| |
| Right Click Jmol Molecule For More Options. (Safari 1.2 (v125) Compatible). Jmol is a free download found Here. |
| |
|
|
| IUPAC name : | 5-hexyl-1,4-dioxan-2-one |
| InChI : | InChI=1/C10H18O3/c1-2-3-4-5-6-9-7-13-10(11)8-12-9/h9H,2-8H2,1H3 |
| InChIKey : | KBOAQIXMCPQXIP-UHFFFAOYAS |
| SMILES : | CCCCCCC1COC(=O)CO1 |
| cas number : | 65504-97-4 |
| fema number : | 2574 |
| jecfa number : | 1486 |
| molar refractivity : | 49.64 ± 0.3 cm3 |
| parachor : | 444.7 ± 6.0 cm3 |
| index of refraction : | 1.439 ± 0.02 |
| surface tension : | 30.9 ± 3.0 dyne/cm |
| density : | 0.987 ± 0.06 g/cm3 |
| polarizability : | 19.68 ± 0.5 10-24cm3 |
| XlogP : | 2.60 |
| molecular weight : | 186.2481200 (IUPAC) |
| formula : | C10 H18 O3 |
| NMR Predictor : | Predict |
|
|
| |
| |
| export tariff code : | 2932.29.6000 |
| fda reg : | unspecified |
Suppliers :
|
| Need This Molecule?: | You can contact the Chemical Sources Association and ask the Sourceress. |
organoleptics :
|
| odor type : | nutty |
| odor strength : | high , recommend smelling in a 1.00 % solution or less |
odor description: at 1.00 % in dipropylene glycol. | sweet nutty |
properties :
|
| appearence : | colorless to pale yellow clear liquid |
| assay : | 97.00 to 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 1.28000 to 1.28600 @ 25.00 °C.
|
| pounds per gallon - calc. : | 10.651 to 10.701
|
| refractive index : | 1.48600 to 1.49200 @ 20.00 °C.
|
| boiling point : | 104.00 °C. @ 15.00 mm Hg
|
| flash point : | 245.00 °F. TCC ( 118.33 °C. )
|
| logP (o/w) : | 1.61 |
safety :
|
| Oral Toxicity(LD50) : | | | |
Not determined
|
| Dermal Toxicity(LD50) : | | | |
Not determined
|
| Inhalation Toxicity(LC50) : | | | |
Not determined
|
| |
safety in use :
|
| Category : | flavoring agents |
| |
| recommendation for 2-hexyl-5 or 6-keto-1,4-dioxane fragrance usage levels up to : | | | not for fragrance use.
|
safety references :
|
| EPI System : | view |
| Canada Domestic Sub. List : | Yes |
| |
| | | |
| | 5-hexyl-1,4-dioxan-2-one |
| chemidplus : | 065504974 |
| EPA Substance Registry Services : | 65504-97-4 |
references :
|
| | 5-hexyl-1,4-dioxan-2-one |
| jecfa number : | 1486 |
| pubchem : | 3749999 |
other :
|
| FDA Everything Added to Food in the United States (EAFUS) | View |
|
synonyms :
|
| 5 or 6- | hexyl-1,4-dioxan-2-one | | 5- | hexyl-1,4-dioxan-2-one | | 1 or 2- | hexyl-2-hydroxyethoxyacetic acid delta-lactone |
Similar Products: note
|
| 2- | amyl-5 or 6-keto-1,4-dioxane |
| 2- | butyl-5(6)-keto-1,4-dioxane |
soluble in :
|
| | alcohol | | | water, slightly |
insoluble in :
|
| | water |
potential blenders : note
|
| | acetyl propionyl | FL/FR |
| 2- | acetyl pyrazine | FL/FR |
| 3- | acetyl pyridine | FL/FR |
| 2- | acetyl pyrrole | FL/FR |
| | acetyl pyrroline | FL |
| 2- | acetyl thiazole | FL/FR |
| 2- | acetyl-2-thiazoline | FL |
| 5- | acetyl-2,3-dihydro-1,4-thiazine | FL |
| 3- | acetyl-2,5-dimethyl furan | FL/FR |
| 2- | acetyl-3-ethyl pyrazine | FL |
| 2- | acetyl-3-methyl pyrazine | FL/FR |
| 2- | acetyl-3,5-dimethyl pyrazine | FL/FR |
| 2- | acetyl-5-methyl furan | FL/FR |
| | allyl 2-ethyl butyrate | FL |
| iso | amyl nonanoate | FL/FR |
| alpha- | angelica lactone | FL/FR |
| | benzothiazole | FL |
| | bornyl isobutyrate | FL/FR |
| | boronia butenal | FR |
| | butyramide | FL |
| | butyroin | FL |
| | chocolate pyrazine A | FL/FR |
| | chocolate pyrazine B | FL |
| | cocoa pyrazine | FL/FR |
| 3,6- | cocoa pyrazine | FL |
| | coconut absolute | FL/FR |
| | coffee furanone | FL |
| | coumane | FL/FR |
| | coumarin | FR |
| para- | cresyl laurate | FL/FR |
| | cyclohexyl methyl pyrazine | FL |
| (E,E)-2,4- | decadien-1-al | FL |
| 2,5- | diethyl thiazole | FL |
| 3,5- | diethyl-2-methyl pyrazine | FL |
| 2,5- | diethyl-3-methyl pyrazine | FL |
| 2,5- | diethyl-4-methyl thiazole | FL |
| | difurfuryl ether | FL |
| 6,7- | dihydro-2,3-dimethyl-5H-cyclopentapyrazine | FL |
| | dihydroxyacetophenone | FL |
| | dimethyl dihydrocyclopentapyrazine | FL |
| 2,3- | dimethyl pyrazine | FL/FR |
| 2,5- | dimethyl pyrazine | FL/FR |
| 2,6- | dimethyl pyridine | FL |
| 2,5- | dimethyl thiazole | FL |
| 4,5- | dimethyl thiazole | FL |
| 2,5- | dimethyl thiophene | FL |
| 4,5- | dimethyl-2-ethyl-3-thiazoline | FL |
| 2,4- | dimethyl-5-vinyl thiazole | FL |
| 2- | ethoxythiazole | FL |
| | ethyl 2-hydroxy-2-methyl butyrate | FL/FR |
| 2- | ethyl pyrazine | FL/FR |
| 1- | ethyl-2-acetyl pyrrole | FL |
| 5- | ethyl-2-methyl pyridine | FL |
| 2- | ethyl-3-methoxypyrazine | FL/FR |
| 2- | ethyl-4-methyl thiazole | FL/FR |
| (Z+E)-5- | ethyl-4-methyl-2-(2-butyl) thiazoline | FL |
| (Z+E)-5- | ethyl-4-methyl-2-(2-methyl propyl) thiazoline | FL |
| | filbert heptenone | FL/FR |
| | filbert pyrazine | FL |
| | furfuryl thioacetate | FL |
| 3-(2- | furyl) acrolein | FL |
| | hazelnut pyrazine | FL/FR |
| (E,E)-2,4- | heptadien-1-ol | FL |
| gamma- | heptalactone | FL/FR |
| 2- | heptyl furan | FL |
| 2,4- | hexadien-1-ol | FL |
| 3,4- | hexane dione | FL/FR |
| 4- | hydroxybenzoic acid | FL |
| | maraniol | CS |
| | menthofuran | FL/FR |
| 2- | methoxypyrazine | FL/FR |
| | methyl 2-(methyl thio) acetate | FL |
| 2- | methyl anisole | FL/FR |
| para- | methyl anisole | FL/FR |
| 2- | methyl butyraldehyde | FL |
| 2- | methyl pyrazine | FL/FR |
| 2- | methyl quinoxaline | FL |
| 5- | methyl quinoxaline | FL/FR |
| 4- | methyl thiazole | FL |
| 2- | methyl thio-3,5 or 6-methyl pyrazine | FL/FR |
| 2-( | methyl thio) acetaldehyde | FL |
| | methyl valerate | FL/FR |
| 3- | methyl-2-buten-1-al | FL/FR |
| 2- | methyl-3-(methyl thio) pyrazine | FL/FR |
| 2- | methyl-3-propyl pyrazine | FL/FR |
| 2- | methyl-3,(5 or 6)-ethoxypyrazine | FL |
| 2- | methyl-5-isopropyl pyrazine | FL |
| (E,E)-2,4- | nonadien-1-al | FL |
| (E,Z)-2,6- | nonadien-1-yl acetate | FL/FR |
| | nutty cyclohexenone | FL/FR |
| | nutty quinoxaline | FL/FR |
| | nutty thiazole | FL |
| | peanut dithiazine | FL |
| | peanut oxazole | FL |
| | popcorn pyrimidine | FL/FR |
| | propionaldehyde | FL |
| 2- | propionyl thiazole | FL |
| 2- | propionyl-2-thiazoline | FL |
| | propyl benzoate | FL/FR |
| iso | propyl pyrazine | FL |
| 2- | propyl pyridine | FL |
| | saffron pyranone | FR |
| | shoyu pyrazine | FL/FR |
| | sulfuryl butyrate | FL/FR |
| | sulfuryl decanoate | FL/FR |
| | sulfuryl formate | FL |
| | sulfuryl hexanoate | FL/FR |
| | sulfuryl isobutyrate | FL/FR |
| | sulfuryl octanoate | FL/FR |
| | sulfuryl propionate | FL/FR |
| 2,3,5,6- | tetramethyl pyrazine | FL |
| | tobacco butenal | FR |
| | tonka bean absolute | FR |
| | tonka bean resinoid | FR |
| 2,3,5- | trimethyl pyrazine | FL |
| | tropical thiazole | FL/FR |
| | valeraldehyde | FL/FR |
| | valeraldehyde dibutyl acetal | FL/FR |
| | valeraldehyde propylene glycol acetal | FL/FR |
| 2- | vinyl pyrazine | FL |
| | vinyl sulfurol | FL |
| | whiskey lactone | FL/FR |
potential uses :
|
| | nut |
natural occurrence in : note
|
| | not found in nature
| |
|