Notes :
Blends well with balsams, herb and wood notes.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 2-methylpropyl 2-hydroxybenzoate | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C11H14O3/c1-8(2)7-14-11(13)9-5-3-4-6-10(9)12/h3-6,8,12H,7H2,1-2H3 | |||||||||||||||||||||||||||||||||||
| InChIKey : | PTXDBYSCVQQBNF-UHFFFAOYAG | |||||||||||||||||||||||||||||||||||
| SMILES : | CC(C)COC(=O)C1=CC=CC=C1O | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2918.23.0000 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | floral | |||||||||||||||||||||||||||||||||||
| odor strength : | medium , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | clover herbal orchid floral | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 3.00 ppm. Sweet, cooling, spicy with fruity nuances | |||||||||||||||||||||||||||||||||||
| substantivity : | 48 hour(s) at 100.00 % | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless clear liquid | |||||||||||||||||||||||||||||||||||
| assay : | 98.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | Yes | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.03600 - 1.06600 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.621 to 8.870 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.50800 - 1.51000 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| melting point : | 5.90 - 6.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 260.00 - 262.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 3.64 | |||||||||||||||||||||||||||||||||||
| shelf life : | 24.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn - Harmful. | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 1560.00 mg/kg FCTXAV 13,813,1975 | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >5.00 gm/kg FCTXAV 13,813,1975 | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 230.00 °F. TCC ( 110.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for isobutyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 0.8000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for isobutyl salicylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 3.0000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 201-729-9 | |||||||||||||||||||||||||||||||||||
| rtecs : | VO4320000 for 87-19-4 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000087194 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 87-19-4 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 62140 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 149877 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3749711470 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 17, No. 4, 33, (1992)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| 2-iso | butoxycarbonyl phenol |
| iso | butyl ortho-hydroxybenzoate |
| iso | butyl salicylate |
| 2- | hydroxybenzoic acid 2-methyl propyl ester |
| 2- | methyl propyl 2-hydroxybenzoate |
| 2- | methyl propyl ortho-hydroxybenzoate |
| 2- | methyl-1-propyl salicylate |
| salicylic acid isobutyl ester | |
| soluble in : | |
| alcohol | |
| fixed oils | |
| insoluble in : | |
| water | |
| glycerin | |
| stability : | |
| non-discoloring in most media | |
| (odor and/or flavor) blends with : | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl salicylate |
| amyris wood oil | |
| para- | anisaldehyde |
| balsams | |
| benzoin resinoid | |
| benzyl benzoate | |
| benzyl salicylate | |
| iso | butyl benzoate |
| caraway seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| clary sage oil | |
| clove bud oil | |
| coriander seed oil | |
| coumarin | |
| para- | cresyl caprylate |
| dihydrojasmone | |
| eugenols | |
| iso | eugenyl acetate |
| fir balsam absolute | |
| floral pyranol | |
| heliotropyl acetone | |
| herb and wood oils | |
| alpha- | hexyl cinnamaldehyde |
| labdanum resinoid | |
| lavender absolute | |
| methyl cedryl ketone | |
| methyl ionones | |
| musks | |
| nerolidol | |
| ocean propanal | |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl alcohol | |
| 3- | phenyl propyl alcohol |
| rose butanoate | |
| santall | |
| tonka bean absolute | |
| 10- | undecen-1-al |
| verymoss | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| aimant | |
| ambrosia | |
| anise | |
| balsam | |
| blackberry | |
| camelia | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| cherry | |
| clary sage | |
| clover trefle le'trefle incarnat | |
| currant | |
| fern fougere | |
| leather | |
| modifier | |
| mulberry | |
| orchid | |
| oriental | |
| peach | |
| poppy red poppy | |
| presence | |
| raspberry | |
| rootbeer | |
| strawberry | |
| tuberose tubereuse | |
| tutti frutti | |
| wallflower giroflee | |
| wintergreen | |
| natural occurrence in : | |
| found in nature | |