| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | [(Z)-hex-3-enyl] 2-hydroxybenzoate | |||||||||||||||||||||||||||
| InChI : | InChI=1/C13H16O3/c1-2-3-4-7-10-16-13(15)11-8-5-6-9-12(11)14/h3-6,8-9,14H,2,7,10H2,1H3/b4-3+ | |||||||||||||||||||||||||||
| InChIKey : | IEPWIPZLLIOZLU-ARJAWSKDBG | |||||||||||||||||||||||||||
| SMILES : | CC\C=C/CCOC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2918.23.0000 | |||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||
| odor description : at 100.00 %. | floral green metallic herbal balsam | |||||||||||||||||||||||||||
| substantivity : | 216 Hour(s) | |||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||
| appearence : | colorless clear oily liquid | |||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % sum of isomers | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| specific gravity : | 1.05600 - 1.06400 @ 25.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.787 to 8.854 | |||||||||||||||||||||||||||
| specific gravity : | 1.05700 - 1.06500 @ 20.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.806 to 8.872 | |||||||||||||||||||||||||||
| refractive index : | 1.51800 - 1.52200 @ 20.00 °C. | |||||||||||||||||||||||||||
| boiling point : | 145.00 °C. @ 5.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 271.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| logp : | 4.36 | |||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 5.00 gm/kg FCTXAV 17,373,1979 | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 17,373,1979 | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||
| recommendation for (Z)-3-hexen-1-yl salicylate usage levels up to : | ||||||||||||||||||||||||||||
| 7.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||
| recommendation for (Z)-3-hexen-1-yl salicylate usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||
| (EINECS) number : | 265-745-8 | |||||||||||||||||||||||||||
| chemidplus : | 65405-77-8 | |||||||||||||||||||||||||||
| epa-srs : | 65405-77-8 | |||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||
| pubchem : | 10531843 | |||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3306718206 | |||||||||||||||||||||||||||
| synonyms : | |
| (Z)-3- | hexen-1-yl 2-hydroxybenzoate |
| (Z)-3- | hexen-1-yl salicylate |
| cis-3- | hexen-1-yl salicylate |
| (Z)-3- | hexenyl salicylate |
| cis-3- | hexenyl salicylate |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| acid cleaner | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| amyris wood oil | |
| animal carbolactone | |
| bay leaf oil | |
| iso | bornyl acetate |
| boronia absolute | |
| iso | butyl phenyl acetate |
| iso | butyl salicylate |
| citronella oil | |
| clary sage oil | |
| clover nitrile | |
| cognac oil | |
| costus valerolactone | |
| coumarin | |
| cypress oil | |
| decanol | |
| deertongue absolute | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl benzoate | |
| ethyl cinnamate | |
| eugenia jambolana leaf oil | |
| eugenol | |
| iso | eugenyl acetate |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| ho leaf oil | |
| hyssop oil | |
| ivy absolute | |
| labdanum resinoid | |
| lavandin oil | |
| lavender absolute | |
| lemongrass oil | |
| laevo- | linalool |
| linalool oxide | |
| litsea cubeba oil | |
| melilot absolute | |
| mimosa absolute | |
| nerolidol | |
| nonanol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| olibanum oil | |
| origanum oil | |
| orris absolute | |
| patchouli ethanone | |
| pimento berry oil | |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| spike lavender oil | |
| spruce oil | |
| alpha- | terpineol |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| watermelon ketone | |
| (odor and/or flavor) used in : | |
| agrumen | |
| algae | |
| animal | |
| apple crabapple | |
| artichoke | |
| ash mountain ash | |
| ash mountain ash blossom | |
| asparagus | |
| avocado | |
| balsam | |
| bark | |
| bayberry | |
| botanical | |
| boxwood | |
| boxwood blossom | |
| boxwoodberry | |
| carnation dianthus oeillet | |
| carrot seed | |
| cedar forest | |
| celery | |
| charlie | |
| cherry black cherry | |
| christmas blends | |
| chrysanthemum chrysantheme | |
| chypre | |
| clean | |
| clover trefle le'trefle incarnat | |
| colonia | |
| coronilla | |
| crabapple blossom | |
| cucumber | |
| cyclamen | |
| daffodil narcissus | |
| dillenia | |
| earth humus | |
| elder blossom | |
| elderberry | |
| fantasy blends | |
| fern fougere | |
| fig | |
| fir balsam | |
| fixer | |
| floral | |
| flouve | |
| foliage | |
| forest | |
| freesia | |
| fresh | |
| fungus | |
| galanga | |
| ginger white ginger | |
| gooseberry | |
| grass sweet grass | |
| green | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| hyacinth jacinthe | |
| hydrangea | |
| iris blossom | |
| kewda | |
| kiwi | |
| kiwi blossom | |
| leaf green leaf | |
| leather | |
| lily | |
| lotus | |
| lychee soapberry | |
| magnolia | |
| mango blossom | |
| mate | |
| meadow | |
| melon | |
| moss | |
| muguet lily of the valley | |
| musk | |
| narcissus narcisse | |
| new car | |
| nut | |
| ocean sea | |
| orchid | |
| pansy | |
| peach blossom | |
| pear prickly pear | |
| peony | |
| phlox | |
| pine | |
| pomegranate | |
| poppy | |
| privet | |
| privet blossom | |
| rain | |
| redwood | |
| reseda mignonette | |
| rhubarb | |
| rose tea rose | |
| rose white rose | |
| rose wild rose | |
| starfruit | |
| stephanotis | |
| stock evening scented stock | |
| sweet pea pois de senteur | |
| tea | |
| tobacco tabac tabaco | |
| tuberose tubereuse | |
| tulip | |
| verbena verveine | |
| violet | |
| woody | |
| yew | |
| natural occurrence in : | |
| data page | witch hazel leaf oil @ 0.01% |