| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydronaphtho[8,7-d]furan-2-one | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C16H26O2/c1-14(2)7-5-8-15(3)11(14)6-9-16(4)12(15)10-13(17)18-16/h11-12H,5-10H2,1-4H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | IMKJGXCIJJXALX-UHFFFAOYAC | |||||||||||||||||||||||||||||||||
| SMILES : | CC1(CCCC2(C1CCC3(C2CC(=O)O3)C)C)C | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| export tariff code : | 2932.19.0000 | |||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||
| IFF : | Sclareolide
≥98.00%, natural, Kosher Odor: Woody, raspberry | |||||||||||||||||||||||||||||||||
| Penta : | sclareolide | |||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | (3aR)-(+)-Sclareolide
97% | |||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | woody | |||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||
| odor description :¹ at 10.00 % in isopropyl myristate. | dry paper woody ambergris labdanum | |||||||||||||||||||||||||||||||||
| substantivity : | 108 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||
| appearence : | white crystals | |||||||||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||
| melting point : | 124.00 to 127.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| boiling point : | 320.00 to 321.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| flash point : | 270.00 °F. TCC ( 132.22 °C. ) | |||||||||||||||||||||||||||||||||
| logP (o/w) : | 4.32 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | None - None found. | |||||||||||||||||||||||||||||||||
|
S 02 - Keep out of the reach of children. S 24/25 - Avoid contact with skin and eyes. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 1.10 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-USA) : | 6.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||
| recommendation for sclareolide usage levels up to : | ||||||||||||||||||||||||||||||||||
| 0.5000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for sclareolide usage levels up to : | ||||||||||||||||||||||||||||||||||
| 5.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||||||
| European Food Safety Athority(efsa) : | Flavor usage levels; Subacute, Subchronic, Chronic and Carcinogenicity Studies; Developmental / Reproductive Toxicity Studies; Genotoxicity Studies... | |||||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||||||
| WGK Germany : | 2 | |||||||||||||||||||||||||||||||||
| 3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydronaphtho[8,7-d]furan-2-one | ||||||||||||||||||||||||||||||||||
| (EINECS) number : | 209-269-0 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000564205 | |||||||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 564-20-5 | |||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||
| 3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydronaphtho[8,7-d]furan-2-one | ||||||||||||||||||||||||||||||||||
| fl. number : | 16.055 | |||||||||||||||||||||||||||||||||
| jecfa number : | 1165 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 564205 | |||||||||||||||||||||||||||||||||
| pubchem : | 197381 | |||||||||||||||||||||||||||||||||
Cosmetics : | ||||||||||||||||||||||||||||||||||
| Cosmetic uses : |
masking agents perfuming agents skin conditioning | |||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (2007) ¹ | |||||||||||||||||||||||||||||||||
| CosIng : | cosmetic data | |||||||||||||||||||||||||||||||||
| VCF-Online: | VCF Volatile Compounds in Food | |||||||||||||||||||||||||||||||||
| synonyms : | |
| (+)-nor | ambreinolide |
| 12-nor | ambrienolide |
| (3ar- (3aalpha,5abeta, 9aalpha,9bbeta)) | decahydro-3a,6,6,9a-tetramethyl naphth(2,1-b)furan-2(1H)-one |
| (3aR,5aS,9aS,9bR)- | decahydro-3a,6,6,9a-tetramethyl naphtho(2,1-b)furan-2(1H)-one |
| 3a,4,5,5aalpha, 6,7,8,9,9a,9balpha- | decahydro-3abeta,6,6,9abeta-tetramethyl naphtho(2,1-b)furan-2(1H)-one |
| (3aR)-(+)- | sclareolide |
| 3a,6,6,9a- | tetramethyl-1,4,5,5a,7,8,9,9b-octahydronaphtho[8,7-d]furan-2-one |
soluble in : | |
| alcohol | |
| diethyl phthalate | |
| isopropyl myristate | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| acetophenone | |
| ambergris | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzoin resinoid | |
| bois de rose oil | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cistus oil | |
| costus valerolactone | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl maltol | |
| iso | eugenyl acetate |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| indole | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| maltol | |
| melon heptenal | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| 2- | methyl undecanal |
| musks | |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| santall | |
| spruce oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
(odor and/or flavor) used in : | |
| agate | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| christmas blends | |
| cigar box | |
| cistus | |
| cloth clean cloths | |
| cool water | |
| coronilla | |
| deertongue | |
| dry | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| maple | |
| moss | |
| musk | |
| ocean sea | |
| ocean sea breeze | |
| oriental | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| sandalwood | |
| spice | |
| tea | |
| tobacco tabac tabaco | |
| tonka | |
| tweed | |
| vanilla | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| cigar | |
| clary sage | |
| tobacco | |