| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | octanoic acid | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10) | |||||||||||||||||||||||||||||||||||
| InChIKey : | WWZKQHOCKIZLMA-UHFFFAOYAH | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCCCCCC(=O)O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| export tariff code : | 2915.90.0000 | |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||||
| Bedoukian Research : | CAPRYLIC ACID (NATURAL)
≥98.0%, Kosher | |||||||||||||||||||||||||||||||||||
| Cargill - Alfrebro : | CAPRYLIC ACID
natural, Kosher | |||||||||||||||||||||||||||||||||||
| Fleurchem : | caprylic acid
natural | |||||||||||||||||||||||||||||||||||
| Fontarome Chemical : | OCTANOIC ACID (CAPRYLIC ACID) NATURAL | |||||||||||||||||||||||||||||||||||
| Oxford Chemicals Ltd : | OCTANOIC ACID
≥99.00%, NI, Kosher | |||||||||||||||||||||||||||||||||||
| Oxford Chemicals Ltd : | NATURAL OCTANOIC ACID (CAPRYLIC)
≥99.00%, natural, Kosher | |||||||||||||||||||||||||||||||||||
| Robertet : | Octanoic acid
naturel | |||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Octanoic acid
≥98%, Kosher, FG | |||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Octanoic acid
≥98%, natural, Kosher | |||||||||||||||||||||||||||||||||||
| Symrise : | Caprylic acid
natural | |||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | fatty | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | fatty waxy rancid oily vegetable cheesy | |||||||||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear oily liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 0.89300 to 0.92200 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 7.431 to 7.672 | |||||||||||||||||||||||||||||||||||
| melting point : | 16.00 to 17.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 237.00 to 239.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 3.05 | |||||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 10080.00 mg/kg | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 230.00 °F. TCC ( > 110.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for octanoic acid usage levels up to : | ||||||||||||||||||||||||||||||||||||
| not for fragrance use. | ||||||||||||||||||||||||||||||||||||
| recommendation for octanoic acid usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 20.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-677-5 | |||||||||||||||||||||||||||||||||||
| RTECS : | RH0175000 for 124-07-2 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000124072 | |||||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 124-07-2 | |||||||||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 124-07-2 | |||||||||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 124-07-2 | |||||||||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 124-07-2 | |||||||||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 124-07-2 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 5024 | |||||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 99 | |||||||||||||||||||||||||||||||||||
| fl. number : | 08.010 | |||||||||||||||||||||||||||||||||||
| pubchem : | 173331 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1696520005 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| C-8 | |
| caprylic acid | |
| N- | caprylic acid |
| 1- | heptane carboxylic acid |
| octanoic acid | |
| N- | octanoic acid |
| octoic acid | |
| N- | octoic acid |
| octylic acid | |
| N- | octylic acid |
soluble in : | |
| alcohol | |
| water, 789 mg/L @ 25C | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| allyl cyclohexyl propionate | |
| allyl octanoate | |
| alpha- | amyl cinnamaldehyde / methyl anthranilate schiff's base |
| iso | amyl laurate |
| 6- | amyl-alpha-pyrone |
| benzyl laurate | |
| cyclohexyl acetic acid | |
| dairy lactone | |
| 2,4- | decadien-1-ol |
| decanal / methyl anthranilate schiff's base | |
| (E)-2- | decen-1-al |
| (E)-2- | decen-1-ol |
| (Z)-5- | decen-1-ol |
| (E)-2- | decen-1-yl acetate |
| dodecanal | |
| dodecanol | |
| ethyl (E)-2-octenoate | |
| ethyl hexanoate | |
| ethyl undecanoate | |
| ethyl undecylenate | |
| (E)-2- | hexen-1-al |
| jasmin absolute pommade | |
| melon valerate | |
| methyl 10-undecenal | |
| 5- | methyl hexanoic acid |
| methyl myristate | |
| 4- | methyl octanoic acid |
| methyl undecanoate | |
| myristic acid | |
| 2,4- | nonadien-1-ol |
| (Z)-2- | nonen-1-al |
| (E)-2- | octenoic acid |
| oleic acid | |
| palmitic acid | |
| tetradecanal | |
(odor and/or flavor) used in : | |
| apple | |
| banana | |
| beef roasted beef | |
| beer | |
| blackberry | |
| bramble arctic bramble | |
| bread white bread | |
| butter | |
| chamomile | |
| cheese | |
| cherry | |
| chocolate cocoa | |
| cider | |
| cinnamon | |
| cloudberry bakeapple | |
| coconut | |
| coffee | |
| emulsifying agents | |
| grape brandy | |
| honey miel | |
| hops houblon | |
| lamb | |
| lemongrass | |
| lime | |
| marjoram | |
| mushroom | |
| nut peanut | |
| nut pecan | |
| nutmeg | |
| papaya | |
| passion fruit | |
| peach | |
| pear | |
| pear brandy | |
| petitgrain lemon petitgrain | |
| plum brandy | |
| sauerkraut | |
| sherry | |
| soybean | |
| tea | |
| tobacco tabac tabaco flower | |
| tomato | |
natural occurrence in : | |
| data page | ambrette seed concrete @ 0.07% |
| apple | |
| beer | |
| blackberry | |
| data page | boronia absolute @ 0.07% |
| bread | |
| capsicum | |
| chamomile | |
| data page | cistus oil @ 3.7% |
| coconut | |
| data page | grapefruit oil california @ 0.02% |
| data page | helichrysum arenarium (l.) moench oil hungary @ 6.00% |
| hop | |
| lemongrass | |
| lime | |
| data page | malpighia glabra l. fruit oil @ 0.10% |
| data page | osmanthus absolute @ 0.11% |
| papaya | |
| peach | |
| pear | |
| raspberry fruit | |
| strawberry | |
| tobacco flower | |
| tomato | |