| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| IUPAC name : | 2-methoxy-3-methylpyrazine |
| InChI : | InChI=1/C6H8N2O/c1-5-6(9-2)8-4-3-7-5/h3-4H,1-2H3 |
| InChIKey : | VKJIAEQRKBQLLA-UHFFFAOYAT |
| SMILES : | CC1=NC=CN=C1OC |
| (EINECS) number : | 220-651-6 |
| cas number : | 2847-30-5 |
| fema number : | 3183 |
| coe number : | 2266 |
| jecfa number : | 788 |
| fl. number : | 14.126 |
| molar refractivity : | 33.93 ± 0.3 cm3 |
| parachor : | 289.8 ± 4.0 cm3 |
| index of refraction : | 1.496 ± 0.02 |
| surface tension : | 38.7 ± 3.0 dyne/cm |
| density : | 1.068 ± 0.06 g/cm3 |
| polarizability : | 13.45 ± 0.5 10-24cm3 |
| xlogp : | 1.00 |
| molecular weight : | 124.1405200 |
| formula : | C6 H8 N2 O |
|
|
| |
| |
| IUPAC name : | 2-methoxy-6-methylpyrazine |
| InChI : | InChI=1/C6H8N2O/c1-5-3-7-4-6(8-5)9-2/h3-4H,1-2H3 |
| InChIKey : | MYDVJLOKNIAHPH-UHFFFAOYAN |
| SMILES : | CC1=CN=CC(=N1)OC |
| (EINECS) number : | 220-737-3 |
| cas number : | 2882-21-5 |
| fema number : | 3183 |
| coe number : | 2266 |
| fl. number : | 14.025 |
| molar refractivity : | 33.93 ± 0.3 cm3 |
| parachor : | 289.8 ± 4.0 cm3 |
| index of refraction : | 1.496 ± 0.02 |
| surface tension : | 38.7 ± 3.0 dyne/cm |
| density : | 1.068 ± 0.06 g/cm3 |
| polarizability : | 13.45 ± 0.5 10-24cm3 |
| xlogp : | 1.00 |
| molecular weight : | 124.1405200 |
| formula : | C6 H8 N2 O |
|
|
| |
| |
| export tariff code : | 2933.90 |
| fda reg : | unspecified |
| |
| |
organoleptics :
|
| odor type : | chocolate |
properties :
|
| appearence : | colorless clear liquid |
| assay : | 97.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| logp : | -0.54 |
safety :
|
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | 130.00 °F. TCC ( 54.44 °C. )
|
| | |
| recommendation for chocolate pyrazine B usage levels up to : | | | not for fragrance use.
|
| | |
| recommendation for chocolate pyrazine B usage levels up to : | | | 5.0000 ppm in the flavor.
|
| | |
safety links :
|
| (EINECS) number : | 220-651-6 |
| chemidplus : | 002882215 |
| epa-srs : | 2847-30-5 |
| | |
| (EINECS) number : | 220-737-3 |
| chemidplus : | 2882-21-5 |
| epa-srs : | 2882-21-5 |
| | |
| EPI System : | Click here |
other :
|
| |
|
references :
|
| jecfa number : | 788 |
| fl. number : | 14.126 |
| pubchem : | 161011 |
| NIST Chemistry WebBook : | 1605373978 |
| | |
| fl. number : | 14.025 |
| pubchem : | 10517161 |
| NIST Chemistry WebBook : | 178627740 |
| | |
|
| synonyms : |
| | chocolate pyrazine B | | 2- | methoxy-(3,6)-methyl pyrazine | | 2- | methoxy-3-methyl pyrazine + 2-methoxy-6-methyl pyrazine | | 2- | methoxy-3-methyl pyrazine + 5-methoxy-3-methyl pyrazine |
| soluble in : |
| | alcohol | | | water |
| stability : |
| (odor and/or flavor) blends with : |
| | acetophenone |
| | acetyl acetaldehyde dimethyl acetal |
| 2- | acetyl furan |
| | acetyl propionyl |
| 2- | acetyl pyrazine |
| 2- | acetyl pyridine |
| 3- | acetyl pyridine |
| 2- | acetyl pyrrole |
| | acetyl pyrroline |
| 2- | acetyl thiazole |
| 2- | acetyl-2-thiazoline |
| 5- | acetyl-2,3-dihydro-1,4-thiazine |
| 3- | acetyl-2,5-dimethyl furan |
| 2- | acetyl-3-ethyl pyrazine |
| 2- | acetyl-3-methyl pyrazine |
| 2- | acetyl-3,5-dimethyl pyrazine |
| 2- | acetyl-5-methyl furan |
| | allspice oil |
| | allyl 2-ethyl butyrate |
| | almond oil bitter |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| | amyl cinnamate |
| iso | amyl cinnamate |
| alpha- | amyl cinnamyl acetate |
| iso | amyl nonanoate |
| | amyl phenyl acetate |
| iso | amyl phenyl acetate |
| | amyl salicylate |
| | amyris wood oil |
| alpha- | angelica lactone |
| ortho- | anisaldehyde |
| para- | anisaldehyde |
| para- | anisyl alcohol |
| | beeswax absolute |
| | benzaldehyde |
| | benzaldehyde / methyl anthranilate schiff's base |
| | benzaldehyde dimethyl acetal |
| | benzaldehyde glycrol acetal |
| 2- | benzofuran carboxaldehyde |
| | benzoin resinoid |
| | benzothiazole |
| | benzyl cinnamate |
| | benzyl isoeugenol |
| | benzyl salicylate |
| | bois de rose oil |
| | bornyl isobutyrate |
| | boronia butenal |
| | bread thiophene |
| | butyl 2-methyl butyrate |
| iso | butyl benzoate |
| | butyl cinnamate |
| iso | butyl cinnamate |
| | butyl phenyl acetate |
| iso | butyl phenyl acetate |
| iso | butyl quinoline |
| iso | butyl quinoline |
| 2-iso | butyl-3,(5 and 6)-dimethyl pyrazine |
| 2(4)-iso | butyl-4(2),6-dimethyl dihydro-4H-1,3,5-dithiazine |
| | butyraldehyde |
| | butyramide |
| | butyroin |
| | caramel furanone |
| | carnation absolute |
| | cassia bark oil |
| | cherry laurel oil |
| | chocolate notes |
| | cinnamyl alcohol |
| | clary sage oil |
| | clove bud oil |
| | cocoa butenal |
| | cocoa hexenal |
| | cocoa oleoresin |
| | cocoa pentenal |
| | cocoa propanal |
| | cocoa pyrazine |
| 3,6- | cocoa pyrazine |
| | coconut absolute |
| | coffee furanone |
| | coumane |
| | coumarin |
| para- | cresyl laurate |
| | cyclohexyl cinnamate |
| | cyclohexyl methyl pyrazine |
| (E,E)-2,4- | decadien-1-al |
| gamma- | decalactone |
| | dibenzyl ketone |
| 2,5- | diethyl thiazole |
| 3,5- | diethyl-2-methyl pyrazine |
| 2,5- | diethyl-3-methyl pyrazine |
| 2,5- | diethyl-4-methyl thiazole |
| | difurfuryl ether |
| 6,7- | dihydro-2,3-dimethyl-5H-cyclopentapyrazine |
| | dihydroxyacetophenone |
| | dimethyl anthranilate |
| 2,4- | dimethyl benzaldehyde |
| | dimethyl dihydrocyclopentapyrazine |
| 2,3- | dimethyl pyrazine |
| 2,5- | dimethyl pyrazine |
| 2,6- | dimethyl pyrazine |
| 2,6- | dimethyl pyridine |
| 2,5- | dimethyl thiazole |
| 4,5- | dimethyl thiazole |
| 2,5- | dimethyl thiophene |
| 4,5- | dimethyl-2-ethyl thiazole |
| 4,5- | dimethyl-2-ethyl-3-thiazoline |
| 2,4- | dimethyl-5-vinyl thiazole |
| 2- | ethoxythiazole |
| | ethyl 2-hydroxy-2-methyl butyrate |
| 4- | ethyl benzaldehyde |
| 2- | ethyl butyraldehyde |
| | ethyl cinnamate |
| 2- | ethyl furan |
| 4- | ethyl guaiacol |
| | ethyl maltol |
| | ethyl phenyl acetate |
| 2- | ethyl pyrazine |
| | ethyl vanillin |
| | ethyl vanillin isobutyrate |
| 1- | ethyl-2-acetyl pyrrole |
| 5- | ethyl-2-methyl pyridine |
| 5- | ethyl-2-thiophene carboxaldehyde |
| 2- | ethyl-3-methoxypyrazine |
| 2- | ethyl-3,5(6)-dimethyl pyrazine mixture |
| 2- | ethyl-4-butanol |
| 2- | ethyl-4-methyl thiazole |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline |
| | eugenol |
| | fenugreek oleoresin |
| | fenugreek resinoid |
| | filbert heptenone |
| | filbert pyrazine |
| | furfural |
| | furfuryl thioacetate |
| 3-(2- | furyl) acrolein |
| | geranyl crotonate |
| laevo- | glutamine |
| | guaiacwood oil |
| | gurjun balsam oil |
| | hay absolute |
| | hazelnut notes |
| | hazelnut oleoresin |
| | hazelnut pyrazine |
| | heliotropin |
| (E,E)-2,4- | heptadien-1-ol |
| gamma- | heptalactone |
| 2- | heptyl furan |
| 2,4- | hexadien-1-ol |
| gamma- | hexalactone |
| 3,4- | hexane dione |
| 2- | hexen-1-al |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| 2- | hexyl-5 or 6-keto-1,4-dioxane |
| | ho leaf oil |
| 4- | hydroxybenzoic acid |
| | immortelle absolute |
| | labdanum resinoid |
| | maltol |
| | maraniol |
| | menthofuran |
| 2- | methoxy-3-methyl pyrazine |
| 2'- | methoxyacetophenone |
| 2- | methoxypyrazine |
| | methyl 2-(methyl thio) acetate |
| | methyl acetophenone |
| 2- | methyl anisole |
| para- | methyl anisole |
| | methyl benzoate |
| 2- | methyl butyraldehyde |
| alpha- | methyl cinnamaldehyde |
| | methyl cinnamate |
| | methyl cyclopentenolone |
| | methyl dihydrojasmonate |
| | methyl ethoxypyrazine |
| 2- | methyl furan |
| | methyl ionones |
| | methyl isoeugenol |
| | methyl phenyl acetate |
| 2- | methyl pyrazine |
| 2- | methyl quinoxaline |
| 5- | methyl quinoxaline |
| 4- | methyl salicylaldehyde |
| 4- | methyl thiazole |
| 2- | methyl thio-3,5 or 6-methyl pyrazine |
| 2-( | methyl thio) acetaldehyde |
| | methyl valerate |
| 3- | methyl-2-buten-1-al |
| 2- | methyl-3-(methyl thio) pyrazine |
| 2- | methyl-3-propyl pyrazine |
| 2- | methyl-3,(5 or 6)-ethoxypyrazine |
| 2- | methyl-5-isopropyl pyrazine |
| (E,E)-2,4- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-yl acetate |
| gamma- | nonalactone |
| | nutmeg oil |
| | nutty cyclohexenone |
| | nutty quinoxaline |
| | nutty thiazole |
| | oakmoss absolute |
| | ocean propanal |
| | orris pyridine |
| | patchouli ethanone |
| | peanut dithiazine |
| | peanut oxazole |
| | pepper oil black |
| | peru balsam oil |
| | phenethyl octanoate |
| | phenethyl phenyl acetate |
| | phenyl acetaldehyde |
| | phenyl acetaldehyde diethyl acetal |
| | phenyl acetaldehyde diisobutyl acetal |
| | phenyl acetic acid |
| 3- | phenyl propyl alcohol |
| | phenyl pyruvic acid |
| | popcorn pyrimidine |
| | powdery ketone |
| | prenyl benzoate |
| 2- | propionyl thiazole |
| 2- | propionyl-2-thiazoline |
| | propyl benzoate |
| iso | propyl formate |
| iso | propyl pyrazine |
| 2- | propyl pyridine |
| | raspberry ketone |
| | raspberry ketone acetate |
| | raspberry ketone methyl ether |
| | saffron pyranone |
| | sandalwood oil |
| | santall |
| | shoyu pyrazine |
| | strawberry furanone |
| | sulfuryl butyrate |
| | sulfuryl decanoate |
| | sulfuryl formate |
| | sulfuryl hexanoate |
| | sulfuryl isobutyrate |
| | sulfuryl octanoate |
| | sulfuryl propionate |
| alpha- | terpineol |
| | tetrahydrolinalool |
| 2,3,5,6- | tetramethyl pyrazine |
| (E)- | tiglic aldehyde |
| | tobacco butenal |
| | tobacco dodecane |
| | tolualdehyde glyceryl acetal |
| | tonka bean absolute |
| | tonka bean resinoid |
| | tricyclodecenyl isobutyrate |
| 2,3,5- | trimethyl pyrazine |
| 2,4,5- | trimethyl thiazole |
| | tropical thiazole |
| | valeraldehyde |
| | valeraldehyde dibutyl acetal |
| | valeraldehyde propylene glycol acetal |
| gamma- | valerolactone |
| | vanilla absolute |
| | vanillin |
| | vanillyl acetate |
| | vanillyl isobutyrate |
| | verymoss |
| | vetiver oil |
| 2- | vinyl pyrazine |
| | vinyl sulfurol |
| | whiskey lactone |
| | woody acetate |
| | woody amylene |
| | ylang ylang oil |
| (odor and/or flavor) used in : |
| | almond | | | caramel | | | chocolate cacao | | | chocolate cocoa | | | coffee | | | nut | | | nut almond | | | nut hazelnut | | | nut peanut |
| natural occurrence in : |
| found in nature |
|