| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | ethyl 3-oxobutanoate | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C6H10O3/c1-3-9-6(8)4-5(2)7/h3-4H2,1-2H3 | |||||||||||||||||||||||||||||||
| InChIKey : | XYIBRDXRRQCHLP-UHFFFAOYAP | |||||||||||||||||||||||||||||||
| SMILES : | CCOC(=O)CC(=O)C | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | 172.515 175.300 |
h. number : | 2915.39.9050 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | fruity | |||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fresh fruity green apple fatty | |||||||||||||||||||||||||||||||
| taste description³ : | at 300.00 ppm. Estry, fatty, fruity and tutti-frutti | |||||||||||||||||||||||||||||||
| substantivity : | 4 Hour(s) | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless to yellow clear liquid | |||||||||||||||||||||||||||||||
| assay : | 99.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||
| specific gravity : | 1.02200 - 1.02710 @ 25.00 °C. | |||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.504 to 8.546 | |||||||||||||||||||||||||||||||
| refractive index : | 1.41800 - 1.42100 @ 20.00 °C. | |||||||||||||||||||||||||||||||
| melting point : | -45.40 - -44.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 180.00 - 181.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||
| boiling point : | 100.00 - 101.00 °C. @ 50.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 5.00 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 0.72 | |||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3980.00 mg/kg (Smyth et al., 1949) | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 1200.00 (μg/capita/day) | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 184.00 °F. TCC ( 84.44 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for ethyl acetoacetate usage levels up to : | ||||||||||||||||||||||||||||||||
| 15.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| recommendation for ethyl acetoacetate usage levels up to : | ||||||||||||||||||||||||||||||||
| 530.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||
| (EINECS) number : | 205-516-1 | |||||||||||||||||||||||||||||||
| rtecs : | AK5250000 for 141-97-9 | |||||||||||||||||||||||||||||||
| chemidplus : | 000141979 | |||||||||||||||||||||||||||||||
| epa-srs : | 141-97-9 | |||||||||||||||||||||||||||||||
| dtp/nci : | 8657 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 152020 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2817390235 | |||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 21, No. 5, 49, (1996)³ | |||||||||||||||||||||||||||||||
| synonyms : | |
| acetoacetic acid ethyl ester | |
| acetoacetic ester | |
| 3-oxo | butanoic acid ethyl ester |
| 3-oxo- | butanoic acid ethyl ester |
| diacetic ether | |
| 1- | ethoxybutane-1,3-dione |
| ethyl 3-oxobutanoate | |
| ethyl 3-oxobutyrate | |
| ethyl acetoacetate | |
| ethyl acetyl acetate | |
| ethyl acetyl acetonate | |
| ethyl beta-ketobutyrate | |
| soluble in : | |
| alcohol | |
| isopropyl myristate | |
| most organic solvents | |
| water, 110000 mg/L @ 17C | |
| insoluble in : | |
| paraffin oil | |
| water | |
| (odor and/or flavor) blends with : | |
| allyl amyl glycolate | |
| allyl hexanoate | |
| almond oil | |
| iso | amyl acetate |
| iso | amyl butyrate |
| iso | amyl isovalerate |
| iso | amyl salicylate |
| para- | anisyl alcohol |
| benzyl acetate | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| benzyl propionate | |
| bergamot oil | |
| blood orange oil | |
| bois de rose oil | |
| citral | |
| citronella oils | |
| citronellyl acetate | |
| citrus carbaldehyde | |
| clary sage oil | |
| coriander seed oil | |
| cyclamen aldehyde | |
| decanal | |
| (E)-4- | decen-1-al |
| diethyl malonate | |
| dihydromyrcenol | |
| ethyl butyrate | |
| ethyl cinnamate | |
| ethyl heptanoate | |
| eucalyptus oil | |
| fir needle oil | |
| galbanum oil | |
| geranyl acetate | |
| grapefruit oil | |
| grapefruit pentanol | |
| green acetate | |
| (Z)-3- | hexen-1-ol |
| (Z)-3- | hexen-1-yl 2-methyl butyrate |
| (Z)-3- | hexen-1-yl acetate |
| (Z)-3- | hexen-1-yl butyrate |
| (Z)-3- | hexen-1-yl propionate |
| hexyl 2-methyl butyrate | |
| hexyl acetate | |
| hexyl isovalerate | |
| ho leaf oil | |
| leaf acetal | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| melon heptenal | |
| melon nonenoate | |
| methyl 2-methyl valerate | |
| methyl heptenone | |
| 2- | methyl undecanal |
| neryl acetate | |
| nonanal | |
| nopyl acetate | |
| octanal | |
| petitgrain oil | |
| phenethyl acetate | |
| raspberry ketone | |
| strawberry furanone | |
| styralyl acetate | |
| alpha- | terpineol |
| alpha- | terpinyl acetate |
| tetrahydrolinalool | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| agrumen | |
| almond bitter almond | |
| almond blossom | |
| apple | |
| apple blossom | |
| apple brandy | |
| apple crabapple | |
| apple green apple | |
| apple red apple | |
| arrack | |
| banana | |
| brandy | |
| briar sweet briar eglantine | |
| bubblegum | |
| cherry | |
| cherry maraschino cherry | |
| cherry wild cherry | |
| cider | |
| citrus | |
| cloudberry bakeapple | |
| coffee | |
| cologne | |
| crabapple blossom | |
| fig | |
| fruit tropical fruit | |
| gardenia | |
| green | |
| herbal | |
| hibiscus | |
| lemon | |
| marigold tagete | |
| melon watermelon muskmelon cantaloupe | |
| myrtle | |
| orange | |
| passion blossom | |
| passion fruit | |
| peach | |
| pear | |
| pear blossom | |
| pineapple | |
| pomegranate | |
| rain spring rain | |
| raspberry | |
| rose wild rose | |
| sherry | |
| starfruit | |
| strawberry | |
| strawberry leaf | |
| tea | |
| topnotes | |
| tropical | |
| tutti frutti | |
| wine | |
| natural occurrence in : | |
| coffee | |
| passion fruit | |
| strawberry 4 ppm | |