| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | butyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H14O3/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12/h4-7,12H,2-3,8H2,1H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | YFDUWSBGVPBWKF-UHFFFAOYAG | |||||||||||||||||||||||||||||||||||
| SMILES : | CCCCOC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| export tariff code : | 2915.13.0000 | |||||||||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Butyl salicylate | |||||||||||||||||||||||||||||||||||
| ≥99% | ||||||||||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | harsh clover ethyl benzoate | |||||||||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 96.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.07000 - 1.08000 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.903 to 8.987 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.50800 - 1.52000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 6.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 268.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| logp : | 3.83 | |||||||||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1700.00 mg/kg | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-EU) : | 0.012 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI-USA) : | 0.0007 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for butyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 0.1000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||||||||||
| (EINECS) number : | 218-142-9 | |||||||||||||||||||||||||||||||||||
| rtecs : | VO2000000 for 2052-14-4 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 002052144 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 2052-14-4 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 1511 | |||||||||||||||||||||||||||||||||||
| EPI System : | Click here | |||||||||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||||||||
| jecfa number : | 901 | |||||||||||||||||||||||||||||||||||
| fl. number : | 09.763 | |||||||||||||||||||||||||||||||||||
| pubchem : | 159590 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1346894686 | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| butyl (2-hydroxyphenyl) formate | |
| butyl 2-hydroxybenzoate | |
| butyl 2-hydroxyphenyl formate | |
| N- | butyl ortho-hydroxybenzoate |
| butyl salicylate | |
| N- | butyl salicylate |
| 2- | hydroxybenzoic acid butyl ester |
| salicylic acid butyl ester | |
| soluble in : | |
| alcohol | |
| water, 20 mg/L @ 25C | |
| insoluble in : | |
| water | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| amyl cinnamate | |
| iso | amyl cinnamate |
| amyl salicylate | |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| benzoin resinoid | |
| benzyl benzoate | |
| benzyl salicylate | |
| iso | butyl benzoate |
| caraway seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| clover notes | |
| coriander seed oil | |
| coumarin | |
| para- | cresyl caprylate |
| dihydrojasmone | |
| 2- | ethyl hexyl salicylate |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| hexyl salicylate | |
| labdanum resinoid | |
| lavender absolute | |
| methyl cedryl ketone | |
| methyl ionones | |
| musks | |
| nerolidol | |
| ocean propanal | |
| orchid notes | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl alcohol | |
| phenyl acetaldehyde | |
| 3- | phenyl propyl alcohol |
| propyl salicylate | |
| rose butanoate | |
| santall | |
| tonka bean absolute | |
| 10- | undecen-1-al |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| anise | |
| balsam | |
| blackberry | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| cherry | |
| clary sage | |
| clover trefle le'trefle incarnat | |
| currant | |
| fern fougere | |
| leather | |
| modifier | |
| mulberry | |
| orchid | |
| oriental | |
| peach | |
| poppy red poppy | |
| raspberry | |
| rootbeer | |
| strawberry | |
| tuberose tubereuse | |
| tutti frutti | |
| wallflower giroflee | |
| wintergreen | |
| natural occurrence in : | |
| not found in nature | |