| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | (Z)-4-phenylbut-3-ene-1,2,3-triol | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C10H12O3/c11-7-10(13)9(12)6-8-4-2-1-3-5-8/h1-6,10-13H,7H2/b9-6- | |||||||||||||||||||||||||||||||
| InChIKey : | FSDPQZPRLPFVLK-TWGQIWQCBG | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2911.00.5000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | cherry bitter almond sweet | |||||||||||||||||||||||||||||||
| taste description³ : | at 30.00 - 75.00 ppm. Faint mustiness, mild red fruit with a cherry almond nuance | |||||||||||||||||||||||||||||||
| substantivity : | 8 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||||
| assay : | 96.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||
| specific gravity : | 1.18300 - 1.19300 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.844 to 9.927 | |||||||||||||||||||||||||||||||
| refractive index : | 1.53370 - 1.54370 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| boiling point : | 185.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 143.00 - 144.00 °C. @ 2.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 2.00 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 1.98 | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for benzaldehyde glycrol acetal usage levels up to : | ||||||||||||||||||||||||||||||||
| 8.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for benzaldehyde glycrol acetal usage levels up to : | ||||||||||||||||||||||||||||||||
| 250.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 215-294-8 | |||||||||||||||||||||||||||||||
| chemidplus : | 001319886 | |||||||||||||||||||||||||||||||
| epa-srs : | 1319-88-6 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 203722 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 25, No. 4, 71, (2000)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| benzal glyceral acetal | |
| benzal glycerin | |
| benzaldehyde 1,2,3-propane triol cyclic acetal | |
| benzaldehyde cyclic acetal with 1,2,3-propane triol | |
| benzaldehyde cyclic acetal with glycerol | |
| benzaldehyde glycerol cyclic acetal | |
| benzaldehyde glyceryl 1,3-cyclic acetal | |
| benzaldehyde glyceryl acetal | |
| benzaldehyde glycrol acetal | |
| benzylidene glycerol | |
| (Z)-1,3-O- | benzylidene glycerol |
| (Z)-5- | hydroxy-2-phenyl-1,3-dioxane |
| (Z)-4- | hydroxymethyl-2-phenyl-meta-dioxolane |
| (Z)-4- | phenyl but-3-ene-1,2,3-triol |
| (Z)-2- | phenyl-1,3-dioxolane-4-methanol |
| (Z)-2- | phenyl-meta-dioxan-5-ol |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| alkalis | |
| (odor and/or flavor) blends with : | |
| acetaldehyde ethyl phenethyl acetal | |
| acetophenone | |
| 2- | acetyl furan |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| benzophenone | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl propionate | |
| blood orange oil | |
| bois de rose oil | |
| laevo- | carvone |
| cassia bark oil | |
| citronellyl acetate | |
| citronellyl nitrile | |
| citrus carbaldehyde | |
| coumarin | |
| diethyl malonate | |
| dihydromyrcenol | |
| dimethyl anthranilate | |
| ethyl acetoacetate | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| ethyl phenyl acetate | |
| fir needle oil | |
| green acetate | |
| heliotropin | |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| hexyl 2-methyl butyrate | |
| linalool | |
| linalool oxide | |
| linalyl acetate | |
| methyl acetophenone | |
| para- | methyl anisole |
| methyl benzoate | |
| orange oil | |
| phenethyl acetate | |
| rose butanoate | |
| (odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| almond | |
| almond blossom | |
| apple | |
| apple crabapple | |
| apple green apple | |
| apricot | |
| arrack | |
| balsam | |
| berry | |
| blackberry | |
| blueberry | |
| bouquet | |
| brandy | |
| bread white bread | |
| briar sweet briar eglantine | |
| bubblegum | |
| butter | |
| butterscotch | |
| cassia | |
| cassie acacia farnesiana | |
| cherry | |
| cherry black cherry | |
| cherry blossom | |
| cherry maraschino cherry | |
| cherry wild cherry | |
| cinnamon | |
| citrus | |
| clove blossom | |
| coconut | |
| coconut tropical coconut | |
| coffee | |
| cranberry | |
| cream | |
| elder blossom | |
| elderberry | |
| enhancer | |
| floral | |
| fruit | |
| gooseberry | |
| grenadine | |
| heliotrope | |
| herbal | |
| hibiscus | |
| jasmin | |
| loganberry dewberry | |
| marigold tagete | |
| mint | |
| mulberry | |
| myrtle | |
| nut | |
| nut pecan | |
| nut pistachio | |
| nut walnut | |
| papaya | |
| parsley | |
| passion blossom | |
| passion fruit | |
| peach | |
| pineapple | |
| plum | |
| plum blossom | |
| pomegranate | |
| quince | |
| raspberry | |
| rhubarb | |
| rose wild rose | |
| rum | |
| spice | |
| starfruit | |
| strawberry | |
| topnotes | |
| tropical | |
| vanilla | |
| violet | |
| whiskey | |
| natural occurrence in : | |
| not found in nature | |