Notes :
Partial replacement for safrol and root beer types.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 1-methoxy-4-propylbenzene | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H14O/c1-3-4-9-5-7-10(11-2)8-6-9/h5-8H,3-4H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | KBHWKXNXTURZCD-UHFFFAOYAQ | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCC1=CC=C(C=C1)OC | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | unspecified | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | anisic | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | sweet anise licorice sassafrass fennel | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 1.00 - 15.00 ppm. Intense herbal fennel sweetness reminiscent of black licorice, sassafras and anise. It has slight spicy basil-like nuances | |||||||||||||||||||||||||||||||||||
| substantivity : | 4 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear oily liquid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.94000 - 0.94300 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.822 to 7.847 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.50200 - 1.50600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 212.00 - 213.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 104.00 - 107.00 °C. @ 20.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 3.66 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 4400.00 mg/kg TXAPA9 6,378,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 13,789,1975 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 194.00 °F. TCC ( 90.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for dihydroanethol usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for dihydroanethol usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 70.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-203-4 | |||||||||||||||||||||||||||||||||||
| rtecs : | BZ9450000 for 104-45-0 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000104450 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 104-45-0 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 37996 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 1244 | |||||||||||||||||||||||||||||||||||
| fl. number : | 04.039 | |||||||||||||||||||||||||||||||||||
| pubchem : | 150791 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3573840002 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 25, No. 6, 26, (2000)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| dihydroanethol | |
| dihydroanethole | |
| 1- | methoxy-4-propyl benzene |
| methyl para-propyl phenyl ether | |
| 4- | propyl anisole |
| 4-N- | propyl anisole |
| para- | propyl anisole |
| para-N- | propyl anisole |
| 4- | propyl methoxybenzene |
| para- | propyl methoxybenzene |
| soluble in : | |
| alcohol | |
| fixed oils | |
| insoluble in : | |
| glycerin | |
| propylene glycol | |
| water | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| amerinal | |
| iso | amyl benzoate |
| iso | amyl butyrate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| amyris wood oil | |
| (E)- | anethol |
| para- | anisaldehyde |
| anise seed oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| bay leaf oil | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl propionate | |
| blood orange oil | |
| bois de rose oil | |
| caramel furanone | |
| caraway seed oil | |
| carrot seed oil | |
| laevo- | carvone |
| cassia bark oil | |
| christmas blends | |
| clove bud oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| ethyl cinnamate | |
| ethyl heptanoate | |
| ethyl vanillin | |
| fennel seed oil | |
| fir balsam absolute | |
| floral pyranol | |
| guaiacwood oil | |
| heliotropin | |
| heliotropyl diethyl acetal | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| lavender absolute | |
| leerall | |
| lilyall | |
| linalool oxide | |
| maltol | |
| methyl 2-methyl valerate | |
| methyl dihydrojasmonate | |
| mimosa absolute | |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| patchouli ethanone | |
| pepper oil black | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| santall | |
| spearmint oil | |
| strawberry glycidate 1 | |
| para- | tolyl aldehyde |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| vanillin | |
| wintergreen oil | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| absinthe | |
| anise | |
| apple blossom | |
| apricot | |
| azzaro | |
| basil | |
| birch beer | |
| blueberry | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| cattle feed | |
| cheese gouda | |
| cherry | |
| clover trefle le'trefle incarnat | |
| detergents | |
| fennel | |
| fern fougere | |
| gardenia | |
| gooseberry | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| honey miel | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jasmin | |
| licorice | |
| lilac lilas syringa | |
| lily | |
| magnolia | |
| metropolis | |
| mimosa wattle | |
| mint | |
| myrrhis odorata | |
| nut | |
| pizza | |
| quince | |
| rootbeer | |
| sassafras | |
| spice | |
| strawberry | |
| tuberose tubereuse | |
| tuscany | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wintergreen | |
| woody | |
| ylang ylang cananga | |
| natural occurrence in : | |
| katsubushi | |