| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | hexyl 2-hydroxybenzoate | |||||||||||||||||||||||||||
| InChI : | InChI=1/C13H18O3/c1-2-3-4-7-10-16-13(15)11-8-5-6-9-12(11)14/h5-6,8-9,14H,2-4,7,10H2,1H3 | |||||||||||||||||||||||||||
| InChIKey : | DUKPKQFHJQGTGU-UHFFFAOYAH | |||||||||||||||||||||||||||
| SMILES : | CCCCCCOC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | 2918.23.0000 | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Hexyl salicylate | |||||||||||||||||||||||||||
| >98% | ||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | herbal | |||||||||||||||||||||||||||
| odor strength : | low | |||||||||||||||||||||||||||
| odor description : at 100.00 %. | fresh herbal orchid green | |||||||||||||||||||||||||||
| substantivity : | 40 Hour(s) | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | colorless clear oily liquid | |||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| specific gravity : | 1.03200 - 1.04000 @ 25.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.587 to 8.654 | |||||||||||||||||||||||||||
| specific gravity : | 1.03300 - 1.04100 @ 20.00 °C. | |||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.606 to 8.672 | |||||||||||||||||||||||||||
| refractive index : | 1.50200 - 1.50700 @ 20.00 °C. | |||||||||||||||||||||||||||
| boiling point : | 290.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||
| logp : | 4.91 | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xi N - Irritant, Dangerous for the environment. | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >5.00 gm/kg | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||
| IFRA critical Effect : | Sensitization | |||||||||||||||||||||||||||
| Fragrance usage is RESTRICTED to : | ||||||||||||||||||||||||||||
| Please review all IFRA documents for complete information. (QRA) | ||||||||||||||||||||||||||||
| IFRA categories : limits in the finished product: (For a description of the categories, refer to the IFRA QRA Information Booklet.) | ||||||||||||||||||||||||||||
| Category 1 : | 1.00 % (1) | Category 2 : | 1.30 % | |||||||||||||||||||||||||
| Category 3 : | 5.30 % | Category 4 : | 16.00 % | |||||||||||||||||||||||||
| Category 5 : | 8.40 % | Category 6 : | 25.70 % (1) | |||||||||||||||||||||||||
| Category 7 : | 2.70 % | Category 8 : | 2.00 % | |||||||||||||||||||||||||
| Category 9 : | 5.00 % | Category 10 : | 2.50 % | |||||||||||||||||||||||||
| Category 11 : | See Note | |||||||||||||||||||||||||||
(1) IFRA would recommend that any material used to impart perfume or flavour in products intended for human ingestion should consist of ingredients that are in compliance with appropriate regulations for foods and food flavourings in the countries of planned distribution and, where these are lacking, with the recommendations laid down in the Code of Practice of IOFI (International Organisation of the Flavor Industry). Further information about IOFI can be found on its website (www.iofi.org). | ||||||||||||||||||||||||||||
Note : Category 11 includes all non-skin contact or incidental skin contact products. Due to negligible skin contact, the concentration of a fragrance ingredient should not exceed the usual concentration of the fragrance compound in the finished product. For example, hypothetically if the usual concentration of a fragrance compound in the final product, for example a candle, is at 5%, then any individual fragrance ingredient (in this case hexyl salicylate) must not exceed 5% in the candle. | ||||||||||||||||||||||||||||
| recommendation for hexyl salicylate usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
safety links : | ||||||||||||||||||||||||||||
| (EINECS) number : | 228-408-6 | |||||||||||||||||||||||||||
| rtecs : | DH2207000 for 6259-76-3 | |||||||||||||||||||||||||||
| chemidplus : | 006259763 | |||||||||||||||||||||||||||
| epa-srs : | 6259-76-3 | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| fl. number : | 09.581 | |||||||||||||||||||||||||||
| pubchem : | 165272 | |||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 1878798673 | |||||||||||||||||||||||||||
| synonyms : | |
| hexyl 2-hydroxy-1-benzene carboxylate | |
| hexyl 2-hydroxybenzoate | |
| hexyl salicylate | |
| hexyl-2-hydroxybenzoate | |
| N- | hexyl-ortho-hydroxybenzoate |
| salicylic acid hexyl ester | |
| soluble in : | |
| alcohol | |
| water, 9 mg/L @ 20C | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic lotion | |
| antiperspirant | |
| deo stick | |
| detergent | |
| fabric softener | |
| hard surface cleaner | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| iso | amyl salicylate |
| amyris wood oil | |
| bay leaf oil | |
| iso | bornyl acetate |
| boronia absolute | |
| iso | butyl phenyl acetate |
| citronella oil | |
| clary sage oil | |
| cognac oil | |
| coumarin | |
| cypress oil | |
| decanol | |
| deertongue absolute | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinyl butyrate | |
| ethyl benzoate | |
| ethyl cinnamate | |
| eugenia jambolana leaf oil | |
| eugenol | |
| floral pyranol | |
| flouve absolute | |
| geraniol | |
| ho leaf oil | |
| hyssop oil | |
| ivy absolute | |
| labdanum resinoid | |
| lavandin oil | |
| lavender absolute | |
| lemongrass oil | |
| laevo- | linalool |
| linalool oxide | |
| litsea cubeba oil | |
| melilot absolute | |
| mimosa absolute | |
| nonanol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| olibanum oil | |
| origanum oil | |
| orris absolute | |
| patchouli ethanone | |
| pimento berry oil | |
| raspberry ketone | |
| rose butanoate | |
| santall | |
| spike lavender oil | |
| spruce oil | |
| alpha- | terpineol |
| tonka bean absolute | |
| treemoss absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vetiver oil | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| aldehydic | |
| almond | |
| alpine bouquet | |
| amber | |
| apple blossom | |
| apricot | |
| azalea | |
| balsam | |
| banana | |
| blue grass | |
| blue mist | |
| bouquet | |
| broom genet genista | |
| camelia | |
| carnation dianthus oeillet | |
| cedar | |
| cherry | |
| cherry blossom | |
| christmas blends | |
| chrysanthemum chrysantheme | |
| chypre | |
| citrus | |
| clove | |
| clover trefle le'trefle incarnat | |
| coconut tropical coconut | |
| currant | |
| cyclamen | |
| fern fougere | |
| floral | |
| fruit | |
| gooseberry | |
| green | |
| grenadine | |
| hay new mown hay foin coupe | |
| herbal | |
| honey miel | |
| hyacinth jacinthe | |
| labdanum | |
| leather | |
| lemon | |
| lilac lilas syringa | |
| lotus | |
| meadow | |
| mimosa wattle | |
| mint | |
| moss | |
| musk | |
| ocean sea breeze | |
| orange | |
| orchid | |
| oriental | |
| outdoors fresh outdoors | |
| peach | |
| pine | |
| plum | |
| poppy red poppy | |
| potpourri | |
| raspberry | |
| rose | |
| rose tea rose | |
| rounding off | |
| solvents | |
| spearmint | |
| spice | |
| strawberry | |
| tuberose tubereuse | |
| vanilla | |
| wallflower giroflee | |
| woody | |
| ylang ylang cananga | |
| natural occurrence in : | |
| data page | osmanthus absolute @ 0.007% |