Notes :
Improve the diffusion in soap.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||
| IUPAC name : | (2-butan-2-yl-1-ethynylcyclohexyl) acetate | |||||||||||||||||||||||||||||
| InChI : | InChI=1/C14H22O2/c1-5-11(3)13-9-7-8-10-14(13,6-2)16-12(4)15/h2,11,13H,5,7-10H2,1,3-4H3 | |||||||||||||||||||||||||||||
| InChIKey : | PKVIIPGIGKYQFI-UHFFFAOYAN | |||||||||||||||||||||||||||||
| SMILES : | CCC(C)C1CCCCC1(C#C)OC(=O)C | |||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||
| Nanjing : | cyclohexanol,1-ethynyl-2-(1-methylpropyl)-,acetate | |||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||
| odor type : | amber | |||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||
| odor description :¹ at 100.00 %. | woody amber dry guaiacwood | |||||||||||||||||||||||||||||
| odor sample from : | Givaudan Corporation | |||||||||||||||||||||||||||||
| substantivity : | 64 Hour(s) | |||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow clear liquid | |||||||||||||||||||||||||||||
| assay : | 95.00 to 100.00 % | |||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||
| specific gravity : | 0.96400 to 0.96900 @ 25.00 °C. | |||||||||||||||||||||||||||||
| pounds per gallon - calc. : | 8.021 to 8.063 | |||||||||||||||||||||||||||||
| refractive index : | 1.46800 to 1.47300 @ 20.00 °C. | |||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||
| flash point : | > 200.00 °F. TCC ( > 93.33 °C. ) | |||||||||||||||||||||||||||||
| logP (o/w) : | 4.24 | |||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||
|
R 36/37/38 - Irritating to eyes, respiratory system, and skin. S 02 - Keep out of the reach of children. S 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S 36 - Wear suitable protective clothing. | ||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | ||||||||||||||||||||||||||||||
|
Oral-Rat 680.00 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 3S, 1992. | ||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | ||||||||||||||||||||||||||||||
|
Skin-Rabbit 2000.00 mg/kg Food and Chemical Toxicology. Vol. 30, Pg. 3S, 1992. | ||||||||||||||||||||||||||||||
| Inhalation Toxicity(LC50) : | ||||||||||||||||||||||||||||||
| Not determined | ||||||||||||||||||||||||||||||
safety in use : | ||||||||||||||||||||||||||||||
| recommendation for amber cyclohexanol usage levels up to : | ||||||||||||||||||||||||||||||
| 6.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||
| recommendation for amber cyclohexanol usage levels up to : | ||||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||
| Canada Domestic Sub. List : | Yes | |||||||||||||||||||||||||||||
| EPA Chem. Sub. Inventory : | Yes | |||||||||||||||||||||||||||||
| (2-butan-2-yl-1-ethynylcyclohexyl) acetate | ||||||||||||||||||||||||||||||
| (EINECS) number : | 253-378-6 | |||||||||||||||||||||||||||||
| chemidplus : | 037172057 | |||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 37172-05-7 | |||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||
| (2-butan-2-yl-1-ethynylcyclohexyl) acetate | ||||||||||||||||||||||||||||||
| pubchem : | 739465 | |||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||
| reference : | Luebke, William tgsc, (1989)¹ | |||||||||||||||||||||||||||||
| synonyms : | |
| 1- | acetoxy-1-ethynyl-2-sec-butyl cyclohexanol |
| acetoxy-2-sec-butyl-1-ethynyl cyclohexane | |
| ambrate | |
| (2- | butan-2-yl-1-ethynylcyclohexyl) acetate |
| 1- | ethynyl-2-(1-methyl propyl) cyclohexanol acetate |
| 1- | ethynyl-2-(1-methyl propyl) cyclohexyl acetate |
soluble in : | |
| alcohol | |
| dipropylene glycol | |
insoluble in : | |
| water | |
stability : | |
| detergent | |
| soap | |
(odor and/or flavor) blends with : | |
| acetyl thujopsene | |
| agarwood oil | |
| amber furan | |
| ambergris | |
| ambra oxide | |
| ambrarome | |
| ambreine | |
| ambrettolide | |
| alpha- | ambrinol |
| ambrinol epoxide | |
| ambroxan | |
| ambroxide | |
| iso | amyl salicylate |
| angelica root oil | |
| animal carbolactone | |
| benzoin resinoid | |
| benzyl acetate | |
| bergamot oil | |
| calarene epoxide | |
| carrot seed oil | |
| castoreum absolute | |
| cedarwood oil | |
| chaulmooga oil | |
| cistus oil | |
| citronellone | |
| civet absolute | |
| civettone | |
| clary sage oil | |
| costus root oil | |
| costus valerolactone | |
| cypress oil | |
| decahydro-beta-naphthaldehyde | |
| dihydro-gamma-ionone | |
| dihydrocoumarin | |
| dihydrolinalool | |
| dodecanal | |
| grisambrene | |
| grisambria | |
| grisambrol | |
| heptalactones | |
| hexalactones | |
| indole | |
| ionones | |
| juniper lactone | |
| labdanum resinoid | |
| lilyall | |
| linalool oxide | |
| marjoram oil | |
| methyl ionones | |
| 2- | methyl undecanal |
| musks | |
| nonadienal acetate | |
| oakmoss absolute | |
| olibanum oil | |
| patchouli ethanone | |
| patchouli oil | |
| peru balsam oil | |
| rhodinol | |
| rose absolute | |
| rosewood oil | |
| sandalwood oil | |
| santall | |
| sclareol | |
| 5,6,7,8- | tetrahydro-1-naphthyl acetaldehyde |
| tetrahydromethyl quinoleine | |
| tolu balsam | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| vanilla absolute | |
| vanillin | |
| versalide | |
| vetiver acetate | |
| vetiver oil | |
(odor and/or flavor) used in : | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| chypre | |
| cigar box | |
| cloth clean cloths | |
| coronilla | |
| deertongue | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| ocean sea | |
| oriental | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| spice | |
| tonka | |
| vanilla | |
| woodruff asperula | |
| woody | |
natural occurrence in : | |
| not found in nature | |