Notes :
mossy accord - isoeugenol, verymoss 10% and benzyl salicylate.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | phenylmethyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C14H12O3/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9,15H,10H2 | |||||||||||||||||||||||||||||||||||
| InChIKey : | ZCTQGTTXIYCGGC-UHFFFAOYAC | |||||||||||||||||||||||||||||||||||
| SMILES : | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2918.23.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | balsamic | |||||||||||||||||||||||||||||||||||
| odor strength : | low | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | balsam clean herbal oily sweet | |||||||||||||||||||||||||||||||||||
| substantivity : | 384 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid to solid at low room temps | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.17300 - 1.18100 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.761 to 9.827 | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.17400 - 1.18200 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 9.780 to 9.847 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.57900 - 1.58300 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 22.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 208.00 °C. @ 26.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 168.00 - 170.00 °C. @ 5.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 4.01 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 2227.00 mg/kg FCTXAV 11,1029,1973 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit 14150.00 mg/kg | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||||||||||||
| Fragrance usage is RESTRICTED to : | ||||||||||||||||||||||||||||||||||||
| Please review all IFRA documents for complete information. (QRA) | ||||||||||||||||||||||||||||||||||||
| IFRA categories : limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) | ||||||||||||||||||||||||||||||||||||
| Category 1 : | 0.50 % (1) | Category 2 : | 0.70 % | |||||||||||||||||||||||||||||||||
| Category 3 : | 2.70 % | Category 4 : | 8.00 % | |||||||||||||||||||||||||||||||||
| Category 5 : | 4.20 % | Category 6 : | 12.80 % (1) | |||||||||||||||||||||||||||||||||
| Category 7 : | 1.30 % | Category 8 : | 2.00 % | |||||||||||||||||||||||||||||||||
| Category 9 : | 5.00 % | Category 10 : | 2.50 % | |||||||||||||||||||||||||||||||||
| Category 11 : | See Note | |||||||||||||||||||||||||||||||||||
(1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). | ||||||||||||||||||||||||||||||||||||
Note : Category 11 includes all non-skin contact or incidental skin contact products. Due to negligible skin contact, the concentration of a fragrance ingredient should not exceed the usual concentration of the fragrance compound in the finished product. For example, hypothetically if the usual concentration of a fragrance compound in the final product, for example a candle, is at 5%, then any individual fragrance ingredient (in this case benzyl salicylate) must not exceed 5% in the candle. | ||||||||||||||||||||||||||||||||||||
| recommendation for benzyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 5.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 204-262-9 | |||||||||||||||||||||||||||||||||||
| rtecs : | VO1750000 for 118-58-1 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000118581 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 118-58-1 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 6647 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 904 | |||||||||||||||||||||||||||||||||||
| fl. number : | 09.752 | |||||||||||||||||||||||||||||||||||
| pubchem : | 151509 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 739600749 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| benzyl 2-hydroxybenzoate | |
| benzyl ortho-hydroxybenzoate | |
| benzyl salicylate | |
| 2- | hydroxybenzoic acid phenyl methyl ester |
| phenyl methyl 2-hydroxybenzoate | |
| salicylic acid benzyl ester | |
| soluble in : | |
| deluent for candle fragrances | |
| ethyl alcohol, 9 vol. 90% alcohol | |
| fixed oils, most fixed oils | |
| isopropyl myristate | |
| kerosene | |
| paraffin oil | |
| insoluble in : | |
| water | |
| glycerin | |
| propylene glycol | |
| stability : | |
| acid cleaner | |
| antiperspirant | |
| deo stick | |
| detergent perborate | |
| fabric softener | |
| hair spray | |
| non-discoloring in most media | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| ambreine | |
| ambrette seed oil | |
| ambroxan | |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisyl alcohol |
| benzoin resinoid | |
| benzyl acetate | |
| benzyl alcohol | |
| benzyl cinnamate | |
| benzyl isobutyrate | |
| iso | bornyl acetate |
| boronia absolute | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cedryl methyl ether | |
| christmas blends | |
| citronellol | |
| citrus carbaldehyde | |
| costus root oil | |
| costus valerolactone | |
| para- | cresyl caprylate |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| ethyl cinnamate | |
| ethyl laurate | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| green acetate | |
| guaiacwood oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| indole | |
| labdanum resinoid | |
| leerall | |
| lilyall | |
| dextro- | limonene |
| laevo- | linalool |
| linalool oxide | |
| methyl cedryl ketone | |
| musks | |
| nerolidol | |
| gamma- | nonalactone |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| orris absolute | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl alcohol | |
| rose oxides | |
| santall | |
| tetrahydrolinalool | |
| tonka bean absolute | |
| verymoss | |
| vetiver oil | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| aimant | |
| aldehydic | |
| amber | |
| ambergris | |
| ambrene | |
| amour-amour | |
| anais anais | |
| apple | |
| apple green apple | |
| apple red apple | |
| apricot | |
| arpege | |
| baby powder | |
| balsam | |
| banana | |
| bellodgia | |
| blue grass | |
| blue mist | |
| bluebell | |
| blueberry | |
| botanical | |
| bouquet | |
| bubblegum | |
| cabochard | |
| carnation dianthus oeillet | |
| cassia | |
| cassie acacia farnesiana | |
| castoreum | |
| cedar | |
| chanel #5 | |
| charlie | |
| cherry | |
| cherry blossom | |
| chloe | |
| cinq fleurs forvil | |
| citrus | |
| clean | |
| cloth clean cloths | |
| clover trefle le'trefle incarnat | |
| coconut | |
| coconut tropical coconut | |
| currant | |
| elder blossom | |
| elderberry | |
| estee | |
| evergreen | |
| fetes | |
| fidji | |
| fleurs de rocailles | |
| floral | |
| flower | |
| fresh | |
| gardenia | |
| gooseberry | |
| grape | |
| grapefruit | |
| grass sweet grass | |
| hay new mown hay foin coupe | |
| heliotrope | |
| herbal | |
| hyacinth jacinthe | |
| incense | |
| jasmin | |
| je reviens | |
| jonquil narcissus jonquilla | |
| joy | |
| l'air du temps | |
| leaf green leaf | |
| leather russian leather | |
| lemon | |
| lilac lilas syringa | |
| lily | |
| lime | |
| linden blossom limeflower tilleul | |
| lotus | |
| magnolia | |
| mint | |
| muguet lily of the valley | |
| musk | |
| my sin | |
| new car | |
| norell | |
| ocean sea breeze | |
| ophira | |
| orange | |
| oriental | |
| outdoors fresh outdoors | |
| paris | |
| peach | |
| pear | |
| pennyroyal | |
| pineapple | |
| plum | |
| popcorn | |
| potpourri | |
| presence | |
| rain | |
| rain spring rain | |
| raspberry | |
| rose tea rose | |
| sandalwood | |
| spice | |
| strawberry | |
| tuberose tubereuse | |
| vanilla | |
| violet | |
| wallflower giroflee | |
| wistaria wisteria glycine | |
| woodruff asperula | |
| ylang ylang cananga | |
| natural occurrence in : | |
| data page | ayou wood oil @ 1.60% |
| carnation | |
| data page | carnation absolute @ 3.90% |
| dianthus caryophyllus l. | |
| data page | narcissus absolute @ 0.17% |
| primula auricula | |
| data page | ylang ylang oil @ 1.37% |
| data page | ylang ylang oil CO2 extract @ 3.66% |
| data page | ylang ylang oil I (cananga odorata hook. f. and thomas.) @ 2.63% |
| data page | ylang ylang oil II (cananga odorata hook. f. and thomas.) @ 3.05% |
| data page | ylang ylang oil III @ 2.81% |