| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-phenylethyl propanoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H14O2/c1-2-11(12)13-9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | HVGZQCSMLUDISR-UHFFFAOYAZ | |||||||||||||||||||||||||||||||||||
| SMILES : | CCC(=O)OCCC1=CC=CC=C1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2915.50.3000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | floral red rose fruity honey balsam styrax | |||||||||||||||||||||||||||||||||||
| substantivity : | 96 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.00900 - 1.01700 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.396 to 8.462 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.01000 - 1.01800 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.414 to 8.481 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.49100 - 1.49600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 245.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 3.06 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 15.00 gm/kg FCTXAV 2,327,1964 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for phenethyl propionate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 20.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for phenethyl propionate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 35.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-567-7 | |||||||||||||||||||||||||||||||||||
| rtecs : | AJ3255000 for 122-70-3 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000122703 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 122-70-3 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 404457 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 173259 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2721833341 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzyl carbinyl propionate | |
| japanese beetle bait | |
| phenethyl alcohol propionate | |
| phenethyl propionate | |
| 2- | phenethyl propionate |
| phenyl ethyl alcohol propionate | |
| 2- | phenyl ethyl propanoate |
| phenyl ethyl propionate | |
| 2- | phenyl ethyl propionate |
| propanoic acid 2-phenethyl ester | |
| propanoic acid 2-phenyl ethyl ester | |
| propionic acid phenethyl ester | |
| propionic acid phenyl ethyl ester | |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| paraffin oil | |
| propylene glycol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| 2- | acetyl furan |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| benzaldehyde | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| cassia bark oil | |
| cinnamyl alcohol | |
| citronellol | |
| citronellyl acetate | |
| clary sage oil | |
| clove bud oil | |
| coriander seed oil | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanol | |
| 9- | decen-1-ol |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl isobutyrate | |
| ethyl (E,Z)-2,4-decadienoate | |
| ethyl cinnamate | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| fir balsam absolute | |
| floral pyranol | |
| gardenia oxide | |
| geraniol | |
| geranyl acetate | |
| (E)- | geranyl acetone |
| guaiacwood oil | |
| heliotropin | |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl propionate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hexyl isovalerate | |
| ho leaf oil | |
| hydroxycitronellal | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| methyl anthranilate | |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl phenyl acetate | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| neryl acetate | |
| nonanal | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenethyl phenyl acetate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| santall | |
| strawberry glycidate 1 | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| acacia | |
| almond blossom | |
| apple | |
| apple blossom | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| balsam | |
| beer | |
| blackberry | |
| bouquet | |
| boysenberry | |
| briar sweet briar eglantine | |
| carnation dianthus oeillet | |
| cassis black currant bud | |
| cheese | |
| cherry | |
| cherry black cherry | |
| cherry blossom | |
| cherry brandy | |
| cloudberry bakeapple | |
| clove blossom | |
| crabapple blossom | |
| date | |
| dillenia | |
| floral | |
| frangipanni plumeria | |
| freesia | |
| hawthorn | |
| heather | |
| hibiscus | |
| honey miel | |
| kewda | |
| kiwi blossom | |
| kumquat | |
| linden blossom limeflower tilleul | |
| lotus | |
| mandarin | |
| mango blossom | |
| meadow | |
| millefleurs | |
| mimosa wattle | |
| modifier | |
| muguet lily of the valley | |
| nectarine | |
| nut almond | |
| nut peanut | |
| orchid | |
| pansy | |
| papaya | |
| passion blossom | |
| passion fruit | |
| peach | |
| pear | |
| peony | |
| pineapple | |
| plum | |
| plum blossom | |
| quince | |
| rhubarb | |
| rose | |
| rose geranium | |
| rose moss rose | |
| rose red rose | |
| rose tea rose | |
| starfruit | |
| stock evening scented stock | |
| sweet pea pois de senteur | |
| tangerine | |
| tea | |
| tropical | |
| tuberose tubereuse | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| ylang ylang cananga | |
| natural occurrence in : | |
| data page | champaca absolute (michelia alba dc.) @ 0.12% |
| data page | champaca concrete @ 0.10% |
| cheese | |
| data page | eucalyptus globulus bicostata oil @ 0.21% |
| data page | eucalyptus globulus oil @ 0.17% |
| data page | eucalyptus globulus pseudoglobulus oil @ 0.08% |
| peanut | |