| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||
| IUPAC name : | 2-heptyl-4-methyl-1,3-dioxolane | |||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H22O2/c1-3-4-5-6-7-8-11-12-9-10(2)13-11/h10-11H,3-9H2,1-2H3 | |||||||||||||||||||||||||||||
| InChIKey : | PTJICCHLTNPHDB-UHFFFAOYAQ | |||||||||||||||||||||||||||||
| SMILES : | CCCCCCCC1OCC(O1)C | |||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | green woody | |||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||
| assay : | 97.00 to 100.00 % | |||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||
| specific gravity : | 0.88600 to 0.89300 @ 25.00 °C. | |||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.372 to 7.431 | |||||||||||||||||||||||||||||
| refractive index : | 1.42700 to 1.43400 @ 20.00 °C. | |||||||||||||||||||||||||||||
| boiling point : | 236.00 to 237.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||
| vapor pressure : | 0.13600 mm/Hg @ 25.00 °C. | |||||||||||||||||||||||||||||
| flash point : | 183.00 °F. TCC ( 83.89 °C. ) | |||||||||||||||||||||||||||||
| logP (o/w) : | 3.45 | |||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||
| recommendation for octanal propylene glycol acetal usage levels up to : | ||||||||||||||||||||||||||||||
| 2.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||
| Use levels for FEMA GRAS flavoring substances on which the FEMA Expert Panel based its judgments that the substances are generally recognized as safe (GRAS). | ||||||||||||||||||||||||||||||
| The Expert Panel also publishes separate extensive reviews of scientific information on all FEMA GRAS flavoring substances and can be found at FEMA on the "LIBRARY" link. | ||||||||||||||||||||||||||||||
| publication number : 23 | ||||||||||||||||||||||||||||||
| average usual ppm | average maximum ppm | |||||||||||||||||||||||||||||
| baked goods : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||
| beverages(nonalcoholic) : | 1.00000 | 10.00000 | ||||||||||||||||||||||||||||
| beverages(alcoholic) : | - | - | ||||||||||||||||||||||||||||
| breakfast cereal : | - | - | ||||||||||||||||||||||||||||
| cheese : | - | - | ||||||||||||||||||||||||||||
| chewing gum : | 10.00000 | 50.00000 | ||||||||||||||||||||||||||||
| condiments / relishes : | - | - | ||||||||||||||||||||||||||||
| confectionery froastings : | - | - | ||||||||||||||||||||||||||||
| egg products : | - | - | ||||||||||||||||||||||||||||
| fats / oils : | 0.50000 | 10.00000 | ||||||||||||||||||||||||||||
| fish products : | - | - | ||||||||||||||||||||||||||||
| frozen dairy : | 1.00000 | 10.00000 | ||||||||||||||||||||||||||||
| fruit ices : | - | - | ||||||||||||||||||||||||||||
| gelatins / puddings : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||
| granulated sugar : | - | - | ||||||||||||||||||||||||||||
| gravies : | - | - | ||||||||||||||||||||||||||||
| hard candy : | 1.60000 | 10.00000 | ||||||||||||||||||||||||||||
| imitation dairy : | - | - | ||||||||||||||||||||||||||||
| instant coffee / tea : | - | - | ||||||||||||||||||||||||||||
| jams / jellies : | - | - | ||||||||||||||||||||||||||||
| meat products : | - | - | ||||||||||||||||||||||||||||
| milk products : | 2.00000 | 10.00000 | ||||||||||||||||||||||||||||
| nut products : | - | - | ||||||||||||||||||||||||||||
| other grains : | - | - | ||||||||||||||||||||||||||||
| poultry : | - | - | ||||||||||||||||||||||||||||
| processed fruits : | - | - | ||||||||||||||||||||||||||||
| processed vegetables : | - | - | ||||||||||||||||||||||||||||
| reconstituted vegetables : | - | - | ||||||||||||||||||||||||||||
| seasonings / flavors : | - | - | ||||||||||||||||||||||||||||
| snack foods : | - | - | ||||||||||||||||||||||||||||
| soft candy : | 1.60000 | 10.00000 | ||||||||||||||||||||||||||||
| soups : | - | - | ||||||||||||||||||||||||||||
| sugar substitutes : | - | - | ||||||||||||||||||||||||||||
| sweet sauces : | - | - | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||
| 2-heptyl-4-methyl-1,3-dioxolane | ||||||||||||||||||||||||||||||
| (EINECS) number : | 277-712-5 | |||||||||||||||||||||||||||||
| chemidplus : | 074094614 | |||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 74094-61-4 | |||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||
| 2-heptyl-4-methyl-1,3-dioxolane | ||||||||||||||||||||||||||||||
| jecfa number : | 1741 | |||||||||||||||||||||||||||||
| pubchem : | 3768589 | |||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||
| synonyms : | |
| aldehyde C-8 propylene glycol acetal | |
| 2- | heptyl-4-methyl-1,3-dioxolane |
| octanal propyleneglycol acetal | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| apple ketal | |
| bergoxane | |
| bicyclogermacrene | |
| birch bud oil | |
| bornyl salicylate | |
| beta- | cadinene |
| alpha- | campholenic aldehyde |
| iso | cyclogeraniol |
| iso | dihydrolavandulal |
| elemi oil | |
| alpha- | elemol |
| beta- | eudesmol |
| iso | eugenyl formate |
| fresh nitrile | |
| galbanum oil | |
| galbanum oleoresin | |
| galbanum resinoid | |
| green acetate | |
| (E)-2- | hexen-1-yl salicylate |
| 6- | hydroxydihydrotheaspirane (mixture of isomers) |
| karo karounde absolute | |
| linalool | |
| para- | methyl hydratropaldehyde |
| alpha- | methylene citronellal |
| neroli ketone | |
| (Z)-6- | nonen-1-al |
| nonisyl formate | |
| oakmoss absolute | |
| beta- | ocimene |
| octanal propylene glycol acetal | |
| 2- | octanol |
| 3- | octyl acetate |
| orange leaf absolute | |
| iso | pulegol |
| spruce needle absolute | |
| terpinyl propionate | |
| alpha- | thujene |
| tricyclo(5.2.1.02,6)dec-3-enyl acetate | |
| valerian absolute | |
| valerian root oil | |
| valerian root oil china | |
| valerian root oil CO2 extract china | |
(odor and/or flavor) used in : | |
| absinthe | |
| agrumen | |
| algae | |
| amaryllis | |
| apple green apple | |
| artichoke | |
| asafoetida | |
| asparagus | |
| avocado | |
| basil | |
| boxwood | |
| boxwood blossom | |
| boxwoodberry | |
| cajuput | |
| carrot | |
| carrot seed | |
| cassie acacia farnesiana | |
| cassis black currant bud | |
| celery | |
| chamomile | |
| cilantro | |
| clary sage | |
| clematis | |
| cognac | |
| cortex | |
| costus | |
| cucumber | |
| daffodil narcissus | |
| dill | |
| elemi | |
| evergreen | |
| fennel | |
| fern fougere | |
| fig | |
| fir | |
| fir balsam | |
| foliage | |
| galbanum | |
| geranium | |
| grass | |
| grass green grass | |
| green | |
| guava | |
| hops houblon | |
| hyacinth jacinthe | |
| hydrangea | |
| ivy leaf | |
| jonquil narcissus jonquilla | |
| leaf | |
| leaf green leaf | |
| lettuce | |
| liverwort | |
| lotus | |
| marjoram | |
| mimosa wattle | |
| narcissus narcisse | |
| oregano | |
| pansy | |
| parsley | |
| pea green pea | |
| pear prickly pear | |
| pepper bell pepper | |
| pine scotch pine | |
| privet | |
| privet blossom | |
| reseda mignonette | |
| rhubarb | |
| rootbeer | |
| rose geranium | |
| rose leaf | |
| stem | |
| strawberry leaf | |
| tomato | |
| tomato leaf | |
| valerian | |
| vegetable | |
| vegetation tropical hothouse vegetation | |
| vine | |
| violet leaf | |
| weedy | |
| wintergreen | |
| wormwood absinthium | |
| yew | |
natural occurrence in : | |
| not found in nature | |