| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 4-hydroxy-2,5-dimethylfuran-3-one | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3,8H,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | INAXVXBDKKUCGI-UHFFFAOYAH | |||||||||||||||||||||||||||||||||||
| SMILES : | CC1C(=O)C(=C(O1)C)O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| IUPAC name : | (5R)-2,5-dimethyloxolane-3,4-dione | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3-4H,1-2H3/t3-,4u/m1/s1 | |||||||||||||||||||||||||||||||||||
| InChIKey : | PUVDDHUFFRRFMN-SYPWQXSBBU | |||||||||||||||||||||||||||||||||||
| SMILES : | CC1C(=O)C(=O)[C@H](O1)C | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| IUPAC name : | (5S)-2,5-dimethyloxolane-3,4-dione | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3-4H,1-2H3/t3-,4u/m0/s1 | |||||||||||||||||||||||||||||||||||
| InChIKey : | PUVDDHUFFRRFMN-WUCPZUCCBJ | |||||||||||||||||||||||||||||||||||
| SMILES : | CC1C(=O)C(=O)[C@@H](O1)C | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| export tariff code : | 2932.19.0000 | |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||||
| Advanced Biotech : | strawberry furanone
98% min. natural Odor: Strawberry | |||||||||||||||||||||||||||||||||||
| Advanced Biotech : | strawberry furanone
98% min. synthetic Odor: Burnt, Caramel, Fruity, Pineapple | |||||||||||||||||||||||||||||||||||
| Advanced Biotech : | walnut furanone
15% min. (in PG) synthetic Odor: Walnut, to match standard | |||||||||||||||||||||||||||||||||||
| Berje : | Dimethyl Hydroxy Furanone
Natural | |||||||||||||||||||||||||||||||||||
| Elan : | carmelan
100%, (natural), Kosher | |||||||||||||||||||||||||||||||||||
| Fleurchem : | flerueol (strawberry furanone)
natural | |||||||||||||||||||||||||||||||||||
| Frutarom : | NATURAL HYDROXY DIMETHYL FURANONE
≥98.00%, natural, Kosher Odor: Candy Floss, Caramel, Sweet | |||||||||||||||||||||||||||||||||||
| Givaudan : | Furonol
≥90%, natural (US Only), Kosher Odor: Sweet,Brown,Cotton Candy | |||||||||||||||||||||||||||||||||||
| Mane : | strawberry furanone | |||||||||||||||||||||||||||||||||||
| Moellhausen : | furaneol
99% min. nature identical kosher Odor: strongly fruity, on dilution strawberry and pineapple-like Flavor: sweet, caramel-fruity (pineapple-like), fried meat aspects brown, caramellic, jammy, cotton candy, sugary | |||||||||||||||||||||||||||||||||||
| Mooreganics : | Strawberry Furanone, Pure
Natural (Organic Compliant) | |||||||||||||||||||||||||||||||||||
| Penta : | strawberry furanone | |||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | 4-Hydroxy-2,5-dimethyl-3(2H)-furanone
≥98%, FCC, Kosher, FG Odor: strawberry; sweet | |||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | 4-Hydroxy-2,5-dimethyl-3(2H)-furanone
≥98%, natural, FG Odor: strawberry; sweet | |||||||||||||||||||||||||||||||||||
| Treatt : | Hydroxy-2,5-dimethyl-3(2H)furanone | |||||||||||||||||||||||||||||||||||
| Vigon : | Furaneol Strawberry Furanone
Odor: FRUITY, CARAMEL | |||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | caramellic | |||||||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 1.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description :¹ at 1.00 % in propylene glycol. | sweet cotton candy caramel strawberry sugar | |||||||||||||||||||||||||||||||||||
| odor sample from : | CA Aromatics Company Inc. | |||||||||||||||||||||||||||||||||||
| substantivity : | 320 Hour(s) | |||||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | white to pale yellow solid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| melting point : | 78.00 to 81.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 3.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| flash point : | 200.00 °F. TCC ( 93.33 °C. ) | |||||||||||||||||||||||||||||||||||
| logP (o/w) : | 0.34 | |||||||||||||||||||||||||||||||||||
| shelf life : | 12.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | refrigerate in tightly sealed containers. store under nitrogen. | |||||||||||||||||||||||||||||||||||
| moisture Sensitive. | ||||||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
|
R 22 - Harmful if swallowed. S 02 - Keep out of the reach of children. S 20/21 - When using do not eat, drink or smoke. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||||||||
|
Oral-Mouse 1608.00 mg/kg Zhonghua Yufangyixue Zazhi. Chinese Journal of Preventive Medicine. Vol. 22, Pg. 85, 1988. | ||||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 4483.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-USA) : | 5203.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| Structure Class : | II | |||||||||||||||||||||||||||||||||||
| recommendation for strawberry furanone usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 5.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for strawberry furanone usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||||||
| European Food Safety Athority(efsa) : | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... | |||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||||
| Chemical Carcinogenesis Research Information System : | Search | |||||||||||||||||||||||||||||||||||
| Cancer Citations : | Search | |||||||||||||||||||||||||||||||||||
| Toxicology Citations : | Search | |||||||||||||||||||||||||||||||||||
| Env. Mutagen Info. Center : | Search | |||||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | Search | |||||||||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||||||||
| WGK Germany : | 3 | |||||||||||||||||||||||||||||||||||
| 4-hydroxy-2,5-dimethylfuran-3-one | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 222-908-8 | |||||||||||||||||||||||||||||||||||
| RTECS : | LU3990000 for 3658-77-3 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 003658773 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 3658-77-3 | |||||||||||||||||||||||||||||||||||
| (5R)-2,5-dimethyloxolane-3,4-dione | ||||||||||||||||||||||||||||||||||||
| chemidplus : | 131222-82-7 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 131222-82-7 | |||||||||||||||||||||||||||||||||||
| (5S)-2,5-dimethyloxolane-3,4-dione | ||||||||||||||||||||||||||||||||||||
| chemidplus : | 131222-81-6 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 131222-81-6 | |||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||||
| 4-hydroxy-2,5-dimethylfuran-3-one | ||||||||||||||||||||||||||||||||||||
| fl. number : | 13.010 | |||||||||||||||||||||||||||||||||||
| jecfa number : | 1446 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3289447321 | |||||||||||||||||||||||||||||||||||
| pubchem : | 162243 | |||||||||||||||||||||||||||||||||||
| (5R)-2,5-dimethyloxolane-3,4-dione | ||||||||||||||||||||||||||||||||||||
| pubchem : | 43559612 | |||||||||||||||||||||||||||||||||||
| (5S)-2,5-dimethyloxolane-3,4-dione | ||||||||||||||||||||||||||||||||||||
| pubchem : | 43559611 | |||||||||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||||||||
| Cosmetic uses : |
masking agents tonic | |||||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1995)¹ | |||||||||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| synonyms : | |
| alletone | |
| alnose | |
| cadion | |
| dimethyl hydroxyfuranone | |
| 2,5- | dimethyl-3-hydroxy-4-oxo-4,5-dihydrofuran |
| 2,5- | dimethyl-4-hydroxy-2,3-dihydrofuran-3-one |
| 2,5- | dimethyl-4-hydroxy-3(2H)-furanone |
| enhansol | |
| furaneol | |
| 4- | hydroxy-2,5-dimethyl furan-2(3H)-one |
| 4- | hydroxy-2,5-dimethyl-3(2H)-furanone |
| 4- | hydroxy-2,5-dimethylfuran-3-one |
| pineapple compound | |
| pineapple ketone | |
| walnut furanone | |
soluble in : | |
| alcohol | |
| dipropylene glycol | |
| propylene glycol | |
| water, slightly | |
insoluble in : | |
| water | |
| paraffin oil | |
| isopropyl myristate | |
(odor and/or flavor) blends with : | |
| acetoin | |
| 2- | acetyl furan |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| beeswax absolute | |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| benzyl salicylate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| iso | butyl cinnamate |
| caramel furanone | |
| cassia bark oil | |
| chocolate pyrazine | |
| cinnamyl alcohol | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coconut absolute | |
| coffee furanone | |
| coriander seed oil | |
| coumarin | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| gamma- | decalactone |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl acetate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl cinnamate | |
| 2- | ethyl furan |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| geraniol | |
| grapefruit pentanol | |
| green acetate | |
| heliotropin | |
| heliotropyl acetate | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| alpha- | hexyl cinnamaldehyde |
| ho leaf oil | |
| hyacinth ether | |
| hydroxycitronellal | |
| immortelle absolute | |
| ionones | |
| leerall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| maltol | |
| methyl cinnamate | |
| methyl cyclopentenolone | |
| methyl dihydrojasmonate | |
| methyl ionones | |
| methyl phenyl acetate | |
| mimosa absolute | |
| muguet carboxaldehyde | |
| musks | |
| beta- | naphthyl ethyl ether |
| nerol | |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-al |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| (Z)-5- | octen-1-ol |
| orange oil | |
| patchouli ethanone | |
| peony alcohol | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenyl acetaldehyde dimethyl acetal | |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| santall | |
| strawberry glycidate 1 | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco dodecane | |
| para- | tolyl aldehyde |
| tonka bean absolute | |
| 2,4,5- | trimethyl thiazole |
| gamma- | undecalactone |
| vanilla absolute | |
| vanillyl acetate | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
(odor and/or flavor) used in : | |
| beeswax cire d'abeille | |
| blackberry | |
| blossom tropical blossom | |
| blueberry | |
| boysenberry | |
| bread | |
| butterscotch | |
| cake | |
| candy cotton candy | |
| cappuccino | |
| caramel | |
| cassia | |
| cereal | |
| cherry | |
| chocolate cacao | |
| chocolate cocoa | |
| coconut | |
| coconut tropical coconut | |
| coffee | |
| cookie | |
| currant | |
| date | |
| fantasy blends | |
| fig | |
| fir balsam | |
| fruit | |
| fruit jam | |
| fruit punch | |
| fruit tropical fruit | |
| gingerbread | |
| gooseberry | |
| graham cracker | |
| grape | |
| guava | |
| hay new mown hay foin coupe | |
| hibiscus | |
| honey miel | |
| huckleberry bilberry | |
| loganberry dewberry | |
| malt | |
| mango | |
| mango blossom | |
| maple | |
| marshmallow | |
| melon watermelon muskmelon cantaloupe | |
| molasses | |
| nut | |
| nut almond | |
| nut filbert | |
| passion blossom | |
| passion fruit | |
| pina colada | |
| pineapple | |
| popcorn | |
| praline | |
| pumpkin | |
| quince | |
| raspberry | |
| rum butter rum | |
| strawberry | |
| strawberry jam | |
| sugar brown sugar | |
| tobacco tabac tabaco | |
| toffee | |
| tropical | |
| tutti frutti | |
| vanilla | |
natural occurrence in : | |
| almond roasted almond | |
| arctic bramble | |
| beef cooked beef | |
| coffee | |
| filbert roasted filbert | |
| gooseberry cape | |
| grape concord grape | |
| guava fruit | |
| malt | |
| mango | |
| pineapple | |
| popcorn | |
| raspberry | |
| strawberry | |