| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| IUPAC name : | 2-(4-propan-2-yl-1-cyclohexa-1,4-dienyl)ethyl formate | |||||||||||||||||||||||
| InChI : | InChI=1/C12H18O2/c1-10(2)12-5-3-11(4-6-12)7-8-14-9-13/h3,6,9-10H,4-5,7-8H2,1-2H3 | |||||||||||||||||||||||
| InChIKey : | VQKSHQQZPYHYOS-UHFFFAOYAA | |||||||||||||||||||||||
| SMILES : | CC(C)C1=CCC(=CC1)CCOC=O | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| export tariff code : | 2915.13.0000 | |||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description : at 100.00 %. | sweet floral fruity herbal minty | |||||||||||||||||||||||
| substantivity : | 8 Hour(s) | |||||||||||||||||||||||
properties : | ||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 0.99000 - 0.99700 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.238 to 8.296 | |||||||||||||||||||||||
| refractive index : | 1.48400 - 1.49000 @ 20.00 °C. | |||||||||||||||||||||||
| boiling point : | 271.00 - 272.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||
| logp : | 3.10 | |||||||||||||||||||||||
safety : | ||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3568.00 mg/kg | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5000.00 mg/kg | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||
| limits in the finished product for - "leave on the skin contact" : | ||||||||||||||||||||||||
| 0.1000 % Restriction. | ||||||||||||||||||||||||
| limits in the finished product for - "wash off the skin contact" : | ||||||||||||||||||||||||
| 0.1000 % Restriction. | ||||||||||||||||||||||||
| limits in the finished product for - "no skin contact" : | ||||||||||||||||||||||||
| 1.0000 % Restriction. | ||||||||||||||||||||||||
| recommendation for menthadienyl formate usage levels up to : | ||||||||||||||||||||||||
| 3.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for menthadienyl formate usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 272-066-0 | |||||||||||||||||||||||
| chemidplus : | 068683205 | |||||||||||||||||||||||
| epa-srs : | 68683-20-5 | |||||||||||||||||||||||
| ifra : | ifra - ( Found under : Menthadienyl formate (Isobergamate) ) | |||||||||||||||||||||||
other : | ||||||||||||||||||||||||
references : | ||||||||||||||||||||||||
| pubchem : | 688792 | |||||||||||||||||||||||
| synonyms : | |
| iso | bergamate |
| formic acid 2-(4-isopropyl cyclohexa-1,4-dien-1-yl) ethyl formate | |
| menthadiene-7-methyl formate | |
| menthadienyl formate | |
| 4-(1- | methyl ethyl)-cyclohexadiene-1-ethyl formate |
| 2-(4-iso | propyl cyclohexadienyl) ethyl formate |
| 4-(iso | propyl)-cyclohexadiene-1-ethyl formate |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| (odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| iso | amyl acetate |
| iso | amyl benzoate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzophenone | |
| benzyl acetate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| cardamom seed oil | |
| cinnamyl alcohol | |
| citronellol | |
| clary sage oil | |
| clove bud oil | |
| coriander seed oil | |
| cortex pyridine | |
| cyclamen aldehyde | |
| iso | cyclocitral |
| cyclohexyl ethyl alcohol | |
| gamma- | decalactone |
| decanal | |
| decanol | |
| dihydroterpinyl acetate | |
| dimethyl anthranilate | |
| ethyl (E,Z)-2,4-decadienoate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| floral pyranol | |
| galbanum oil | |
| gardenia oxide | |
| geraniol | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| heliotropyl acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl salicylate |
| hexyl 2-methyl butyrate | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| ionones | |
| 2,4- | ivy carbaldehyde |
| leaf acetal | |
| lemon oil | |
| lime oil | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| litsea cubeba oil | |
| melon nonenoate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| muguet octadienol | |
| musks | |
| nerol | |
| nonanol | |
| ocean propanal | |
| orange oil | |
| patchouli ethanone | |
| peony alcohol | |
| petitgrain oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl isobutyrate | |
| phenyl acetaldehyde dimethyl acetal | |
| raspberry ketone | |
| rhodinol | |
| rose butanoate | |
| santall | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| tetrahydromyrcenol | |
| para- | tolyl aldehyde |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| violet leaf absolute | |
| violet methyl carbonate | |
| woody amylene | |
| ylang ylang oil | |
| (odor and/or flavor) used in : | |
| agrumen | |
| aldehydic | |
| alpine bouquet | |
| amaryllis | |
| apple green apple | |
| ash mountain ash | |
| bayberry | |
| bergamot | |
| blossom tropical blossom | |
| boronia | |
| boxwood | |
| boxwood blossom | |
| carrot seed | |
| chamomile | |
| chervil | |
| cilantro | |
| citrus | |
| clematis | |
| cologne | |
| cranberry | |
| daffodil narcissus | |
| dillenia | |
| evergreen | |
| fern fougere | |
| fig | |
| floral | |
| foliage | |
| fresh | |
| fruit tropical fruit | |
| geranium | |
| gooseberry | |
| grape | |
| grapefruit | |
| grass green grass | |
| herbal | |
| hibiscus | |
| ivy leaf | |
| kiwi | |
| lemon | |
| lilac lilas syringa | |
| lime | |
| linden blossom limeflower tilleul | |
| lotus | |
| mimosa wattle | |
| ocean sea | |
| osmanthus | |
| palmarosa | |
| pansy | |
| parsley | |
| passion blossom | |
| passion fruit | |
| petitgrain | |
| petitgrain lime petitgrain | |
| pine | |
| pine needle | |
| pineapple | |
| privet blossom | |
| rain spring rain | |
| reseda mignonette | |
| rhubarb | |
| rose tea rose | |
| rose wild rose | |
| saffron | |
| seedy | |
| spruce | |
| tea | |
| tropical | |
| valerian | |
| watercress nasturtium | |
| wormwood absinthium | |
| yew | |
| natural occurrence in : | |
| not found in nature | |