| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | dimethoxymethylbenzene | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H12O2/c1-10-9(11-2)8-6-4-3-5-7-8/h3-7,9H,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | HEVMDQBCAHEHDY-UHFFFAOYAC | |||||||||||||||||||||||||||||||||||
| SMILES : | COC(C1=CC=CC=C1)OC | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2911.00.5000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | green | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | floral almond sharp fruity wine green | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 5.00 ppm. Green, sharp and almondy with a cherry pit nuance | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.00700 - 1.01700 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.379 to 8.462 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.48800 - 1.49600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 87.00 - 89.00 °C. @ 18.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 198.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 2.24 | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1220.00 mg/kg | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 157.00 °F. TCC ( 69.44 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for benzaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for benzaldehyde dimethyl acetal usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 60.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 214-413-0 | |||||||||||||||||||||||||||||||||||
| rtecs : | CU5774000 for 1125-88-8 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 001125888 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 1125-88-8 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 286137 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 837 | |||||||||||||||||||||||||||||||||||
| fl. number : | 06.003 | |||||||||||||||||||||||||||||||||||
| pubchem : | 203673 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 23, No. 1, 33, (1998)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzaldehyde dimethyl acetal | |
| alpha,alpha- | dimethoxymethyl benzene |
| ( | dimethoxymethyl) benzene |
| dimethoxyphenyl methane | |
| alpha,alpha- | dimethoxytoluene |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| alkalis | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| acetophenone | |
| 2- | acetyl furan |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| benzophenone | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl propionate | |
| blood orange oil | |
| bois de rose oil | |
| laevo- | carvone |
| cassia bark oil | |
| citronellyl acetate | |
| citronellyl nitrile | |
| citrus carbaldehyde | |
| coumarin | |
| diethyl malonate | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| ethyl phenyl acetate | |
| iso | eugenyl acetate |
| fir needle oil | |
| green acetate | |
| heliotropin | |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| hexyl 2-methyl butyrate | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| methyl acetophenone | |
| para- | methyl anisole |
| methyl benzoate | |
| orange oil | |
| phenethyl acetate | |
| rose butanoate | |
| alpha- | terpinyl acetate |
| tetrahydromyrcenol | |
| para- | tolyl aldehyde |
| (odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| almond | |
| almond blossom | |
| apple | |
| apple crabapple | |
| apple green apple | |
| apricot | |
| arrack | |
| balsam | |
| berry | |
| blackberry | |
| bouquet | |
| brandy | |
| bread white bread | |
| briar sweet briar eglantine | |
| bubblegum | |
| butterscotch | |
| cassia | |
| cassie acacia farnesiana | |
| cherry | |
| cherry black cherry | |
| cherry blossom | |
| cherry maraschino cherry | |
| cherry wild cherry | |
| cinnamon | |
| citrus | |
| clove blossom | |
| coconut | |
| coconut tropical coconut | |
| coffee | |
| cranberry | |
| elder blossom | |
| elderberry | |
| floral | |
| fruit | |
| gooseberry | |
| grenadine | |
| heliotrope | |
| herbal | |
| hibiscus | |
| loganberry dewberry | |
| marigold tagete | |
| mint | |
| mulberry | |
| myrtle | |
| nut | |
| nut pecan | |
| nut pistachio | |
| nut walnut | |
| papaya | |
| parsley | |
| passion blossom | |
| passion fruit | |
| peach | |
| pineapple | |
| plum | |
| plum blossom | |
| pomegranate | |
| quince | |
| raspberry | |
| rhubarb | |
| rose wild rose | |
| rum | |
| spice | |
| starfruit | |
| strawberry | |
| tomato | |
| topnotes | |
| tropical | |
| vanilla | |
| violet | |
| whiskey | |
| natural occurrence in : | |
| potato | |
| rhubarb | |