| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 2-(furan-2-ylmethoxymethyl)furan |
| InChI : | InChI=1/C10H10O3/c1-3-9(12-5-1)7-11-8-10-4-2-6-13-10/h1-6H,7-8H2 |
| InChIKey : | YEQMNLGBLPBBNI-UHFFFAOYAZ |
| SMILES : | C1=COC(=C1)COCC2=CC=CO2 |
| cas number : | 4437-22-3 |
| beilstein number : | 0156726 |
| fema number : | 3337 |
| coe number : | 10930 |
| jecfa number : | 1522 |
| fl. number : | 13.061 |
| molar refractivity : | 46.63 ± 0.3 cm3 |
| parachor : | 383.6 ± 4.0 cm3 |
| index of refraction : | 1.513 ± 0.02 |
| surface tension : | 37.6 ± 3.0 dyne/cm |
| density : | 1.150 ± 0.06 g/cm3 |
| polarizability : | 18.48 ± 0.5 10-24cm3 |
| xlogp : | 0.80 |
| molecular weight : | 178.1846000 |
| formula : | C10 H10 O3 |
|
|
| |
| |
| fda reg : | unspecified |
h. number : | unspecified |
| |
| organoleptics : | |
| odor type : | coffee |
odor description :
| coffee nutty |
| properties : | |
| appearence : | colorless to yellow clear liquid |
| assay : | 97.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 1.50600 - 1.51200 @ 25.00 °C.
|
| pounds per gallon - calc. : | 12.531 to 12.581
|
| refractive index : | 1.13800 - 1.14400 @ 20.00 °C.
|
| boiling point : | 101.00 °C. @ 2.00 mm Hg
|
| boiling point : | 88.00 - 89.00 °C. @ 1.00 mm Hg
|
| acid value : | 1.00 max. KOH/g
|
| logp : | 2.27 |
| safety : | |
| Oral Toxicity(LD50) : |
Oral-Rat 210.00 mg/kg
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 222.00 °F. TCC ( 105.56 °C. )
|
| | |
| safety links : | |
| chemidplus : | 004437223 |
| epa-srs : | 4437-22-3 |
| dtp/nci : | 97234 |
| | |
| other : | |
| |
|
| references : | |
| jecfa number : | 1522 |
| fl. number : | 13.061 |
| pubchem : | 203986 |
| NIST Chemistry WebBook : | 1245507339 |
| | |
|
| synonyms : |
| | difurfuryl ether | | 2,2'- | difurfuryl ether | | 2,2'-(oxy | dimethylene) difuran | | | furfuryl ether | | 2,2'-(oxybis( | methylene)) bisfuran |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| 2- | acetyl furan |
| 2- | acetyl pyrazine |
| | acetyl pyrroline |
| 2- | acetyl-3-methyl pyrazine |
| | benzothiazole |
| | benzyl mercaptan |
| | butyl mercaptan |
| | caramel furanone |
| | cocoa pyrazine |
| 3,6- | cocoa pyrazine |
| | coffee difuran |
| | coffee dione |
| | coffee pyrazine |
| | dicyclohexyl disulfide |
| | difurfuryl sulfide |
| 6,7- | dihydro-2,3-dimethyl-5H-cyclopentapyrazine |
| | diisoamyl thiomalate |
| | dimethyl dihydrocyclopentapyrazine |
| 2,3- | dimethyl pyrazine |
| 2,6- | dimethyl pyrazine |
| 2,4- | dimethyl thiazole |
| 2,5- | dimethyl thiazole |
| 4,5- | dimethyl thiazole |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 2,5- | dimethyl-3-thiofuroyl furan |
| | ethyl 3-(furfuryl thio) propionate |
| | ethyl methyl sulfide |
| 2- | ethyl-3,5(6)-dimethyl pyrazine mixture |
| | filbert heptenone |
| | furfuryl alcohol |
| | furfuryl isopropyl sulfide |
| | furfuryl mercaptan |
| | furfuryl methyl ether |
| | furfuryl propionate |
| 1- | furfuryl pyrrole |
| | furfuryl thioacetate |
| S- | furfuryl thioformate |
| | furfuryl thiopropionate |
| 2- | heptyl furan |
| 1- | hydroxy-2-butanone |
| | menthofuran |
| 2- | methyl 3-(methyl thio) furan 10% in triacetin |
| 2- | methyl 5-(methyl thio) furan |
| 2- | methyl butyraldehyde |
| | methyl cyclopentenolone |
| | methyl furfuryl disulfide |
| 2- | methyl quinoxaline |
| 5- | methyl quinoxaline |
| 2- | methyl thio-3,5 or 6-methyl pyrazine |
| 2- | methyl-3-,5 or 6-(furfuryl thio) pyrazine |
| 2- | methyl-5-isopropyl pyrazine |
| | nutty quinoxaline |
| 2- | propionyl-2-thiazoline |
| | sulfuryl butyrate |
| | sulfuryl decanoate |
| | sulfuryl formate |
| | sulfuryl hexanoate |
| | sulfuryl isobutyrate |
| | sulfuryl octanoate |
| | sulfuryl propionate |
| 2,3,5,6- | tetramethyl pyrazine |
| 2- | thienyl mercaptan |
| 2- | thiophene thiol |
| 2,4,5- | trimethyl thiazole |
| 2,6- | xylenol |
| (odor and/or flavor) used in : |
| | coffee | | | nut |
| natural occurrence in : |
| coffee |
|