| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 1-methoxy-2-methylbenzene |
| InChI : | InChI=1/C8H10O/c1-7-5-3-4-6-8(7)9-2/h3-6H,1-2H3 |
| InChIKey : | DTFKRVXLBCAIOZ-UHFFFAOYAG |
| SMILES : | CC1=CC=CC=C1OC |
| (EINECS) number : | 209-426-3 |
| cas number : | 578-58-5 |
| fema number : | 2680 |
| coe number : | 187 |
| jecfa number : | 1242 |
| fl. number : | 04.014 |
| molar refractivity : | 37.75 ± 0.3 cm3 |
| parachor : | 301.5 ± 4.0 cm3 |
| index of refraction : | 1.493 ± 0.02 |
| surface tension : | 29.2 ± 3.0 dyne/cm |
| density : | 0.941 ± 0.06 g/cm3 |
| polarizability : | 14.96 ± 0.5 10-24cm3 |
| xlogp : | 2.20 |
| molecular weight : | 122.1644000 |
| formula : | C8 H10 O |
|
|
| |
| |
| fda reg : | 172.515 |
h. number : | 3909.30 |
| |
| organoleptics : | |
| odor type : | naphthyl |
| odor strength : | medium ,
recommend smelling in a 1.00 % solution or less |
odor description :
at 1.00 % in dipropylene glycol. | sweet nutty floral earthy walnut |
| properties : | |
| appearence : | colorless clear liquid |
| assay : | 99.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.98500 @ 25.00 °C.
|
| refractive index : | 1.51600 @ 20.00 °C.
|
| boiling point : | 170.00 - 172.00 °C. @ 760.00 mm Hg
|
| boiling point : | 63.00 - 64.00 °C. @ 14.00 mm Hg
|
| logp : | 2.74 |
| safety : | |
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 125.00 °F. TCC ( 51.67 °C. )
|
| | |
| recommendation for 2-methyl anisole usage levels up to : | | | 2.0000 % in the fragrance concentrate.
|
| | |
| recommendation for 2-methyl anisole usage levels up to : | | | 50.0000 ppm in the flavor.
|
| | |
| safety links : | |
| (EINECS) number : | 209-426-3 |
| chemidplus : | 000578585 |
| epa-srs : | 578-58-5 |
| dtp/nci : | 6253 |
| | |
| other : | |
| |
|
| references : | |
| jecfa number : | 1242 |
| fl. number : | 04.014 |
| pubchem : | 197385 |
| NIST Chemistry WebBook : | 1756580020 |
| | |
|
| synonyms : |
| ortho- | cresyl methyl ether | | 1- | methoxy-2-methyl benzene | | 2- | methoxytoluene | | ortho- | methoxytoluene | | 2- | methyl anisole | | ortho- | methyl anisole | | 2- | methyl methoxybenzene | | | methyl ortho-cresyl ether | | 2- | methyl ortho-tolyl ether |
| soluble in : |
| | alcohol | | | water, 450 mg/L @ 25C |
| insoluble in : |
| | water |
| (odor and/or flavor) blends with : |
| | acetyl acetaldehyde dimethyl acetal |
| | acetyl propionyl |
| 2- | acetyl pyrazine |
| 3- | acetyl pyridine |
| 2- | acetyl pyrrole |
| | acetyl pyrroline |
| 2- | acetyl thiazole |
| 2- | acetyl-2-thiazoline |
| 5- | acetyl-2,3-dihydro-1,4-thiazine |
| 3- | acetyl-2,5-dimethyl furan |
| 2- | acetyl-3-ethyl pyrazine |
| 2- | acetyl-3-methyl pyrazine |
| 2- | acetyl-3,5-dimethyl pyrazine |
| 2- | acetyl-5-methyl furan |
| | allyl 2-ethyl butyrate |
| iso | amyl nonanoate |
| alpha- | angelica lactone |
| | benzothiazole |
| | bornyl isobutyrate |
| | boronia butenal |
| | butyrophenone |
| | chocolate pyrazine A |
| | chocolate pyrazine B |
| | cocoa pyrazine |
| 3,6- | cocoa pyrazine |
| | coconut absolute |
| | coffee furanone |
| | coumane |
| | coumarin |
| para- | cresyl laurate |
| | cyclohexyl methyl pyrazine |
| (E,E)-2,4- | decadien-1-al |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| 2,5- | diethyl-4-methyl thiazole |
| | difurfuryl ether |
| 6,7- | dihydro-2,3-dimethyl-5H-cyclopentapyrazine |
| | dihydroxyacetophenone |
| | dimethyl dihydrocyclopentapyrazine |
| 2,3- | dimethyl pyrazine |
| 2,5- | dimethyl pyrazine |
| 2,6- | dimethyl pyridine |
| 2,5- | dimethyl thiazole |
| 4,5- | dimethyl thiazole |
| 2,5- | dimethyl thiophene |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 2,4- | dimethyl-5-vinyl thiazole |
| | earthy acetal |
| 2- | ethoxythiazole |
| | ethyl 2-hydroxy-2-methyl butyrate |
| 2- | ethyl pyrazine |
| 1- | ethyl-2-acetyl pyrrole |
| 5- | ethyl-2-methyl pyridine |
| 2- | ethyl-3-methoxypyrazine |
| 2- | ethyl-4-methyl thiazole |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| | filbert heptenone |
| | filbert pyrazine |
| | furfuryl thioacetate |
| 3-(2- | furyl) acrolein |
| | hazelnut oleoresin |
| | hazelnut pyrazine |
| (E,E)-2,4- | heptadien-1-ol |
| gamma- | heptalactone |
| 2- | heptyl furan |
| 2,4- | hexadien-1-ol |
| 3,4- | hexane dione |
| 2- | hexyl-5 or 6-keto-1,4-dioxane |
| 4- | hydroxybenzoic acid |
| (Z)- | linalool oxide (furanoid) |
| | maraniol |
| | menthofuran |
| 2- | methoxypyrazine |
| | methyl 2-(methyl thio) acetate |
| para- | methyl anisole |
| 2- | methyl butyraldehyde |
| | methyl cyclocitrone |
| 2- | methyl pyrazine |
| 2- | methyl quinoxaline |
| 5- | methyl quinoxaline |
| 4- | methyl thiazole |
| 2- | methyl thio-3,5 or 6-methyl pyrazine |
| 2-( | methyl thio) acetaldehyde |
| | methyl valerate |
| 3- | methyl-2-buten-1-al |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-propyl pyrazine |
| 2- | methyl-3,(5 or 6)-ethoxypyrazine |
| 2- | methyl-4-phenyl butanal |
| 2- | methyl-5-isopropyl pyrazine |
| (E,E)-2,4- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-yl acetate |
| | nutty cyclohexenone |
| | nutty quinoxaline |
| | nutty thiazole |
| (Z)-2- | octen-1-al |
| | peanut dithiazine |
| | peanut oxazole |
| | phenyl acetaldehyde 2,3-butylene glycol acetal |
| 2- | phenyl propionaldehyde dimethyl acetal |
| | popcorn pyrimidine |
| | propionaldehyde |
| 2- | propionyl thiazole |
| 2- | propionyl-2-thiazoline |
| | propyl benzoate |
| iso | propyl pyrazine |
| 2- | propyl pyridine |
| | saffron pyranone |
| | salicylic acid |
| | sandalwood oil |
| | shoyu pyrazine |
| | styralyl butyrate |
| | sulfuryl butyrate |
| | sulfuryl decanoate |
| | sulfuryl formate |
| | sulfuryl hexanoate |
| | sulfuryl isobutyrate |
| | sulfuryl octanoate |
| | sulfuryl propionate |
| 2,3,5,6- | tetramethyl pyrazine |
| | tobacco butenal |
| | tonka bean absolute |
| | tonka bean resinoid |
| 3,5,5- | trimethyl hexanol |
| 2,3,5- | trimethyl pyrazine |
| | tropical thiazole |
| | valeraldehyde |
| | valeraldehyde dibutyl acetal |
| | valeraldehyde propylene glycol acetal |
| 2- | vinyl pyrazine |
| | vinyl sulfurol |
| | whiskey lactone |
| (odor and/or flavor) used in : |
| | bread | | | cherry | | | coffee | | | earth humus | | | herbal | | | nut filbert | | | nut hazelnut | | | nut walnut | | | vanilla |
| natural occurrence in : |
| data page | cascarilla bark oil @ 0.02% |
| clam |
| coffee |
| filbert |
| katsuobushi |
| maize |
| rice wild rice |
| data page | rue oil china @ 0.02% |
|