| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 2,2-dimethoxyethylbenzene | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H14O2/c1-11-10(12-2)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | WNJSKZBEWNVKGU-UHFFFAOYAB | |||||||||||||||||||||||||||||||||||
| SMILES : | COC(CC1=CC=CC=C1)OC | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2911.00.5000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | green foliage floral rosy earthy mushroom | |||||||||||||||||||||||||||||||||||
| substantivity : | 100 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.00000 - 1.00600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.321 to 8.371 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.49300 - 1.49500 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 219.00 - 221.00 °C. @ 754.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.07 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3500.00 ul/kg FCTXAV 13,899,1975 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >2.00 ml/kg FCTXAV 13,899,1975 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 187.00 °F. TCC ( 86.11 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for phenyl acetaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 3.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for phenyl acetaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 202-945-6 | |||||||||||||||||||||||||||||||||||
| rtecs : | AB3040000 for 101-48-4 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000101484 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 101-48-4 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 5174 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 197216 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2791051876 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| 2,2- | dimethoxy-1-phenyl ethane |
| 1,1- | dimethoxy-2-phenyl ethane |
| (2,2- | dimethoxyethyl) benzene |
| hyscylene p | |
| phenacetaldehyde dimethyl acetal | |
| phenyl acetaldehyde dimethyl acetal | |
| 2- | phenyl acetaldehyde dimethyl acetal |
| phenyl acetic aldehyde dimethyl acetal | |
| phenylacetaldehyde dimethyl acetal | |
| rosal | |
| alpha- | tolyl aldehyde dimethyl acetal |
| viridine | |
| soluble in : | |
| fixed oils | |
| paraffin oil | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| alkalis | |
| amines | |
| ammonia | |
| bath foam | |
| cream | |
| hair spray | |
| lotion | |
| non-discoloring in most media | |
| powder | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| amber carbinol | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl propionate | |
| benzyl salicylate | |
| bois de rose oil | |
| cinnamyl alcohol | |
| citronellol | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| cyclohexyl ethyl alcohol | |
| decanol | |
| 9- | decen-1-ol |
| dihydrojasmone | |
| dimethyl benzyl carbinol | |
| dimethyl hydroquinone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl vanillin | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| green acetate | |
| heliotropin | |
| heliotropyl acetone | |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl isoeugenol | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| nonanal | |
| nonanol | |
| oakmoss absolute | |
| ocean propanal | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenethyl salicylate | |
| phenyl acetaldehyde | |
| 3- | phenyl propionaldehyde |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| alpha- | terpineol |
| tonka bean absolute | |
| 10- | undecen-1-al |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| apple blossom | |
| bluebell | |
| carnation dianthus oeillet | |
| champaca champak | |
| cherry | |
| cherry blossom | |
| coconut tropical coconut | |
| cyclamen | |
| earth humus | |
| floral | |
| florida water | |
| foliage | |
| freshener | |
| gardenia | |
| geranium | |
| grass green grass | |
| green | |
| greenhouse | |
| herbal | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jasmin | |
| leaf green leaf | |
| lilac lilas syringa | |
| lily | |
| linden blossom limeflower tilleul | |
| magnolia | |
| muguet lily of the valley | |
| narcissus narcisse | |
| neroli | |
| orange blossom fleur d'oranger | |
| outdoors fresh outdoors | |
| peony | |
| plum greengage plum | |
| plum mirabelle plum | |
| rain | |
| rose | |
| rose centifolia | |
| rose red rose | |
| rose tea rose | |
| rose white rose | |
| spice | |
| sweet pea pois de senteur | |
| tobacco tabac tabaco flower | |
| tuberose tubereuse | |
| violet leaf | |
| natural occurrence in : | |
| cocoa | |