| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 1-pyrazin-2-ylethanone | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H6N2O/c1-5(9)6-4-7-2-3-8-6/h2-4H,1H3 | |||||||||||||||||||||||||||||||
| InChIKey : | DBZAKQWXICEWNW-UHFFFAOYAU | |||||||||||||||||||||||||||||||
| SMILES : | CC(=O)C1=NC=CN=C1 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2933.90.8300 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | popcorn | |||||||||||||||||||||||||||||||
| odor strength : | very high , recommend smelling in a 0.10 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 0.10 % in propylene glycol. | popcorn nutty corn chip bread crust chocolate hazelnut coffee | |||||||||||||||||||||||||||||||
| taste description³ : | at 10.00 ppm. Roasted, nutty, bready and yeasty, with popcorn and corn chip nuances | |||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | white to pale yellow crystals | |||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||
| melting point : | 75.00 - 78.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| logp : | 0.20 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for 2-acetyl pyrazine usage levels up to : | ||||||||||||||||||||||||||||||||
| 0.0500 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for 2-acetyl pyrazine usage levels up to : | ||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 244-753-5 | |||||||||||||||||||||||||||||||
| chemidplus : | 022047252 | |||||||||||||||||||||||||||||||
| epa-srs : | 22047-25-2 | |||||||||||||||||||||||||||||||
| dtp/nci : | 72374 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 172969 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1725064163 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 17, No. 1, 41, (1992)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| acetyl pyrazine | |
| 2- | acetyl pyrazine |
| methyl pyrazinyl ketone | |
| popcorn pyrazine | |
| pyrazin-1-yl ethan-1-one | |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| water, 66500 mg/L @ 25C | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| 2- | acetyl furan |
| 2- | acetyl pyridine |
| 2- | acetyl-2-thiazoline |
| ambroxan | |
| iso | amyl benzoate |
| iso | amyl phenyl acetate |
| amyris wood oil | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl salicylate | |
| caramel furanone | |
| cassia bark oil | |
| coffee furanone | |
| currant bud absolute black | |
| gamma- | decalactone |
| diacetyl | |
| 2,6- | dimethyl pyridine |
| ethyl maltol | |
| ethyl vanillin | |
| guaiacyl phenyl acetate | |
| heliotropin | |
| heliotropyl acetone | |
| immortelle absolute | |
| maltol | |
| mastic resin | |
| methyl cyclopentenolone | |
| 2- | methyl undecanal |
| ocean propanal | |
| phenyl acetic acid | |
| 3- | phenyl propyl alcohol |
| tonka bean absolute | |
| vanilla absolute | |
| verymoss | |
| (odor and/or flavor) used in : | |
| acorn | |
| barley | |
| bread baked bread | |
| bread crisp bread | |
| bread crust | |
| bread rye bread | |
| bread wheat bread | |
| bread white bread | |
| cake | |
| chocolate cocoa | |
| coffee | |
| corn chip | |
| gingerbread | |
| graham cracker | |
| nut almond | |
| nut cashew | |
| nut filbert | |
| nut hazelnut | |
| nut peanut | |
| nut pecan | |
| nut pistachio | |
| nut roasted | |
| nut sesame | |
| pizza | |
| popcorn | |
| taco | |
| toasted | |
| wheat | |
| natural occurrence in : | |
| almond roasted almond | |
| bread | |
| cocoa | |
| coffee | |
| filbert | |
| peanut | |
| popcorn | |
| potato chip | |
| sesame oil | |