| |
| Right Click Jmol Molecule For More Options. (Safari 1.2 (v125) Compatible). Jmol is a free download found Here. |
| |
|
|
| IUPAC name : | 2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane |
| InChI : | InChI=1/C8H17NS2/c1-5(2)8-9-6(3)10-7(4)11-8/h5-9H,1-4H3 |
| InChIKey : | NOOYZCFJVKLILW-UHFFFAOYAY |
| SMILES : | CC1NC(SC(S1)C)C(C)C |
| cas number : | 104691-41-0 |
| fema number : | 3782 |
| jecfa number : | 1047 |
| molar refractivity : | 56.78 ± 0.3 cm3 |
| parachor : | 445.7 ± 6.0 cm3 |
| index of refraction : | 1.498 ± 0.02 |
| surface tension : | 28.1 ± 3.0 dyne/cm |
| density : | 0.988 ± 0.06 g/cm3 |
| polarizability : | 22.51 ± 0.5 10-24cm3 |
| XlogP : | 2.40 |
| molecular weight : | 191.3572800 (IUPAC) |
| formula : | C8 H17 N S2 |
| NMR Predictor : | Predict |
|
|
| |
| |
|
|
|
| |
| |
| export tariff code : | unspecified |
| fda reg : | unspecified |
Suppliers :
|
| Need This Molecule?: | You can contact the Chemical Sources Association and ask the Sourceress. |
organoleptics :
|
| odor type : | nutty |
| odor strength : | high , recommend smelling in a 0.10 % solution or less |
odor description: at 0.10 % in dipropylene glycol. | peanut meaty cocoa |
properties :
|
| appearence : | colorless to pale yellow clear liquid |
| assay : | 70.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| boiling point : | 104.00 to 115.00 °C. @ 1.70 mm Hg
|
| boiling point : | 285.00 to 286.00 °C. @ 760.00 mm Hg
|
| flash point : | 260.00 °F. TCC ( 126.67 °C. )
|
| logP (o/w) : | 2.73 |
safety :
|
| Oral Toxicity(LD50) : | | | |
Not determined
|
| Dermal Toxicity(LD50) : | | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | | |
Not determined
|
| |
safety in use :
|
| Category : | flavoring agents |
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | ND (μg/capita/day) |
| |
| recommendation for peanut dithiazine fragrance usage levels up to : | | | not for fragrance use.
|
safety references :
|
| European Food Safety Athority(efsa) : | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... |
| EPI System : | view |
| Canada Domestic Sub. List : | Yes |
| |
| | | |
| | 2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane |
| chemidplus : | 104691410 |
| EPA Substance Registry Services : | 104691-41-0 |
| | | |
| chemidplus : | 104691409 |
| EPA Substance Registry Services : | 104691-40-9 |
references :
|
| | 2,4-dimethyl-6-propan-2-yl-1,3,5-dithiazinane |
| jecfa number : | 1047 |
| NIST Chemistry WebBook : | 1994445831 |
| pubchem : | 11076987 |
| pubchem : | 104691-40-9 |
other :
|
| VCF-Online: | VCF Volatile Compounds in Food |
| FDA Everything Added to Food in the United States (EAFUS) | View |
|
synonyms :
|
| | dihydro-2-isopropyl-4,6-dimethyl-4H-1,3,5-dithiazine + dihydro-4-isopropyl-2,6-dimethyl-4H-1,3,5-dithiazine | | 2,4- | dimethyl-6-propan-2-yl-1,3,5-dithiazinane | | 2(4)-iso | propyl-4(2),6-dimethyl dihydro-4H-1,3,5-dithiazine |
soluble in :
|
| | alcohol | | | propylene glycol |
insoluble in :
|
| | water |
potential blenders : note
|
| | acetyl acetaldehyde dimethyl acetal | FL |
| 2- | acetyl furan | FL/FR |
| | acetyl propionyl | FL/FR |
| 2- | acetyl pyrazine | FL/FR |
| 3- | acetyl pyridine | FL/FR |
| 2- | acetyl pyrrole | FL/FR |
| | acetyl pyrroline | FL |
| 2- | acetyl thiazole | FL/FR |
| 2- | acetyl-2-thiazoline | FL |
| 5- | acetyl-2,3-dihydro-1,4-thiazine | FL |
| 3- | acetyl-2,5-dimethyl furan | FL/FR |
| 2- | acetyl-3-ethyl pyrazine | FL |
| 2- | acetyl-3-methyl pyrazine | FL/FR |
| 2- | acetyl-3,5-dimethyl pyrazine | FL/FR |
| 2- | acetyl-5-methyl furan | FL/FR |
| | amyl cinnamate | FL/FR |
| iso | amyl cinnamate | FL/FR |
| iso | amyl nonanoate | FL/FR |
| iso | amyl phenyl acetate | FL/FR |
| alpha- | angelica lactone | FL/FR |
| | bornyl isobutyrate | FL/FR |
| | boronia butenal | FR |
| | butyl 2-methyl butyrate | FL/FR |
| | butyl cinnamate | FL/FR |
| | butyl laurate | FL/FR |
| 2-iso | butyl-3,(5 and 6)-dimethyl pyrazine | FL/FR |
| 2(4)-iso | butyl-4(2),6-dimethyl dihydro-4H-1,3,5-dithiazine | FL |
| | butyramide | FL |
| | cedrenyl acetate | FR |
| | chocolate notes | |
| | chocolate pyrazine A | FL/FR |
| | cocoa butenal | FL/FR |
| | cocoa hexenal | FL/FR |
| | cocoa oleoresin | FL |
| | cocoa pentenal | FL/FR |
| | cocoa propanal | FL |
| 3,6- | cocoa pyrazine | FL |
| | coconut absolute | FL/FR |
| | coumane | FL/FR |
| para- | cresyl laurate | FL/FR |
| | cyclohexyl methyl pyrazine | FL |
| 2,5- | diethyl thiazole | FL |
| 3,5- | diethyl-2-methyl pyrazine | FL |
| 2,5- | diethyl-3-methyl pyrazine | FL |
| 2,5- | diethyl-4-methyl thiazole | FL |
| | difurfuryl ether | FL |
| 6,7- | dihydro-2,3-dimethyl-5H-cyclopentapyrazine | FL |
| | dimethyl dihydrocyclopentapyrazine | FL |
| 2,3- | dimethyl pyrazine | FL/FR |
| 2,5- | dimethyl pyrazine | FL/FR |
| 2,6- | dimethyl pyrazine | FL/FR |
| 2,6- | dimethyl pyridine | FL |
| 2,5- | dimethyl thiazole | FL |
| 4,5- | dimethyl thiazole | FL |
| 2,5- | dimethyl thiophene | FL |
| 4,5- | dimethyl-2-ethyl thiazole | FL |
| 2,4- | dimethyl-5-vinyl thiazole | FL |
| | ethyl 2-hydroxy-2-methyl butyrate | FL/FR |
| 2- | ethyl butyraldehyde | FL |
| | ethyl phenyl acetate | FL/FR |
| 2- | ethyl pyrazine | FL/FR |
| 1- | ethyl-2-acetyl pyrrole | FL |
| 5- | ethyl-2-methyl pyridine | FL |
| 2- | ethyl-3-methoxypyrazine | FL/FR |
| 2- | ethyl-4-butanol | FL/FR |
| 2- | ethyl-4-methyl thiazole | FL/FR |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline | FL |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline | FL |
| | fenugreek oleoresin | FL |
| | fenugreek resinoid | FL/FR |
| | filbert heptenone | FL/FR |
| | filbert pyrazine | FL |
| | furfuryl thioacetate | FL |
| 3-(2- | furyl) acrolein | FL |
| laevo- | glutamine | CS |
| | hazelnut notes | |
| | hazelnut oleoresin | FL |
| | hazelnut pyrazine | FL/FR |
| (E,E)-2,4- | heptadien-1-ol | FL |
| gamma- | heptalactone | FL/FR |
| 2- | heptyl furan | FL |
| 2,4- | hexadien-1-ol | FL |
| 3,4- | hexane dione | FL/FR |
| 2- | hexyl-5 or 6-keto-1,4-dioxane | FL |
| 4- | hydroxybenzoic acid | FL |
| | maraniol | CS |
| | menthofuran | FL/FR |
| 2- | methoxy-3-methyl pyrazine | FL/FR |
| 2- | methoxy-4-vinyl phenol | FL/FR |
| 2- | methoxypyrazine | FL/FR |
| 2- | methyl anisole | FL/FR |
| para- | methyl anisole | FL/FR |
| 2- | methyl butyraldehyde | FL |
| | methyl ethoxypyrazine | FL |
| 2- | methyl pyrazine | FL/FR |
| 2- | methyl quinoxaline | FL |
| 5- | methyl quinoxaline | FL/FR |
| 4- | methyl thiazole | FL |
| 2- | methyl thio-3,5 or 6-methyl pyrazine | FL/FR |
| 2-( | methyl thio) acetaldehyde | FL |
| | methyl valerate | FL/FR |
| 3- | methyl-2-buten-1-al | FL/FR |
| 2- | methyl-3-(methyl thio) pyrazine | FL/FR |
| 2- | methyl-3-propyl pyrazine | FL/FR |
| 2- | methyl-3,(5 or 6)-ethoxypyrazine | FL |
| 2- | methyl-5-isopropyl pyrazine | FL |
| (E,E)-2,4- | nonadien-1-al | FL |
| | nutty cyclohexenone | FL/FR |
| | nutty pyrazine | FL/FR |
| | nutty quinoxaline | FL/FR |
| | nutty thiazole | FL |
| | peanut dithiazine | FL |
| | peanut oxazole | FL |
| | phenethyl octanoate | FL/FR |
| | phenyl acetaldehyde | FL/FR |
| 2- | propionyl thiazole | FL |
| 2- | propionyl-2-thiazoline | FL |
| | propyl benzoate | FL/FR |
| iso | propyl formate | FL/FR |
| iso | propyl pyrazine | FL |
| 2- | propyl pyridine | FL |
| | saffron pyranone | FR |
| | sandalwood oil | FL/FR |
| | shoyu pyrazine | FL/FR |
| | sulfuryl butyrate | FL/FR |
| | sulfuryl decanoate | FL/FR |
| | sulfuryl formate | FL |
| | sulfuryl hexanoate | FL/FR |
| | sulfuryl isobutyrate | FL/FR |
| | sulfuryl octanoate | FL/FR |
| | sulfuryl propionate | FL/FR |
| 2,3,5,6- | tetramethyl pyrazine | FL |
| (E)- | tiglic aldehyde | FL/FR |
| | tobacco butenal | FR |
| | tonka bean absolute | FR |
| | tonka bean resinoid | FR |
| 2,3,5- | trimethyl pyrazine | FL |
| 2,4,5- | trimethyl thiazole | FL/FR |
| | valeraldehyde | FL/FR |
| | valeraldehyde dibutyl acetal | FL/FR |
| | valeraldehyde propylene glycol acetal | FL/FR |
| gamma- | valerolactone | FL/FR |
| 2- | vinyl pyrazine | FL |
| | vinyl sulfurol | FL |
| | whiskey lactone | FL/FR |
potential uses :
|
| | arnica | | | bean locust bean | | | chestnut blossom | | | chocolate | | | chocolate cacao | | | chocolate cocoa | | | coconut | | | coconut tropical coconut | | | mace | | | nut | | | nut almond | | | nut cashew | | | nut filbert | | | nut hazelnut | | | nut macadamia | | | nut peanut | | | nut peanut butter | | | nut pecan | | | nut pistachio | | | nut roasted | | | nut sesame | | | nut walnut | | | nutmeg | | | pina colada | | | praline |
natural occurrence in : note
|
| | found in nature
| |
|