Notes :
Isobutyl phenyl acetate really rounds out the odor.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||
| IUPAC name : | 3-methylbutyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H16O3/c1-9(2)7-8-15-12(14)10-5-3-4-6-11(10)13/h3-6,9,13H,7-8H2,1-2H3 | |||||||||||||||||||||||||||||||||
| InChIKey : | PMGCQNGBLMMXEW-UHFFFAOYAO | |||||||||||||||||||||||||||||||||
| SMILES : | CC(C)CCOC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2918.23.0000 | |||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | floral herbal woody orchid metallic | |||||||||||||||||||||||||||||||||
| taste description² : | at 20.00 ppm in water. herbal green berry | |||||||||||||||||||||||||||||||||
| substantivity : | 124 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||
| specific gravity : | 1.04900 - 1.05500 @ 25.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.729 to 8.779 | |||||||||||||||||||||||||||||||||
| specific gravity : | 1.05000 - 1.05600 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.747 to 8.797 | |||||||||||||||||||||||||||||||||
| refractive index : | 1.50700 - 1.50900 @ 20.00 °C. | |||||||||||||||||||||||||||||||||
| boiling point : | 277.00 - 278.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||
| logp : | 4.37 | |||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 3300.00 mg/kg (2),25,1994 | |||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||
| recommendation for isoamyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||
| recommendation for isoamyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||
| 3.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||
| (EINECS) number : | 201-730-4 | |||||||||||||||||||||||||||||||||
| rtecs : | VO4375000 for 87-20-7 | |||||||||||||||||||||||||||||||||
| chemidplus : | 000087207 | |||||||||||||||||||||||||||||||||
| epa-srs : | 87-20-7 | |||||||||||||||||||||||||||||||||
| dtp/nci : | 7952 | |||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||
| pubchem : | 149878 | |||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 70942751 | |||||||||||||||||||||||||||||||||
| synonyms : | |
| iso | amyl ortho-hydroxybenzoate |
| iso | amyl salicylate |
| 2- | hydroxybenzoic acid 3-methyl butyl ester |
| 3- | methyl butyl 2-hydroxybenzoate |
| 3- | methyl butyl ortho-hydroxybenzoate |
| 3- | methyl butyl salicylate |
| iso | pentyl ortho-hydroxybenzoate |
| iso | pentyl salicylate |
| iso | pentyl-2-hydroxyphenyl methanoate |
| salicylic acid isopentyl ester | |
| soluble in : | |
| alcohol | |
| fixed oils | |
| kerosene | |
| paraffin oil | |
| water, 145 mg/L @ 25C | |
| insoluble in : | |
| water | |
| glycerin | |
| propylene glycol | |
| stability : | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hair spray | |
| hard surface cleaner | |
| liquid detergent | |
| non-discoloring in most media | |
| powder | |
| shampoo | |
| (odor and/or flavor) blends with : | |
| abies alba mill oil | |
| abies sibirica oil | |
| acetoin | |
| amyris wood oil | |
| animal carbolactone | |
| bay leaf oil | |
| iso | bornyl acetate |
| boronia absolute | |
| iso | butyl phenyl acetate |
| iso | butyl salicylate |
| citronella oil | |
| clary sage oil | |
| clover nitrile | |
| cognac oil | |
| costus valerolactone | |
| coumarin | |
| cypress oil | |
| decanol | |
| deertongue absolute | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl benzoate | |
| ethyl cinnamate | |
| eugenia jambolana leaf oil | |
| eugenol | |
| iso | eugenyl acetate |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| heliotropyl acetone | |
| hexyl 2-methyl butyrate | |
| ho leaf oil | |
| hyssop oil | |
| ivy absolute | |
| labdanum resinoid | |
| lavandin oil | |
| lavender absolute | |
| lemongrass oil | |
| laevo- | linalool |
| linalool oxide | |
| litsea cubeba oil | |
| melilot absolute | |
| mimosa absolute | |
| nerolidol | |
| nonanol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| olibanum oil | |
| origanum oil | |
| orris absolute | |
| patchouli ethanone | |
| pimento berry oil | |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| spike lavender oil | |
| spruce oil | |
| alpha- | terpineol |
| tonka bean absolute | |
| treemoss absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vetiver oil | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| a suma | |
| aldehydic | |
| almond | |
| alpine bouquet | |
| amber | |
| angel | |
| apple blossom | |
| apricot | |
| balsam | |
| banana | |
| berry | |
| blue grass | |
| blue mist | |
| bluebell | |
| bouquet | |
| broom genet genista | |
| brut | |
| camelia | |
| canoe | |
| carnation dianthus oeillet | |
| cedar | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chrysanthemum chrysantheme | |
| chypre | |
| citrus | |
| clean | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| cologne | |
| currant | |
| cyclamen | |
| date | |
| fern fougere | |
| fleurs de rocailles | |
| floral | |
| fresh | |
| fruit | |
| gooseberry | |
| grenadine | |
| hay new mown hay foin coupe | |
| herbal | |
| honey miel | |
| hyacinth jacinthe | |
| je reviens | |
| leather | |
| lemon | |
| lilac lilas syringa | |
| lotus | |
| lux beauty shower soap | |
| maja | |
| meadow | |
| mimosa wattle | |
| mint | |
| moss | |
| musk | |
| ocean sea breeze | |
| orange | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| peach | |
| pine | |
| plum | |
| pompeia | |
| poppy red poppy | |
| potpourri | |
| powder | |
| raspberry | |
| rootbeer | |
| rose | |
| rose tea rose | |
| spearmint | |
| spice | |
| strawberry | |
| tide | |
| tuberose tubereuse | |
| vanilla | |
| wallflower giroflee | |
| woody | |
| ylang ylang cananga | |
| zibeline | |
| natural occurrence in : | |
| grape | |
| rum | |
| tobacco burley tobacco | |