Notes :
waxy floral fruity accord:
0.05 - leerall
0.01 - aldehyde C-14
0.05 - aldehyde C18 10%
0.01 - musk gx
0.01 - raspberry ketone 10%
0.01 - aldehyde C-16 10%
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 5-pentyloxolan-2-one | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H16O2/c1-2-3-4-5-8-6-7-9(10)11-8/h8H,2-7H2,1H3 | |||||||||||||||||||||||||||||||
| InChIKey : | OALYTRUKMRCXNH-UHFFFAOYAG | |||||||||||||||||||||||||||||||
| SMILES : | CCCCCC1CCC(=O)O1 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| IUPAC name : | (5S)-5-pentyloxolan-2-one | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H16O2/c1-2-3-4-5-8-6-7-9(10)11-8/h8H,2-7H2,1H3/t8-/m0/s1 | |||||||||||||||||||||||||||||||
| InChIKey : | OALYTRUKMRCXNH-QMMMGPOBBX | |||||||||||||||||||||||||||||||
| SMILES : | CCCCC[C@H]1CCC(=O)O1 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2932.29.6000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | coconut | |||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | oily coconut waxy sweet buttery | |||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Coconut, creamy, waxy with fatty milky notes | |||||||||||||||||||||||||||||||
| substantivity : | 309 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear oily liquid | |||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||
| specific gravity : | 0.95800 - 0.96500 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.972 to 8.030 | |||||||||||||||||||||||||||||||
| specific gravity : | 0.96000 - 0.97000 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.997 to 8.081 | |||||||||||||||||||||||||||||||
| refractive index : | 1.44600 - 1.44900 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| boiling point : | 243.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 121.00 - 122.00 °C. @ 6.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 1.20 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 1.85 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Gavage-Rat [sex: M,F] 9780.00 mg/kg (Jenner et al., 1964) Oral-Rat [sex: M] 6600.00 mg/kg (Moreno, 1972a) Gavage-Guineapig [sex: M,F] 3440.00 mg/kg (Jenner et al., 1964) | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 13,889,1975 | |||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 1000.00 (μg/capita/day) | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for gamma-nonalactone (aldehyde C-18) usage levels up to : | ||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for gamma-nonalactone (aldehyde C-18) usage levels up to : | ||||||||||||||||||||||||||||||||
| 50.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 203-219-1 | |||||||||||||||||||||||||||||||
| rtecs : | LU3675000 for 104-61-0 | |||||||||||||||||||||||||||||||
| chemidplus : | 000104610 | |||||||||||||||||||||||||||||||
| epa-srs : | 104-61-0 | |||||||||||||||||||||||||||||||
| dtp/nci : | 46099 | |||||||||||||||||||||||||||||||
| chemidplus : | 104-61-0 | |||||||||||||||||||||||||||||||
| epa-srs : | 104-61-0 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 150801 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1715262819 | |||||||||||||||||||||||||||||||
| pubchem : | 36885347 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 17, No. 1, 41, (1992)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| abricolin | |
| aldehyde C-18 | |
| delta-N- | amyl butyrolactone |
| gamma- | amyl butyrolactone |
| gamma-N- | amyl butyrolactone |
| 4- | amyl-4-hydroxybutyric acid lactone |
| 4-N- | amyl-4-hydroxybutyric acid lactone |
| gamma- | amyl-gamma-butyrolactone |
| coconut aldehyde | |
| dihydro-5-pentyl-2(3H)-furanone | |
| 4- | hydroxynonanoic acid gamma-lactone |
| 4- | nonalactone |
| gamma- | nonalactone |
| nonan-4-olide | |
| gamma- | nonanolactone |
| 1,4- | nonanolide |
| 4- | nonanolide |
| gamma- | nonanolide |
| nonanolide-1,4 | |
| 1,4- | nonyl lactone |
| gamma- | nonyl lactone |
| gamma- | nonyl-gamma-butylrolactone |
| gamma- | nonylactone |
| gamma- | pelargolactone |
| 4- | pentyl butanolide |
| gamma- | pentyl-gamma-butyrolactone |
| prunolide | |
| soluble in : | |
| benzyl alcohol | |
| dipropylene glycol | |
| ethyl alcohol, 1:2 in 60% alcohol | |
| ethyl alcohol, 1:5 in 50% alcohol | |
| fixed oils | |
| paraffin oil | |
| insoluble in : | |
| water | |
| stability : | |
| cream | |
| detergent | |
| hair spray | |
| lipstick | |
| lotion | |
| non-discoloring in most media | |
| powder | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetoin | |
| 2- | acetyl-2-thiazoline |
| iso | amyl phenyl acetate |
| amyris wood oil | |
| para- | anisaldehyde |
| bay leaf oil | |
| benzoin resinoid | |
| benzyl isobutyl ether | |
| iso | bornyl acetate |
| caramel furanone | |
| caraway seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamon leaf oil | |
| clove bud oil | |
| costus valerolactone | |
| ethyl laurate | |
| ethyl maltol | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| gardenia oxide | |
| guaiacwood oil | |
| hazeltone | |
| heliotropin | |
| heliotropyl acetone | |
| heptanal dimethyl acetal | |
| immortelle absolute | |
| labdanum resinoid | |
| laevo- | linalool |
| alpha- | methyl cinnamaldehyde |
| methyl coumarins | |
| methyl ionones | |
| methyl phenyl acetate | |
| musks | |
| noisettal | |
| nutmeg oil | |
| ocean propanal | |
| gamma- | octalactone |
| peru balsam oil | |
| 3- | phenyl propyl alcohol |
| santall | |
| tonka bean absolute | |
| gamma- | undecalactone |
| vanilla absolute | |
| verymoss | |
| (odor and/or flavor) used in : | |
| amber | |
| apricot | |
| balsam | |
| banana | |
| bay | |
| bay rum | |
| bouquet | |
| caramel | |
| cedarwood | |
| chocolate cocoa | |
| chypre | |
| coconut | |
| coconut tropical coconut | |
| femme | |
| fern fougere | |
| fig | |
| floral | |
| fracas | |
| fruit tropical fruit | |
| gardenia | |
| grass sweet grass | |
| honeysuckle chevrefeuille | |
| juniperberry | |
| lavender | |
| lilac lilas syringa | |
| lou lou | |
| lychee soapberry | |
| mace | |
| magnolia | |
| maple | |
| nutmeg | |
| orange | |
| orchid | |
| oriental | |
| peach | |
| pina colada | |
| pine | |
| plum | |
| poison | |
| raspberry | |
| sandalwood | |
| strawberry | |
| tonka | |
| tuberose tubereuse | |
| vanilla | |
| white shoulders | |
| woody | |
| natural occurrence in : | |
| apricot | |
| data page | champaca concrete @ trace% |
| data page | eschweilera coriacea (a. p. dc.) mori flower oil brazil @ 2.20% |
| data page | osmanthus absolute @ 0.04% |
| peach | |
| sugar heated sugar | |