| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | methyl 2-(2-cyclohexylethylideneamino)benzoate | |||||||||||||||||||||||
| InChI : | InChI=1/C16H15NO2/c1-19-16(18)14-9-5-6-10-15(14)17-12-11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3/b17-12+ | |||||||||||||||||||||||
| InChIKey : | UTUBQSIVMXUACR-SFQUDFHCBP | |||||||||||||||||||||||
| SMILES : | COC(=O)C1=CC=CC=C1N=CCC2=CC=CC=C2 | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||
| odor description :¹ at 10.00 % in dipropylene glycol. | hyacinth green foliage floral mandarin sweet pea | |||||||||||||||||||||||
| substantivity : | 244 Hour(s) | |||||||||||||||||||||||
properties : | ||||||||||||||||||||||||
| appearence : | yellow viscous liquid to solid | |||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 1.10270 to 1.11160 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 9.176 to 9.250 | |||||||||||||||||||||||
| refractive index : | 1.55590 to 1.56630 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 414.00 to 415.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| flash point : | 230.00 °F. TCC ( 110.00 °C. ) | |||||||||||||||||||||||
| logP (o/w) : | 4.48 | |||||||||||||||||||||||
safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||
| recommendation for phenyl acetaldehyde / methyl anthranilate schiff's base usage levels up to : | ||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||
| WGK Germany : | 3 | |||||||||||||||||||||||
| methyl 2-(2-cyclohexylethylideneamino)benzoate | ||||||||||||||||||||||||
| (EINECS) number : | 267-070-4 | |||||||||||||||||||||||
| chemidplus : | 067785766 | |||||||||||||||||||||||
| EPA Substance Registry Services : | 67785-76-6 | |||||||||||||||||||||||
references : | ||||||||||||||||||||||||
| methyl 2-(2-cyclohexylethylideneamino)benzoate | ||||||||||||||||||||||||
| pubchem : | 683032 | |||||||||||||||||||||||
other : | ||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1987)¹ | |||||||||||||||||||||||
| synonyms : | |
| methyl (2-phenyl ethylidene) anthranilate | |
| methyl 2-((2-phenyl ethylidene)amino) benzoate | |
| methyl 2-(2-cyclohexylethylideneamino)benzoate | |
| methyl anthranilate / phenyl acetaldehyde schiff's base | |
| methyl N-(2-phenyl ethylidene) anthranilate | |
| phenylacetaldehyde / methyl anthranilate schiff's base | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl propionate | |
| benzyl salicylate | |
| bois de rose oil | |
| cinnamyl alcohol | |
| citronellol | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclohexyl ethyl alcohol | |
| 9- | decen-1-ol |
| dimethyl benzyl carbinol | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| ethyl laurate | |
| ethyl vanillin | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| green acetate | |
| heliotropin | |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nonanal | |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| 3- | phenyl propionaldehyde |
| rhodinol | |
| rose butanoate | |
| 10- | undecen-1-al |
(odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| artichoke | |
| blackberry | |
| broom genet genista | |
| carnation dianthus oeillet | |
| cherry | |
| cherry blossom | |
| chocolate cocoa | |
| cinq fleurs forvil | |
| crabapple blossom | |
| elderberry | |
| evergreen | |
| flower | |
| frangipanni plumeria | |
| fresh | |
| gardenia | |
| grapefruit | |
| green | |
| hyacinth jacinthe | |
| jasmin | |
| jonquil narcissus jonquilla | |
| lilac lilas syringa | |
| lily | |
| magnolia | |
| narcissus narcisse | |
| neroli | |
| orange | |
| peach | |
| pear | |
| powder | |
| pumpkin | |
| raspberry | |
| rose | |
| sweet pea pois de senteur | |
| tea | |
| tea green tea | |
| tobacco tabac tabaco | |
| verbena verveine | |
| wallflower giroflee | |
natural occurrence in : | |
| not found in nature | |