| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 1-pyridin-2-ylethanone | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C7H7NO/c1-6(9)7-4-2-3-5-8-7/h2-5H,1H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | AJKVQEKCUACUMD-UHFFFAOYAY | |||||||||||||||||||||||||||||||||
| SMILES : | CC(=O)C1=CC=CC=N1 | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2933.39.5000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | popcorn | |||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description : at 1.00 % in propylene glycol. | popcorn heavy corn chip fatty tobacco | |||||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Cornmeal with a nutty and bready nuance | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | pale yellow to brown clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| specific gravity : | 1.00000 - 1.10000 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.321 to 9.153 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.51000 - 1.53000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 188.00 - 189.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 78.00 °C. @ 12.00 mm Hg | |||||||||||||||||||||||||||||||||
| logp : | 0.85 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2280.00 mg/kg FCTXAV 13,487,1975 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 164.00 °F. TCC ( 73.33 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for 2-acetyl pyridine usage levels up to : | ||||||||||||||||||||||||||||||||||
| 0.5000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for 2-acetyl pyridine usage levels up to : | ||||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 214-355-6 | |||||||||||||||||||||||||||||||||
| rtecs : | OB5310000 for 1122-62-9 | |||||||||||||||||||||||||||||||||
| chemidplus : | 001122629 | |||||||||||||||||||||||||||||||||
| epa-srs : | 1122-62-9 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 15043 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| jecfa number : | 1309 | |||||||||||||||||||||||||||||||||
| fl. number : | 14.038 | |||||||||||||||||||||||||||||||||
| pubchem : | 157573 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4052643167 | |||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 17, No. 1, 41, (1992)³ | |||||||||||||||||||||||||||||||||
| synonyms : | |
| 2- | acetopyridine |
| 2- | acetyl pyridine |
| methyl-2-pyridyl ketone | |
| popcorn pyridine | |
| 1-(2- | pyridinyl) ethanone |
| 2- | pyridyl methyl ketone |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| ethyl ether | |
| water, 18700 mg/L @ 25C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| 2- | acetyl pyrazine |
| 2- | acetyl-2-thiazoline |
| allyl amyl glycolate | |
| ambroxan | |
| iso | amyl phenyl acetate |
| amyris wood oil | |
| benzoin resinoid | |
| benzyl salicylate | |
| caramel furanone | |
| cassia bark oil | |
| currant bud absolute black | |
| gamma- | decalactone |
| ethyl vanillin | |
| guaiacyl phenyl acetate | |
| heliotropin | |
| heliotropyl acetone | |
| immortelle absolute | |
| labdanum resinoid | |
| maltol | |
| methyl cyclopentenolone | |
| 2- | methyl undecanal |
| nerolidol | |
| nonanol | |
| powdery ketone | |
| santall | |
| tobacco dodecane | |
| tonka bean absolute | |
| vanilla absolute | |
| verymoss | |
| (odor and/or flavor) used in : | |
| acorn | |
| barley | |
| bread | |
| bread baked bread | |
| bread crisp bread | |
| bread crust | |
| bread rye bread | |
| bread wheat bread | |
| bread white bread | |
| cake | |
| chocolate cocoa | |
| coffee | |
| corn | |
| corn chip | |
| gingerbread | |
| graham cracker | |
| nut | |
| nut almond | |
| nut cashew | |
| nut filbert | |
| nut hazelnut | |
| nut peanut | |
| nut pecan | |
| nut pistachio | |
| nut roasted | |
| nut sesame | |
| pizza | |
| popcorn | |
| taco | |
| toasted | |
| tobacco tabac tabaco | |
| wheat | |
| natural occurrence in : | |
| coffee | |