| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||||||
| IUPAC name : | 1,4-dioxacycloheptadecane-5,17-dione | |||||||||||||||||||||||||||||||||||
| InChI : | InChI=1/C15H26O4/c16-14-10-8-6-4-2-1-3-5-7-9-11-15(17)19-13-12-18-14/h1-13H2 | |||||||||||||||||||||||||||||||||||
| InChIKey : | XRHCAGNSDHCHFJ-UHFFFAOYAS | |||||||||||||||||||||||||||||||||||
| SMILES : | C1CCCCCC(=O)OCCOC(=O)CCCCC1 | |||||||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||||||
| fda reg : | 172.515 | h. number : | 2917.19.9090 | |||||||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||||||||
| odor description : at 100.00 %. | powdery sweet floral ambrette musk woody | |||||||||||||||||||||||||||||||||||
| taste description³ : | at 0.50 ppm. Musky, sweet, powdery, floral, vanilla and perfumey | |||||||||||||||||||||||||||||||||||
| substantivity : | 208 Hour(s) | |||||||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear oily liquid | |||||||||||||||||||||||||||||||||||
| assay : | 93.00 - 100.00 % | |||||||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||||||
| specific gravity : | 1.04000 - 1.04700 @ 25.00 °C. | |||||||||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.654 to 8.712 | |||||||||||||||||||||||||||||||||||
| refractive index : | 1.46800 - 1.47400 @ 20.00 °C. | |||||||||||||||||||||||||||||||||||
| boiling point : | 138.00 - 142.00 °C. @ 1.00 mm Hg | |||||||||||||||||||||||||||||||||||
| boiling point : | 330.00 - 331.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||||||
| logp : | 2.90 | |||||||||||||||||||||||||||||||||||
| shelf life : | 36.00 month(s) or longer if stored properly. | |||||||||||||||||||||||||||||||||||
| storage : | store in cool, dry place in tightly sealed containers, protected from heat and light. | |||||||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat 5000.00 mg/kg | |||||||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||||||
| Maximised Survey-derived Daily Intakes (MSDI) : | 3.00 (μg/capita/day) | |||||||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||||||
| recommendation for ethylene brassylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 10.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||||||
| recommendation for ethylene brassylate usage levels up to : | ||||||||||||||||||||||||||||||||||||
| 0.5000 ppm in the flavor. | ||||||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||||||
| msds : | msds | |||||||||||||||||||||||||||||||||||
| (EINECS) number : | 203-347-8 | |||||||||||||||||||||||||||||||||||
| rtecs : | YQ1927500 for 105-95-3 | |||||||||||||||||||||||||||||||||||
| chemidplus : | 000105953 | |||||||||||||||||||||||||||||||||||
| epa-srs : | 105-95-3 | |||||||||||||||||||||||||||||||||||
| dtp/nci : | 46155 | |||||||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||||||
| C of A | ||||||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||||||
| pubchem : | 197238 | |||||||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 4220962603 | |||||||||||||||||||||||||||||||||||
| reference : | Mosciano, Gerard P&F 23, No. 1, 33, (1998)³ | |||||||||||||||||||||||||||||||||||
| synonyms : | |
| astratone | |
| cyclo-1,13-ethylene dioxytridecan-1,13-dione | |
| 1,4- | dioxacycloheptadecane-5,17-dione |
| ethylene brassylate | |
| ethylene glycol brassylate cyclic diester | |
| ethylene undecane dicarboxylate | |
| musk NN | |
| musk T | |
| tridecane dioic acid cyclic ethylene glycol diester | |
| 1,1'- | undecane dicarboxylic acid ester with ethylene glycol |
| soluble in : | |
| alcohol | |
| dipropylene glycol | |
| paraffin oil | |
| insoluble in : | |
| water | |
| stability : | |
| alcoholic fine fragrance, good | |
| antiperspirant, fair | |
| concentrated fabric softener, good | |
| hypochlorite bleach, poor | |
| liquid detergent, good | |
| perborate powder detergent, fair | |
| soap, fair | |
| toiletry application, good | |
| (odor and/or flavor) blends with : | |
| allspice oil | |
| allyl amyl glycolate | |
| allyl cyclohexyl propionate | |
| ambrette seed oil | |
| ambroxan | |
| iso | amyl benzoate |
| alpha- | amyl cinnamaldehyde |
| iso | amyl phenyl acetate |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| para- | anisaldehyde |
| para- | anisyl acetate |
| para- | anisyl alcohol |
| armoise oil | |
| bay leaf oil | |
| benzoin resinoid | |
| benzophenone | |
| benzyl benzoate | |
| benzyl cinnamate | |
| benzyl isoeugenol | |
| benzyl salicylate | |
| blood orange oil | |
| bois de rose oil | |
| iso | bornyl acetate |
| laevo- | bornyl acetate |
| iso | butyl cinnamate |
| caraway seed oil | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cinnamyl alcohol | |
| cistus oil | |
| citronellol | |
| citrus carbaldehyde | |
| clary sage oil | |
| clove bud oil | |
| clover nitrile | |
| coriander seed oil | |
| costus root oil | |
| costus valerolactone | |
| coumarin | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| cyclohexyl ethyl alcohol | |
| davana oil | |
| decanal | |
| decanol | |
| decyl acetate | |
| dihydrojasmone | |
| dimethyl anthranilate | |
| dimethyl benzyl carbinol | |
| dimethyl benzyl carbinyl butyrate | |
| dodecanal | |
| dodecanol | |
| ethyl cinnamate | |
| ethyl laurate | |
| ethyl maltol | |
| ethyl phenyl acetate | |
| ethyl vanillin | |
| iso | eugenyl acetate |
| fennel seed oil | |
| fir balsam absolute | |
| floral pyranol | |
| frankincense oil | |
| gardenia oxide | |
| geraniol | |
| guaiacwood oil | |
| gurjun balsam oil | |
| hay absolute | |
| heliotropin | |
| heliotropyl acetone | |
| heliotropyl diethyl acetal | |
| (Z)-3- | hexen-1-yl salicylate |
| alpha- | hexyl cinnamaldehyde |
| hyacinth ether | |
| hydroxycitronellal | |
| indole | |
| ionones | |
| labdanum resinoid | |
| lavender absolute | |
| leaf acetal | |
| leerall | |
| lilyall | |
| linalool | |
| laevo- | linalool |
| linalool oxide | |
| linalyl acetate | |
| melon nonenoate | |
| methyl cedryl ketone | |
| methyl cinnamate | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| methyl ionones | |
| methyl isoeugenol | |
| methyl octine carbonate | |
| 2- | methyl undecanal |
| mimosa absolute | |
| muguet octadienol | |
| musks | |
| myrrh oil | |
| beta- | naphthyl ethyl ether |
| nerolidol | |
| gamma- | nonalactone |
| nonanal | |
| nonanol | |
| nutmeg oil | |
| oakmoss absolute | |
| ocean propanal | |
| gamma- | octalactone |
| orris pyridine | |
| osmanthus absolute | |
| patchouli ethanone | |
| patchouli oil | |
| peony alcohol | |
| pepper oil black | |
| peru balsam oil | |
| phenethyl acetate | |
| phenethyl alcohol | |
| phenethyl phenyl acetate | |
| phenyl acetic acid | |
| 3- | phenyl propionaldehyde |
| 3- | phenyl propyl alcohol |
| raspberry ketone | |
| raspberry ketone acetate | |
| raspberry ketone methyl ether | |
| rhodinol | |
| rose butanoate | |
| rose oxides | |
| sandalwood oil | |
| santall | |
| spruce oil | |
| alpha- | terpineol |
| tetrahydrolinalool | |
| tobacco absolute | |
| tobacco dodecane | |
| tonka bean absolute | |
| gamma- | undecalactone |
| undecanol | |
| 10- | undecen-1-al |
| 10- | undecen-1-yl acetate |
| vanilla absolute | |
| vanillyl acetate | |
| verymoss | |
| vetiver oil | |
| violet leaf absolute | |
| violet methyl carbonate | |
| watermelon ketone | |
| woody acetate | |
| woody amylene | |
| woody propanol | |
| (odor and/or flavor) used in : | |
| a suma | |
| abronia | |
| acacia | |
| acorn | |
| aldehydic | |
| allspice | |
| alpine bouquet | |
| amber | |
| ambreine | |
| amyris | |
| angel | |
| animal | |
| azalea | |
| bayberry | |
| beeswax cire d'abeille | |
| bellodgia | |
| boronia | |
| broom genet genista | |
| burberry | |
| butterscotch | |
| cabochard | |
| cabreuva | |
| calamus | |
| cascarilla | |
| cassia | |
| cassia blossom | |
| cedar forest | |
| cedarleaf | |
| champaca champak | |
| cherry | |
| christmas blends | |
| chypre | |
| cilantro | |
| cinnamon | |
| civet | |
| clean | |
| cloth clean cloths | |
| coronilla | |
| cucumber | |
| cyclamen | |
| daffodil narcissus | |
| dahlia | |
| daisy | |
| daphne | |
| diffusion | |
| dillenia | |
| dogwood | |
| dusty | |
| elder blossom | |
| enhancer | |
| evergreen | |
| fern fougere | |
| fetes | |
| fig | |
| floral | |
| flouve blossom | |
| foliage | |
| forest | |
| frangipanni plumeria | |
| gardenia | |
| ginger white ginger | |
| grass sweet grass | |
| guaiacwood | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hinoki | |
| hugonia | |
| incense | |
| iris blossom | |
| ivy leaf | |
| lavender | |
| leather | |
| licorice | |
| lily | |
| linden blossom limeflower tilleul | |
| liverwort | |
| lotus | |
| magnolia | |
| mango blossom | |
| marshmallow | |
| meadow | |
| moss | |
| muguet lily of the valley | |
| musk | |
| myrrh | |
| new car | |
| ocean sea | |
| opoponax | |
| oriental | |
| outdoors fresh outdoors | |
| passion blossom | |
| patchouli | |
| peach blossom | |
| pear prickly pear | |
| petal white petal | |
| petunia | |
| phlox | |
| pinon cone | |
| plum blossom | |
| poppy | |
| powder | |
| privet blossom | |
| rain spring rain | |
| reseda mignonette | |
| rhubarb | |
| rose | |
| rose d'orient | |
| rose moss rose | |
| rose white rose | |
| sandalwood | |
| spice | |
| tamarind | |
| tea | |
| tobacco tabac tabaco | |
| tonka | |
| tropical | |
| tulip | |
| valerian | |
| vanilla | |
| white shoulders | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| not found in nature | |