Notes :
Modifier in delicate florals.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 1,1-dimethoxy-3,7-dimethylocta-2,6-diene | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H22O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,9,12H,6,8H2,1-5H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | ZSKAJFSSXURRGL-UHFFFAOYAU | |||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCCC(=CC(OC)OC)C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| IUPAC name : | (2E)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H22O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,9,12H,6,8H2,1-5H3/b11-9+ | |||||||||||||||||||||||||||||||||
| InChIKey : | ZSKAJFSSXURRGL-PKNBQFBNBV | |||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCC/C(=C/C(OC)OC)/C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| IUPAC name : | (2Z)-1,1-dimethoxy-3,7-dimethylocta-2,6-diene | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H22O2/c1-10(2)7-6-8-11(3)9-12(13-4)14-5/h7,9,12H,6,8H2,1-5H3/b11-9- | |||||||||||||||||||||||||||||||||
| InChIKey : | ZSKAJFSSXURRGL-LUAWRHEFBT | |||||||||||||||||||||||||||||||||
| SMILES : | CC(=CCC/C(=C\C(OC)OC)/C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| export tariff code : | 2911.00.5000 | |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||
| International Flavors & Fragrances : | Citral Dimethyl Acetal
≥93% (sum of acetals) | |||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Citral dimethyl acetal
≥95%, Kosher | |||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | citrus | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | green floral citric lemon lime natural | |||||||||||||||||||||||||||||||||
| substantivity : | 7 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 93.00 to 100.00 % sum of isomers | |||||||||||||||||||||||||||||||||
| additional assay information : | sum of Z and E isomers | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.88500 to 0.89300 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.364 to 7.431 | |||||||||||||||||||||||||||||||||
| specific gravity : | 0.88600 to 0.89400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.381 to 7.448 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.45400 to 1.46000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 105.00 to 106.00 °C. @ 10.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 197.00 to 199.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 2.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 3.76 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 2.60 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 180.00 °F. TCC ( 82.22 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for citral dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for citral dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||
| 60.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 231-434-0 | |||||||||||||||||||||||||||||||||
| RTECS : | RG5330000 for 7549-37-3 | |||||||||||||||||||||||||||||||||
| chemidplus : | 007549373 | |||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 7549-37-3 | |||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 7549-37-3 | |||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 7549-37-3 | |||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 7549-37-3 | |||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 7549-37-3 | |||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||
| jecfa number : | 944 | |||||||||||||||||||||||||||||||||
| fl. number : | 06.005 | |||||||||||||||||||||||||||||||||
| pubchem : | 166705 | |||||||||||||||||||||||||||||||||
| pubchem : | 10543344 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1104576295 | |||||||||||||||||||||||||||||||||
| pubchem : | 10543350 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2063155012 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| citral dimethyl acetal | |
| 1,1- | dimethoxy-3,7-dimethyl-2,6-octadiene |
| 3,7- | dimethyl-2,6-octadienal dimethyl acetal |
| geranial dimethyl acetal | |
| neral dimethyl acetal | |
soluble in : | |
| alcohol | |
| dipropylene glycol | |
insoluble in : | |
| water | |
| glycerin | |
stability : | |
| alkalis | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
(odor and/or flavor) blends with : | |
| alpha- | amyl cinnamaldehyde |
| benzylidene acetone | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| cinnamaldehyde | |
| citronella oil | |
| citronellal | |
| citronellol | |
| citronellyl acetate | |
| citronellyl nitrile | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanal | |
| decanol | |
| (E)-4- | decen-1-al |
| dihydromyrcenol | |
| dihydroterpineol | |
| dimethyl anthranilate | |
| dimethyl cyclohexenyl pentenone | |
| diphenyl oxide | |
| dodecanal | |
| elemi resin | |
| iso | eugenol |
| geraniol | |
| geranyl acetate | |
| geranyl nitrile | |
| grapefruit oil | |
| grapefruit pentanol | |
| green dioxolane | |
| heliotropin | |
| alpha- | hexyl cinnamaldehyde |
| ionones | |
| 2,4- | ivy carbaldehyde |
| lavender absolute | |
| leerall | |
| lemon oil | |
| lemongrass oil | |
| lime oil | |
| laevo- | limonene |
| linalool | |
| laevo- | linalool |
| linalyl acetate | |
| litsea cubeba oil | |
| mandarin oil | |
| methyl heptenone | |
| muguet octadienol | |
| nerol | |
| octanal | |
| olibanum oil | |
| orange oil | |
| orange oil bitter | |
| petitgrain oil | |
| phellandrene | |
| phenethyl alcohol | |
| rose butanoate | |
| tangerine oil | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| gamma- | undecalactone |
| verbena oil | |
(odor and/or flavor) used in : | |
| abronia | |
| agrumen | |
| aldehydic | |
| apple | |
| apple green apple | |
| apricot | |
| balsam | |
| bergamot | |
| blackberry | |
| blueberry | |
| cedrat | |
| cherry | |
| citronella | |
| citrus | |
| coconut tropical coconut | |
| cologne | |
| colonia | |
| curacao | |
| fir needle | |
| floral | |
| flower | |
| fresh | |
| fruit | |
| gardenia | |
| geranium | |
| grapefruit | |
| green | |
| herbal | |
| honeysuckle chevrefeuille | |
| hyacinth jacinthe | |
| jonquil narcissus jonquilla | |
| lemon | |
| lemongrass | |
| lime | |
| linden blossom limeflower tilleul | |
| litsea cubeba | |
| magnolia | |
| mandarin | |
| melon watermelon muskmelon cantaloupe | |
| neroli | |
| orange | |
| orange blossom fleur d'oranger | |
| passion fruit | |
| peach | |
| peel | |
| petitgrain | |
| petitgrain lemon petitgrain | |
| pineapple | |
| raspberry | |
| rose | |
| rose red rose | |
| rose tea rose | |
| rose white rose | |
| seedy | |
| strawberry | |
| topnotes | |
| vanilla | |
| verbena verveine | |
| woody | |
natural occurrence in : | |
| data page | valerian root oil china @ 0.33% |