Notes :
Coumarin replacer.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 3,4,4a,5,6,7,8,8a-octahydrochromen-2-one | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C9H14O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h7-8H,1-6H2 | |||||||||||||||||||||||||||||||
| InChIKey : | MSFLYJIWLHSQLG-UHFFFAOYAH | |||||||||||||||||||||||||||||||
| SMILES : | C1CCC2C(C1)CCC(=O)O2 | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| export tariff code : | 2932.29.6000 | |||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||
| International Flavors & Fragrances : | Bicyclononalactone
≥98% (sum of isomers) | |||||||||||||||||||||||||||||||
| Takasago : | Cyclohexyl Lactone
≥98% as Cyclohexyl lactone | |||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | tonka | |||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description :¹ : at 10.00 % in dipropylene glycol. | sweet herbal coumarin tonka woody | |||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % sum of isomers | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| specific gravity : | 1.09200 to 1.09800 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.087 to 9.136 | |||||||||||||||||||||||||||||||
| refractive index : | 1.48400 to 1.49900 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| boiling point : | 144.00 to 146.00 °C. @ 16.00 mm Hg | |||||||||||||||||||||||||||||||
| logp : | 1.55 | |||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3900.00 mg/kg | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 3500.00 mg/kg | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 305.00 °F. TCC ( 151.67 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for octahydrocoumarin usage levels up to : | ||||||||||||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for octahydrocoumarin usage levels up to : | ||||||||||||||||||||||||||||||||
| 10.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 224-623-4 | |||||||||||||||||||||||||||||||
| RTECS : | GN8261500 for 4430-31-3 | |||||||||||||||||||||||||||||||
| chemidplus : | 004430313 | |||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 4430-31-3 | |||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 4430-31-3 | |||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 4430-31-3 | |||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 4430-31-3 | |||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 4430-31-3 | |||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||
| jecfa number : | 1166 | |||||||||||||||||||||||||||||||
| fl. number : | 13.161 | |||||||||||||||||||||||||||||||
| pubchem : | 163308 | |||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1987)¹ | |||||||||||||||||||||||||||||||
| synonyms : | |
| 2-oxa | bicyclo(4.4.0)decan-3-one |
| bicyclononalactone | |
| cyclohexyl lactone | |
| octahydro-(2H)-1-benzopyran-2-one | |
| octahydro-1-benzopyran-2-one | |
| octahydro-2H-1-benzopyran-2-one | |
| octahydrocoumarin | |
soluble in : | |
| alcohol | |
insoluble in : | |
| water | |
stability : | |
| alcoholic fine fragrance, good | |
| antiperspirant, fair | |
| cold wave lotion, good | |
| deo stick | |
| fabric softener | |
| hard surface cleaner | |
| hypochlorite bleach, poor | |
| inorganic acid cleaner, good | |
| liquid detergent, fair | |
| non-discoloring | |
| perborate powder detergent, good | |
| shampoo | |
| soap, good | |
| toiletry application, good | |
(odor and/or flavor) blends with : | |
| 2- | acetyl pyrrole |
| 2- | acetyl-5-methyl furan |
| 6- | amyl-alpha-pyrone |
| anisonitrile | |
| para- | anisyl acetate |
| cherry propanol | |
| coconut decanone | |
| coconut naphthalenone | |
| coumane | |
| coumarin | |
| deertongue absolute | |
| deertongue concrete | |
| deertongue oleoresin | |
| dehydromenthofurolactone | |
| (R)- | dihydroactinidiolide |
| dihydrocoumarin | |
| fenugreek absolute | |
| fig leaf absolute | |
| flouve absolute | |
| hay absolute | |
| heliotropin | |
| gamma- | heptalactone |
| gamma- | hexalactone |
| immortelle absolute | |
| immortelle flower oil | |
| lime oil expressed florida | |
| lovage oleoresin | |
| melilot absolute | |
| melilot oleoresin | |
| methyl acetophenone | |
| 7- | methyl coumarin |
| 6- | methyl quinoline |
| mint lactone | |
| myrtenal | |
| delta- | nonalactone |
| octahydrocoumarin | |
| phthalide | |
| pine needle absolute | |
| poplar bud oleoresin | |
| powdery ketone | |
| syringaldehyde | |
| tolualdehydes (mixed o/m/p) | |
| tonka bean absolute | |
| tonka bean oleoresin | |
| tonka bean resinoid | |
| tonka furanone | |
| tonka ketone | |
| tonka undecanone | |
| tonkavert | |
| vanillin | |
| vanillyl alcohol | |
| whiskey lactone | |
(odor and/or flavor) used in : | |
| amber | |
| balsam | |
| chocolate cacao | |
| coconut | |
| coconut tropical coconut | |
| hawthorn | |
| hay new mown hay foin coupe | |
| herbal | |
| moss | |
| nut | |
| spice | |
| tonka | |
| vanilla | |
| warm | |
| woody | |
natural occurrence in : | |
| not found in nature | |