| logp : | 4.15 | |||||||||||||||||||||||
safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | 191.00 °F. TCC ( 88.33 °C. ) | |||||||||||||||||||||||
| recommendation for musk acetate usage levels up to : | ||||||||||||||||||||||||
| 20.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for musk acetate usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 246-737-3 | |||||||||||||||||||||||
| chemidplus : | 025225109 | |||||||||||||||||||||||
| epa-srs : | 25225-10-9 | |||||||||||||||||||||||
other : | ||||||||||||||||||||||||
references : | ||||||||||||||||||||||||
| pubchem : | 668078 | |||||||||||||||||||||||
| synonyms : | |
| musk acetate | |
| rosamusk | |
| alpha,3,3- | trimethyl cyclohexane-1-methanol acetate |
| alpha-3,3- | trimethyl cyclohexane-1-methanyl acetate |
| alpha,3,3- | trimethyl cyclohexyl methyl acetate |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| acid cleaner | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | butyl cinnamate |
| cedarwood oils | |
| cinnamyl alcohol | |
| citronellol | |
| clove bud oil | |
| coriander seed oil | |
| costus valerolactone | |
| coumarin | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| decanol | |
| 9- | decen-1-al |
| decyl acetate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| diphenyl oxide | |
| ethyl cinnamate | |
| ethyl vanillin | |
| fir balsam absolute | |
| floral pyranol | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| geranium oil | |
| guaiacwood oil | |
| heliotropin | |
| heliotropyl acetone | |
| gamma- | heptalactone |
| (Z)-3- | hexen-1-yl propionate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| laevo- | linalool |
| linalool oxide | |
| methyl anthranilate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nonanol | |
| nutmeg oil | |
| ocean propanal | |
| gamma- | octalactone |
| orangeflower absolute | |
| orris pyridine | |
| patchouli ethanone | |
| peony alcohol | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl propionate | |
| phenyl acetaldehyde | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rhodinol | |
| rose butanoate | |
| santall | |
| alpha- | terpineol |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanol | |
| 10- | undecen-1-al |
| vanilla absolute | |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| algae | |
| ash mountain ash | |
| ash mountain ash blossom | |
| bark | |
| blossom | |
| botanical | |
| boxwood | |
| burberry | |
| carnation dianthus oeillet | |
| cherry black cherry | |
| cherry blossom | |
| christmas blends | |
| cilantro | |
| cloth clean cloths | |
| clover trefle le'trefle incarnat | |
| crabapple blossom | |
| dahlia | |
| daisy | |
| daphne | |
| davana | |
| dewy | |
| dillenia | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| flouve blossom | |
| freesia | |
| fungus | |
| geranium | |
| gingergrass | |
| herbal | |
| hugonia | |
| leaf autumn leaf | |
| lily | |
| maja | |
| mango blossom | |
| musk | |
| natural | |
| new car | |
| orchid | |
| peony | |
| petal waxy petal | |
| plum blossom | |
| rose | |
| rose d'orient | |
| rose red rose | |
| sap | |
| stock evening scented stock | |
| tropical | |
| tulip | |
| valerian | |
| waxy | |
| wet fields | |
| wistaria wisteria glycine | |
| natural occurrence in : | |
| not found in nature | |