Fragrance Demo Formulas |
2-(4-methyl-1-cyclohex-3-enyl)propan-2-yl propanoate (Click)
IUPAC Name: 2-(4-methyl-1-cyclohex-3-enyl)propan-2-yl propanoate
Std.InChI: InChI=1S/C13H22O2/c1-5-12(14)15-13(3,4)11-8-6-10(2)7-9-11/h6,11H,5,7-9H2,1-4H3
InChI: InChI=1/C13H22O2/c1-5-12(14)15-13(3,4)11-8-6-10(2)7-9-11/h6,11H,5,7-9H2,1-4H3
Std.InChIKey: CMKQOKAXUWQAHG-UHFFFAOYSA-N
InChIKey: CMKQOKAXUWQAHG-UHFFFAOYAX
SMILES: CCC(=O)OC(C)(C)C1CCC(=CC1)C
|
CAS Number: | 80-27-3 |
|
Other: | 1334-92-5 |
ECHA EINECS - REACH Pre-Reg: | 201-266-2 |
FDA UNII: | 7JE9M43B3K |
Nikkaji Web: | J141.005I |
MDL: | MFCD00213794 |
FEMA Number: | 3053 |
CoE Number: | 423 |
XlogP3-AA: | 2.90 (est) |
Molecular Weight: | 210.31674000 |
Formula: | C13 H22 O2 |
NMR Predictor: | Predict (works with chrome or firefox) |
2-(4-methyl-1-cyclohex-3-enyl)propan-2-yl propanoate (Click)
IUPAC Name: 2-(4-methyl-1-cyclohex-3-enyl)propan-2-yl propanoate
InChI: InChI=1/C13H22O2/c1-5-12(14)15-13(3,4)11-8-6-10(2)7-9-11/h6,11H,5,7-9H2,1-4H3
InChIKey: CMKQOKAXUWQAHG-UHFFFAOYAX
SMILES: CCC(=O)OC(C)(C)C1CCC(=CC1)C
|
CAS Number: | 62395-45-3 |
|
ECHA EINECS - REACH Pre-Reg: | 263-530-3 |
FDA UNII: | 3GKH6X9TE3 |
XlogP3-AA: | 2.90 (est) |
Molecular Weight: | 210.31674000 |
Formula: | C13 H22 O2 |
NMR Predictor: | Predict (works with chrome or firefox) |
Category: flavor and fragrance agents
US / EU / FDA / JECFA / FEMA / FLAVIS / Scholar / Patent Information:
Physical Properties:
Organoleptic Properties:
Odor Type: | green |
Odor Strength: | medium |
Odor Description: at 100.00 %. | herbal green old wood citrus geranium tropical |
Substantivity: | 32 Hour(s) |
| |
Cosmetic Information:
Safety Information:
Most important hazard(s): | Xi - Irritant |
|
R 36/38 - Irritating to skin and eyes. S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing.
|
Human Experience: | 4 % solution: no irritation or sensitization. |
Oral/Parenteral Toxicity: | |
oral-rat LD50 > 5000 mg/kg (Moreno, 1973q)
|
Dermal Toxicity: | |
Not determined
|
Inhalation Toxicity: | |
Not determined
|
Safety in Use Information:
Category: | flavor and fragrance agents |
Recommendation for terpinyl propionate usage levels up to: | | 4.0000 % in the fragrance concentrate.
|
|
Maximised Survey-derived Daily Intakes (MSDI-EU): | 0.024 (μg/capita/day) |
Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). |
The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA Flavor Ingredient Library |
publication number: 3 |
Click here to view publication 3 |
| average usual ppm | average maximum ppm |
baked goods: | 6.00000 | 10.00000 |
beverages(nonalcoholic): | - | 1.50000 |
beverages(alcoholic): | - | - |
breakfast cereal: | - | - |
cheese: | - | - |
chewing gum: | - | - |
condiments / relishes: | - | - |
confectionery froastings: | - | - |
egg products: | - | - |
fats / oils: | - | - |
fish products: | - | - |
frozen dairy: | 2.60000 | 3.00000 |
fruit ices: | 2.60000 | 3.00000 |
gelatins / puddings: | - | - |
granulated sugar: | - | - |
gravies: | - | - |
hard candy: | 6.00000 | 10.00000 |
imitation dairy: | - | - |
instant coffee / tea: | - | - |
jams / jellies: | - | - |
meat products: | - | - |
milk products: | - | - |
nut products: | - | - |
other grains: | - | - |
poultry: | - | - |
processed fruits: | - | - |
processed vegetables: | - | - |
reconstituted vegetables: | - | - |
seasonings / flavors: | - | - |
snack foods: | - | - |
soft candy: | - | - |
soups: | - | - |
sugar substitutes: | - | - |
sweet sauces: | - | - |
Safety References:
References:
Other Information:
Potential Blenders and core components note
|
For Odor |
No odor group found for these |
(-)-gamma- | elemene | |
3- | mercapto-3-methyl-1-hexanol | |
4-(1- | propenyl) pyridine | |
| satinaldehyde | FL/FR |
1-( | thienyl-2)butan-1,2-dione | |
|
| octanal propylene glycol acetal | FL/FR |
acidic |
2- | ethyl butyric acid | FL/FR |
aldehydic |
| agrumen nitrile | FR |
| green hexanal | FL/FR |
| undecanal | FL/FR |
animal |
iso | butyl quinoline | FR |
| methyl (E)-2-octenoate | FL/FR |
anisic |
| estragole | FL/FR |
| ocimum basilicum leaf oil america | FL/FR |
balsamic |
iso | amyl benzoate | FL/FR |
| betula pubescens bud oil | FL/FR |
| cinnamyl formate | FL/FR |
| fir balsam absolute | FR |
| fir balsam concrete | FR |
| linalyl cinnamate | FL/FR |
christmas | pine fragrance | FR |
| spruce needle absolute | FL/FR |
| valerian rhizome absolute | FL/FR |
brown |
sec- | heptyl acetate | FL/FR |
caramellic |
2-iso | butyl-3-methyl pyrazine | FL/FR |
chemical |
| propyl propionate | FL/FR |
citrus |
| bergamot oil italy | FL/FR |
| bergamot oil ivory coast | FL/FR |
| bergamot oil terpeneless | FL/FR |
| citral diethyl acetal | FL/FR |
| citrus ocimenol | FR |
| citrus woody floral fragrance | FR |
iso | decyl acetate | FR |
2- | heptanol | FL/FR |
| lime oil fractions | FR |
(Z)- | linalool oxide (pyranoid) | FL/FR |
| methyl heptenone | FL/FR |
alpha- | methylene citronellal | FR |
| neroli ketone | FR |
| nonanal dimethyl acetal | FL/FR |
| ocimene quintoxide | FL/FR |
| tangerine acetate | FR |
creamy |
3- | heptyl dihydro-5-methyl-2(3H)-furanone | FL/FR |
earthy |
| geosmin | FL/FR |
| methyl 3-hexenoate | FL/FR |
(S)-1- | octen-3-ol | FL/FR |
| acetaldehyde dimethyl acetal | FL/FR |
| cyclohexyl formate | FL/FR |
| ethyl 4-pentenoate | FL/FR |
1- | hexen-3-ol | FL/FR |
| methyl ethyl ketone | FL/FR |
2- | methyl valeraldehyde | FL/FR |
| propyl formate | FL/FR |
fatty |
| allyl octanoate | FL/FR |
3- | decen-2-one | FL/FR |
| ethyl undecylenate | FL/FR |
2- | octenal | FL/FR |
floral |
| cassis oxime 10% | FR |
| cilantro herb oil egypt | FL/FR |
| citronellal | FL/FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| citronellyl butyrate | FL/FR |
| citronellyl formate | FL/FR |
| coriander oil fractions | FL/FR |
| cuminyl acetaldehyde | FL/FR |
black | currant bud concrete | FL/FR |
| cymbopogon validus leaf oil | FR |
beta- | damascenone | FL/FR |
| dictamnus hispanicus oil | FR |
| dihydrocitronellyl ethyl ether | FR |
| dihydrolinalool | FL/FR |
| dihydrorose oxide | FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
2,4- | dimethyl-3-cyclohexene-1-methanol | FR |
2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| gardenia amide | FR |
| geranium oil egypt | FL/FR |
| geranyl propionate | FL/FR |
| glycoacetal | FR |
beta- | ionone | FL/FR |
iso | jasmone | FL/FR |
iso | jasmone | FL/FR |
| karo karounde absolute | FR |
| lilac pentanol | FL/FR |
| linalool | FL/FR |
| linden flower absolute | FR |
| melaleuca ericifolia leaf oil | FR |
para- | methyl benzyl acetate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
| methyl jasmonate | FL/FR |
| nerol | FL/FR |
| nerolidol | FL/FR |
(E)- | nerolidol | FL/FR |
| neryl formate | FL/FR |
3- | nonanone | FL/FR |
beta- | ocimene | FL/FR |
| orange leaf absolute | FL/FR |
| peony acetonitrile | FR |
| phenethyl acetate | FL/FR |
| phenyl acetaldehyde digeranyl acetal | FR |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
iso | phytol | FL/FR |
| prenyl salicylate | FL/FR |
| rhodinyl isobutyrate | FL/FR |
| rose butanoate | FL/FR |
| rose pyran | FR |
| styralyl propionate | FL/FR |
5- | tricyclodecenyl acetate | FR |
fruity |
| allyl butyrate | FL/FR |
| amyl formate | FL/FR |
iso | amyl hexanoate | FL/FR |
iso | amyl isobutyrate | FL/FR |
iso | amyl isovalerate | FL/FR |
| apple ketal | FL/FR |
| benzyl butyrate | FL/FR |
| berry pentadienoate | FL/FR |
| bisabolene | FL/FR |
| butyl 2-decenoate | FL/FR |
3- | butyl bicyclo[3.2.1]-6-octen-2-one | FR |
| butyl hexanoate | FL/FR |
iso | butyl isovalerate | FL/FR |
| cherry pentenoate | FL/FR |
| citronellyl isobutyrate | FL/FR |
| cyclohexyl crotonate | FR |
1,4- | dibutyl-6,8-dioxabicyclo(3.2.1)octane | FR |
1,4- | diisopropyl-6,8-dioxabicyclo(3.2.1)octane | FR |
1,2- | dimethyl propyl 2-butenoate | |
| dimethyl succinate | FL/FR |
| ethyl 2-ethyl acetoacetate | FL/FR |
| ethyl 2-octenoate | FL/FR |
| ethyl 3-hexenoate | FL/FR |
| ethyl levulinate | FL/FR |
(E)- | ethyl tiglate | FL/FR |
1- | ethyl-2-methyl propyl chrysanthemumate | |
| geranyl butyrate | FL/FR |
| geranyl isovalerate | FL/FR |
| grape butyrate | FL/FR |
| grapefruit acetal | FR |
| green acetate | FR |
| hexanal propylene glycol acetal | FL/FR |
2- | hexen-1-ol | FL/FR |
(E)-3- | hexen-1-yl acetate | FL/FR |
| hexyl acetate | FL/FR |
| hexyl isovalerate | FL/FR |
| linalyl isobutyrate | FL/FR |
| methyl acetoacetate | FL/FR |
| methyl heptanoate | FL/FR |
3- | methyl-2-butenal | FL/FR |
| neryl propionate | FL/FR |
2- | nonanone | FL/FR |
| octyl butyrate | FL/FR |
| prenol | FL/FR |
| propyl hexanoate | FL/FR |
| tropical indene | FR |
| tropical thiazole | FL/FR |
garlic |
4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
green |
| actinidia chinensis fruit extract | FL/FR |
| agrumen aldehyde | FR |
| bergoxane | FR |
| bicyclogermacrene | |
| birch leaf specialty | FR |
iso | butyl heptanoate | FL/FR |
iso | butyl methyl ketone | FL/FR |
S-sec- | butyl thioisovalerate | FL/FR |
| carrot leaf oil (daucus carota ssp.maximus) | FR |
| chrysanthemum carbaldehyde | FR |
| citral / diisotridecyl acetal | FR |
alpha- | elemol | FL/FR |
| ethyl (E)-2-hexenoate | FL/FR |
(Z)-beta- | farnesene | |
| fresh nitrile | FR |
| galbanum oil | FL/FR |
| galbanum oleoresin | FL/FR |
| galbanum resinoid | FL/FR |
| green carboxylate | FR |
| green note propionate | FL/FR |
| heptanal (aldehyde C-7) | FL/FR |
1- | heptanol | FL/FR |
| heptyl benzoate | FL/FR |
(E)-4- | hexen-1-ol | |
(E)-3- | hexen-1-ol | FL/FR |
(Z)-3- | hexen-1-yl (Z)-3-hexenoate | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
(E)-2- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
(Z)-3- | hexen-1-yl hexanoate | FL/FR |
(Z)-3- | hexen-1-yl isovalerate | FL/FR |
(Z)-3- | hexen-1-yl lactate | FL/FR |
(Z)-3- | hexen-1-yl oxyacetaldehyde | FR |
(E)-2- | hexen-1-yl salicylate | FR |
(E)-2- | hexen-1-yl valerate | FL/FR |
3- | hexenyl 2-methyl butyrate | FL/FR |
(Z)-3- | hexenyl methyl ether | FR |
| hexyl hexanoate | FL/FR |
3,6- | ivy carbaldehyde | FL/FR |
3,5- | ivy carbaldehyde | FL/FR |
| ivy carbaldehyde | FL/FR |
2,4- | ivy carbaldehyde | FL/FR |
english | ivy leaf absolute | FR |
dextro- | linalyl acetate | FL/FR |
laevo- | linalyl acetate | FL/FR |
| marigold pot absolute | FL/FR |
| melon heptenal propylene glycol acetal | FL/FR |
| methyl (E)-3-hexenoate | FL/FR |
para- | methyl hydratropaldehyde | FL/FR |
| methyl octine carbonate | FL/FR |
6- | methyl-3-hepten-2-one | FL/FR |
| neryl butyrate | FL/FR |
| octanal diethyl acetal | FL/FR |
(E)-2- | octen-1-ol | FL/FR |
3- | octyl formate | FL/FR |
| phenoxyethyl isobutyrate | FL/FR |
1- | phenyl-2-pentanol | FL/FR |
3- | propyl bicyclo(3.2.1)-6-octen-2-one | FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
| thiogeraniol | FL/FR |
| tiglaldehyde | FL/FR |
| tricyclene-9-butenone | |
2,2,4- | trimethyl-1,3-oxathiane | |
| triplal / ethyl anthranilate schiff's base | FR |
| valerian rhizome oil CO2 extract china | FL/FR |
9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
| anethum graveolens herb oil | FL/FR |
| anethum graveolens herb tincture | FL/FR |
| anthemis nobilis flower extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| apium graveolens seed oil | FL/FR |
| apium graveolens seed oil india | FL/FR |
| artemisia alba oil | FR |
sweet | basil absolute | FL/FR |
| bornyl salicylate | FR |
(+)-alpha- | campholenic aldehyde | FL/FR |
| canarium luzonicum oil | FL/FR |
| chrysanthemum ketone | FR |
| coriander oleoresin | FL/FR |
iso | dihydrolavandulal | FL/FR |
| dihydroterpinyl acetate | FL/FR |
| dill weed oil cuba | FL/FR |
| dill weed oil reunion | FL/FR |
| dimethyl benzyl carbinyl formate | FL/FR |
2-(2,4- | dimethyl-3-cyclohexene-1-yl)-4,4-dimethyl-1,3-oxathiane | FR |
| freesia heptanol | FL/FR |
| geranic oxide | FL/FR |
| guava leaf oil cuba | FR |
cis- | herbal cyclohexane | FR |
| herbal dioxane | FR |
| herbal heptane | FR |
| hexanol | FL/FR |
| hop absolute | FL/FR |
| hop oil | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
| lantana camara flower oil | FR |
| linalyl acetate | FL/FR |
| linalyl formate | FL/FR |
| marigold oil mexico | FL/FR |
| melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
1-(2- | methyl allyl oxy) heptane | FR |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
| mistletoe absolute | |
| monarda fistulosa oil | FR |
| nonisyl formate | FR |
(E,Z)-3,5- | octadien-2-one | |
1- | octen-3-yl acetate | FL/FR |
3- | octyl acetate | FL/FR |
| oregano specialty | FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
2- | pentyl acetate | FL/FR |
| perilla leaf oil | FL/FR |
| perillaldehyde | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| phenyl acetaldehyde diisoamyl acetal | FR |
| prenyl senecioate | FL/FR |
| reseda absolute | FR |
| rosmarinus officinalis extract | FL/FR |
| rosmarinus officinalis tincture | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil rwanda | FL/FR |
| terpinolene | FL/FR |
| theaspirane | FL/FR |
| thyme absolute | FL/FR |
| tricyclo(5.2.1.02,6)dec-3-enyl acetate | FR |
| tricyclodecyl acetate | FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
| viridiflorol | FL/FR |
| wormwood oil america | FL/FR |
| wormwood oil italy | FL/FR |
| wormwood oil poland | FL/FR |
melon |
(Z)-6- | nonenal | FL/FR |
minty |
(-)- | menthone | FL/FR |
iso | pulegol | FL/FR |
(-)-iso | pulegol | FL/FR |
2,4,4,6- | tetramethyl cyclohexa-2,5-diene-1-one | FR |
mossy |
| oakmoss absolute | FL/FR |
| treemoss absolute | FR |
orris |
iso | eugenyl formate | FL/FR |
pine |
| pine oil 85 | FR |
soapy |
2- | ethyl decanoic acid | |
| methyl anthranilate / hexyl cinnamaldehyde schiff's base | FR |
spicy |
iso | butyl angelate | FL/FR |
| cuminaldehyde | FL/FR |
iso | cyclogeraniol (IFF) | FR |
2,5- | dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate + 1,4-dimethyl bicyclo(3.2.1)-2-octen-3-yl acetate | FR |
| myrcene | FL/FR |
2- | octanol | FL/FR |
| origanum majorana oil | FL/FR |
| outdoors specialty | FR |
black | pepper oil CO2 extract | FL/FR |
| spicy carbonate | FR |
sulfurous |
| lychee mercaptan acetate | FL/FR |
| mango thiol | FL/FR |
4- | methoxy-2-methyl butane thiol | FL/FR |
| passiflora acetate | FL/FR |
terpenic |
| cassis bud oil | FL/FR |
para- | cymene | FL/FR |
| juniper branch oil | FR |
alpha- | phellandrene | FL/FR |
alpha- | terpineol | FL/FR |
tropical |
cis- | galbanum oxathiane | FL/FR |
| passiflora edulis fruit extract | FL/FR |
| psidium guajava fruit extract | FL/FR |
2- | tropical oxathiane | FL/FR |
waxy |
| decanal dimethyl acetal | FL/FR |
| ethyl nonanoate | FL/FR |
| heptyl octanoate | FL/FR |
| methyl octanoate | FL/FR |
2- | nonanol | FL/FR |
| nonyl acetate | FL/FR |
woody |
| bruyere root absolute | FR |
beta- | cadinene | |
| cinnamyl tiglate | FL/FR |
| dalbergia sissoo leaf oil | FR |
6,7- | dihydrolinalool | FL/FR |
| dragons blood fragrance | FR |
beta- | eudesmol | |
(E)-beta- | farnesene | FL/FR |
alpha- | farnesene | FL/FR |
alpha- | farnesene isomer | FL/FR |
| furfuryl thenyl ether | |
| humulus lupulus extract | FL/FR |
iso | longifolene epoxide | FR |
| moss naphthaleneol | FR |
(±)- | tetrahydronootkatone | FL/FR |
alpha- | thujene | |
| verdoxan | FR |
| xanthoxylum alatum roxb. oil | FR |
|
For Flavor |
|
No flavor group found for these |
4- | acetyl-2-isopropenyl pyridine | FL |
9- | acetyl-5-methyl-tricyclo[6.2.1.0.sup.2,7 ]undec-4-ene | |
| betula pubescens bud oil | FL/FR |
| bicyclogermacrene | |
iso | butyl heptanoate | FL/FR |
4- | butyl thiazole | FL |
S-sec- | butyl thioisovalerate | FL/FR |
beta- | cadinene | |
| cinnamyl tiglate | FL/FR |
| decanal dimethyl acetal | FL/FR |
(E,E,Z)-2,4,7- | decatrienal | FL |
2,4,7- | decatrienal | FL |
6,7- | dihydrolinalool | FL/FR |
| dihydroterpinyl acetate | FL/FR |
| dimethyl benzyl carbinyl formate | FL/FR |
1,2- | dimethyl propyl 2-butenoate | |
(-)-gamma- | elemene | |
alpha- | elemol | FL/FR |
| ethyl 4-pentenoate | FL/FR |
2- | ethyl decanoic acid | |
1- | ethyl-2-methyl propyl chrysanthemumate | |
beta- | eudesmol | |
iso | eugenyl formate | FL/FR |
(E)-beta- | farnesene | FL/FR |
(Z)-beta- | farnesene | |
| fig leaf absolute | FL |
| furfuryl thenyl ether | |
| heptyl benzoate | FL/FR |
(E,E)-2,4- | hexadien-1-ol | FL |
3,5- | ivy carbaldehyde | FL/FR |
| ivy carbaldehyde | FL/FR |
(Z)- | linalool oxide (pyranoid) | FL/FR |
dextro- | linalyl acetate | FL/FR |
laevo- | linalyl acetate | FL/FR |
| linalyl formate | FL/FR |
| melaleuca leucadendron var. cajuputi leaf oil | FL/FR |
| melon heptenal propylene glycol acetal | FL/FR |
| methyl acetoacetate | FL/FR |
4- | methyl-2-[2-(methyl thio)ethyl]-1,3-oxathiane | |
(E)-6- | methyl-3-hepten-2-one | FL/FR |
6- | methyl-3-hepten-2-one | FL/FR |
| mistletoe absolute | |
(E,Z)-3,5- | octadien-2-one | |
| octanal propylene glycol acetal | FL/FR |
(S)-1- | octen-3-ol | FL/FR |
2- | octenal | FL/FR |
3- | octyl butyrate | FL |
| perilla leaf oil | FL/FR |
| prenyl senecioate | FL/FR |
| seaweed absolute (fucus vesiculosus et serratus) | FL/FR |
(±)- | tetrahydronootkatone | FL/FR |
alpha- | thujene | |
| tricyclene-9-butenone | |
2,4,4- | trimethyl-1,3-oxathiane | FL |
2,2,4- | trimethyl-1,3-oxathiane | |
2- | tropical oxathiane | FL/FR |
ortho- | vinyl anisole | FL |
| viridiflorol | FL/FR |
acidic |
2- | ethyl butyric acid | FL/FR |
alliaceous |
| tropical thiazole | FL/FR |
astringent |
1-( | thienyl-2)butan-1,2-dione | |
balsamic |
| spruce needle absolute | FL/FR |
| geranic oxide | FL/FR |
6- | hydroxydihydrotheaspirane (mixture of isomers) | FL/FR |
cheesy |
2- | nonanone | FL/FR |
chemical |
| methyl ethyl ketone | FL/FR |
citrus |
| bergamot oil italy | FL/FR |
| bergamot oil ivory coast | FL/FR |
| bergamot oil terpeneless | FL/FR |
| bisabolene | FL/FR |
| citral diethyl acetal | FL/FR |
| freesia heptanol | FL/FR |
| linalool | FL/FR |
| nerol | FL/FR |
| styralyl propionate | FL/FR |
alpha- | terpineol | FL/FR |
coconut |
(R)- | massoia lactone | FL |
cooling |
| theaspirane | FL/FR |
creamy |
| massoia lactone | FL |
dairy |
2- | pentyl acetate | FL/FR |
earthy |
| geosmin | FL/FR |
ethereal |
| acetaldehyde dimethyl acetal | FL/FR |
4- | hexen-3-one | FL |
fatty |
| allyl octanoate | FL/FR |
| ethyl undecylenate | FL/FR |
sec- | heptyl acetate | FL/FR |
(Z)-3- | hexen-1-yl benzoate | FL/FR |
(E)-2- | octen-1-ol | FL/FR |
floral |
| citronellal | FL/FR |
| citronellol | FL/FR |
| citronellyl acetate | FL/FR |
| dihydrolinalool | FL/FR |
| dimethyl benzyl carbinyl butyrate | FL/FR |
2,4- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
4,6- | dimethyl-alpha-allyl-3-cyclohexene methanol | |
| geranium oil egypt | FL/FR |
| linalyl acetate | FL/FR |
| linalyl isobutyrate | FL/FR |
(Z)- | methyl epi-jasmonate | FL/FR |
| methyl jasmonate | FL/FR |
| orange leaf absolute | FL/FR |
| rhodinyl isobutyrate | FL/FR |
| satinaldehyde | FL/FR |
fruity |
iso | amyl benzoate | FL/FR |
| amyl formate | FL/FR |
iso | amyl hexanoate | FL/FR |
iso | amyl isobutyrate | FL/FR |
| apple ketal | FL/FR |
| benzyl butyrate | FL/FR |
| berry pentadienoate | FL/FR |
| butyl 2-decenoate | FL/FR |
| butyl hexanoate | FL/FR |
| cassis bud oil | FL/FR |
| cherry pentenoate | FL/FR |
| citronellyl butyrate | FL/FR |
| citronellyl formate | FL/FR |
| citronellyl isobutyrate | FL/FR |
black | currant bud concrete | FL/FR |
| dimethyl succinate | FL/FR |
| ethyl (E)-2-hexenoate | FL/FR |
| ethyl (E)-2-octenoate | FL |
| ethyl 2-ethyl acetoacetate | FL/FR |
| ethyl 2-octenoate | FL/FR |
| ethyl 3-hexenoate | FL/FR |
| ethyl levulinate | FL/FR |
(E)- | ethyl tiglate | FL/FR |
tropical | fruit flavor | FL |
2- | furyl pentyl ketone | FL |
| geranyl butyrate | FL/FR |
2- | heptanol | FL/FR |
3- | heptyl dihydro-5-methyl-2(3H)-furanone | FL/FR |
2,4- | hexadien-1-ol | FL |
| hexanal propylene glycol acetal | FL/FR |
2- | hexen-1-ol | FL/FR |
(E)-3- | hexen-1-yl acetate | FL/FR |
| hexyl acetate | FL/FR |
| hexyl hexanoate | FL/FR |
| kiwi distillates | FL |
| kiwi flavor | FL |
| lilac pentanol | FL/FR |
| linalyl cinnamate | FL/FR |
| lychee flavor | FL |
3- | mercapto-3-methyl-1-hexanol | |
2- | mercapto-4-heptanol | FL |
3- | mercaptohexyl hexanoate | FL |
| methyl (E)-2-octenoate | FL/FR |
| methyl 3-hexenoate | FL/FR |
para- | methyl benzyl acetate | FL/FR |
| methyl heptanoate | FL/FR |
3- | methyl-2-butenal | FL/FR |
| neryl formate | FL/FR |
(Z)-3- | nonen-1-yl acetate | FL |
(Z)-5- | octen-1-yl acetate | FL |
| papaya guava flavor | FL |
| passion fruit distillates | FL |
2- | phenyl propionaldehyde dimethyl acetal | FL/FR |
1- | phenyl-2-pentanol | FL/FR |
| prenol | FL/FR |
| propyl formate | FL/FR |
| propyl hexanoate | FL/FR |
| rose butanoate | FL/FR |
| tagete oil CO2 extract | FL/FR |
| tagete oil rwanda | FL/FR |
| tiglaldehyde | FL/FR |
| valerian rhizome absolute | FL/FR |
| valerian rhizome oil | FL/FR |
| valerian rhizome oil china | FL/FR |
| valerian rhizome oil CO2 extract china | FL/FR |
green |
| actinidia chinensis fruit extract | FL/FR |
| allyl butyrate | FL/FR |
iso | amyl isovalerate | FL/FR |
| anethum graveolens herb tincture | FL/FR |
iso | butyl angelate | FL/FR |
iso | butyl isovalerate | FL/FR |
iso | butyl methyl ketone | FL/FR |
2-iso | butyl-3-methyl pyrazine | FL/FR |
(+)-alpha- | campholenic aldehyde | FL/FR |
| canarium luzonicum oil | FL/FR |
| celery distillates | FL |
| coriander oleoresin | FL/FR |
| cuminyl acetaldehyde | FL/FR |
| cyclohexyl formate | FL/FR |
3- | decen-2-one | FL/FR |
2- | ethyl butyraldehyde | FL |
alpha- | farnesene | FL/FR |
alpha- | farnesene isomer | FL/FR |
| galbanum oil | FL/FR |
| galbanum oleoresin | FL/FR |
cis- | galbanum oxathiane | FL/FR |
| galbanum resinoid | FL/FR |
| geranyl isovalerate | FL/FR |
| grape butyrate | FL/FR |
| green note propionate | FL/FR |
| heptanal (aldehyde C-7) | FL/FR |
| hexanol | FL/FR |
(E)-3- | hexen-1-ol | FL/FR |
(E)-4- | hexen-1-ol | |
(Z)-3- | hexen-1-yl (Z)-3-hexenoate | FL/FR |
(Z)-3- | hexen-1-yl acetate | FL/FR |
(E)-2- | hexen-1-yl acetate | FL/FR |
(Z)-3- | hexen-1-yl hexanoate | FL/FR |
(Z)-3- | hexen-1-yl isovalerate | FL/FR |
(Z)-3- | hexen-1-yl lactate | FL/FR |
(E)-2- | hexen-1-yl valerate | FL/FR |
1- | hexen-3-ol | FL/FR |
3- | hexenyl 2-methyl butyrate | FL/FR |
| hexyl isovalerate | FL/FR |
3,6- | ivy carbaldehyde | FL/FR |
2,4- | ivy carbaldehyde | FL/FR |
iso | jasmone | FL/FR |
iso | jasmone | FL/FR |
| marigold pot absolute | FL/FR |
| methyl (E)-3-hexenoate | FL/FR |
| methyl 2-undecynoate | FL |
| methyl heptenone | FL/FR |
para- | methyl hydratropaldehyde | FL/FR |
| methyl octanoate | FL/FR |
| methyl octine carbonate | FL/FR |
3-(5- | methyl-2-furyl) butanal | FL |
4- | methyl-2-pentenal | FL |
(E)- | nerolidol | FL/FR |
| nerolidol | FL/FR |
| neryl butyrate | FL/FR |
| neryl propionate | FL/FR |
(E,E)-2,6- | nonadienal | FL |
| nonanal dimethyl acetal | FL/FR |
3- | nonanone | FL/FR |
(Z)-6- | nonenal | FL/FR |
| oakmoss absolute | FL/FR |
beta- | ocimene | FL/FR |
| ocimene quintoxide | FL/FR |
2,4- | octadienal | FL |
(E,E)-2,4- | octadienal | FL |
| octanal diethyl acetal | FL/FR |
1- | octen-3-yl acetate | FL/FR |
3- | octyl acetate | FL/FR |
| phenoxyethyl isobutyrate | FL/FR |
4-(1- | propenyl) pyridine | |
herbal |
| anethum graveolens herb oil | FL/FR |
| anthemis nobilis flower extract | FL/FR |
| anthemis nobilis flower oil roman | FL/FR |
| apium graveolens seed oil | FL/FR |
| apium graveolens seed oil india | FL/FR |
sweet | basil absolute | FL/FR |
| celery seed oleoresin | FL |
| cilantro herb oil egypt | FL/FR |
| coriander oil fractions | FL/FR |
iso | dihydrolavandulal | FL/FR |
| dill weed oil cuba | FL/FR |
| dill weed oil reunion | FL/FR |
| green hexanal | FL/FR |
| hop absolute | FL/FR |
| hop oil | FL/FR |
| marigold oil mexico | FL/FR |
| ocimum basilicum leaf oil america | FL/FR |
| origanum majorana oil | FL/FR |
| origanum oil | FL/FR |
| origanum oil greece | FL/FR |
| petroselinum crispum seed oil CO2 extract | FL/FR |
| prenyl salicylate | FL/FR |
| rosmarinus officinalis extract | FL/FR |
| rosmarinus officinalis tincture | FL/FR |
| thyme absolute | FL/FR |
| wormwood oil america | FL/FR |
| wormwood oil italy | FL/FR |
| wormwood oil poland | FL/FR |
honey |
| phenethyl acetate | FL/FR |
juicy |
| lychee mercaptan acetate | FL/FR |
licorice |
| estragole | FL/FR |
minty |
(-)- | menthone | FL/FR |
(-)-iso | pulegol | FL/FR |
iso | pulegol | FL/FR |
| thiogeraniol | FL/FR |
nutty |
| peanut oxazole | FL |
oily |
iso | phytol | FL/FR |
orris |
| costus root oil | FL |
pungent |
| acetaldehyde | FL |
solvent |
1- | heptanol | FL/FR |
spicy |
| cinnamyl formate | FL/FR |
| cuminaldehyde | FL/FR |
2- | octanol | FL/FR |
black | pepper oil CO2 extract | FL/FR |
| perillaldehyde | FL/FR |
sulfurous |
| mango thiol | FL/FR |
4- | methoxy-2-methyl butane thiol | FL/FR |
| methyl 2-(methyl thio) butyrate | FL |
terpenic |
para- | cymene | FL/FR |
alpha- | phellandrene | FL/FR |
tropical |
| guava distillates | FL |
3- | mercaptohexyl butyrate | FL |
| passiflora acetate | FL/FR |
| passiflora edulis fruit extract | FL/FR |
| propyl propionate | FL/FR |
| psidium guajava fruit | FL |
| psidium guajava fruit extract | FL/FR |
vegetable |
2- | methyl valeraldehyde | FL/FR |
waxy |
| ethyl nonanoate | FL/FR |
| geranyl propionate | FL/FR |
| heptyl octanoate | FL/FR |
2- | nonanol | FL/FR |
| nonyl acetate | FL/FR |
| octyl butyrate | FL/FR |
3- | octyl formate | FL/FR |
| undecanal | FL/FR |
woody |
beta- | damascenone | FL/FR |
| humulus lupulus extract | FL/FR |
beta- | ionone | FL/FR |
| myrcene | FL/FR |
| terpinolene | FL/FR |
|
Potential Uses:
Occurrence (nature, food, other): note
Synonyms:
3- | cyclohexene-1-methanol, a,a,4-trimethyl-, propanoate | 3- | cyclohexene-1-methanol, a,a,4-trimethyl-, propionate | p- | menth-1-en-8-ol propionate | para- | menth-1-en-8-ol propionate | p- | menth-1-en-8-yl propanoate | para- | menth-1-en-8-yl propanoate | p- | mentha-1-en-8-ol propionate | para- | mentha-1-en-8-ol propionate | | menthen-1-yl-8-ate | 1- | methyl-1-(4-methyl cyclohex-3-enyl) ethyl propanoate | 1- | methyl-1-(4-methylcyclohex-3-en-1-yl)ethyl propionate | 1- | methyl-1-(4-methylcyclohex-3-enyl)ethylpropanoate | 2-(4- | methyl-1-cyclohex-3-enyl)propan-2-yl propanoate | 2-(4- | methyl-1-cyclohex-3-enyl)propan-2-ylpropanoate | 2-(4- | methylcyclohex-3-en-1-yl)propan-2-yl propionate | | propionic acid terpineol ester | | propionic acid, terpineol ester | | terpenyl propanoate | | terpineol, propanoate | | terpinyl propanoate | alpha | terpinyl propionate | | terpinyl propionate FCC | | terpinyl propionate natural | | terpinyl propionate synthetic | alpha,alpha,4- | trimethyl-3-cyclohexene-1-methyl propionate |
Articles:
|