Notes :
Blend with the benzoates to remove the harshness.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | methyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | OSWPMRLSEDHDFF-UHFFFAOYAD | |||||||||||||||||||||||||||||||||||
| SMILES : | COC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 175.105 177.1010 |
h. number : | 2918.23.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | minty | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | wintergreen mint | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Sweet, salicylate and root beer with aromatic and balsamic nuances | |||||||||||||||||||||||||||||||||||
| substantivity : | 8 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pink clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.18000 - 1.18500 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.819 to 9.860 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.53500 - 1.53800 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | -8.00 - -7.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 222.00 - 224.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 132.00 - 133.00 °C. @ 50.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.55 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1300.00 mg/kg FCTXAV 16,821,1978 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 205.00 °F. TCC ( 96.11 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for methyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for methyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 8400.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-317-7 | |||||||||||||||||||||||||||||||||||
| rtecs : | VO4725000 for 119-36-8 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000119368 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 119-36-8 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 8204 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 151540 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2953080148 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 20, No. 6, 49, (1995)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| 2- | carbomethoxyphenol |
| 2- | hydroxybenzoic acid methyl ester |
| ortho- | hydroxybenzoic acid methyl ester |
| 2-( | methoxycarbonyl) phenol |
| methyl 2-hydroxybenzoate | |
| methyl ortho-hydroxybenzoate | |
| methyl salicylate | |
| salicylic acid methyl ester | |
| synthetic sweet birch oil | |
| synthetic teaberry oil | |
| synthetic wintergreen oil | |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| kerosene | |
| paraffin oil | |
| water, 700 mg/L @ 30C | |
| insoluble in : | |
| water | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| para- | anisaldehyde |
| bay leaf oil | |
| benzyl acetate | |
| benzyl isoeugenol | |
| benzyl propionate | |
| benzyl salicylate | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl salicylate |
| caraway seed oil | |
| laevo- | carvone |
| cassia bark oil | |
| cinnamon bark oil | |
| cinnamyl alcohol | |
| clove bud oil | |
| coriander seed oil | |
| coumarin | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| diethyl malonate | |
| dihydroanethol | |
| dodecanal | |
| dodecanol | |
| ethyl heptanoate | |
| ethyl maltol | |
| ethyl vanillin | |
| eugenol | |
| geraniol | |
| green acetate | |
| gurjun balsam oil | |
| heliotropin | |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| ho leaf oil | |
| hydroxycitronellal | |
| leaf acetal | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| dextro,laevo- | menthol |
| alpha- | methyl cinnamaldehyde |
| methyl cinnamate | |
| musks | |
| nopyl acetate | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| peppermint oil | |
| phenethyl acetate | |
| phenethyl salicylate | |
| 3- | phenyl propyl alcohol |
| raspberry ketone methyl ether | |
| rose butanoate | |
| santall | |
| spearmint oil | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| gamma- | undecalactone |
| vanilla absolute | |
| vanillyl acetate | |
| woody amylene | |
| (odor and/or flavor) used in : | |
| alpine bouquet | |
| apple | |
| apricot | |
| birch beer | |
| blackberry | |
| blueberry | |
| boxwoodberry | |
| bubblegum | |
| carnation dianthus oeillet | |
| cassia | |
| cassia blossom | |
| cassie acacia farnesiana | |
| cassis black currant bud | |
| castoreum | |
| cherry | |
| chypre | |
| clove | |
| cornmint | |
| crabapple blossom | |
| cranberry | |
| currant | |
| date | |
| fern fougere | |
| gardenia | |
| gooseberry | |
| grape | |
| grenadine | |
| hay new mown hay foin coupe | |
| herbal | |
| huckleberry bilberry | |
| hyssop | |
| jasmin | |
| leather russian leather | |
| licorice | |
| magnolia | |
| meadowsweet spiraea | |
| mimosa wattle | |
| mint | |
| mulberry | |
| oriental | |
| peach | |
| peppermint | |
| raspberry | |
| reseda mignonette | |
| rootbeer | |
| rue | |
| sarsaparilla | |
| sassafras | |
| spearmint | |
| spice | |
| spicewood | |
| strawberry | |
| tea green tea | |
| tomato | |
| tuberose tubereuse | |
| tutti frutti | |
| wallflower giroflee | |
| wintergreen | |
| wormwood absinthium | |
| ylang ylang cananga | |
| zibeline | |
| natural occurrence in : | |
| bilberry | |
| data page | cassie absolute @ 94.40% |
| data page | champaca absolute (michelia alba dc.) @ 0.02% |
| data page | champaca concrete @ 0.15% |
| data page | couroupita guianensis aubl. flower oil brazil @ 0.50% |
| currant black currant | |
| data page | dialium guineense wild.fruit oil france @ 4.90% |
| grape concord grape | |
| data page | laurel leaf oil turkey @ trace% |
| data page | orthodon dianthera maxim. oil vietnam @ trace% |
| peach | |
| data page | petitgrain mandarin oil @ trace% |
| data page | pimento berry oil @ trace% |
| rue oil | |
| data page | stachys recta l. oil serbia @ 0.20% |
| strawberry | |
| tomato | |
| wintergreen | |
| data page | ylang ylang oil @ 0.29% |
| data page | ylang ylang oil CO2 extract @ 0.04% |