| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||
| IUPAC name : | 1-(4-tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone | |||||||||||||||||||||||||||
| InChI : | InChI=1/C14H18N2O5/c1-7-10(9(3)17)8(2)13(16(20)21)11(14(4,5)6)12(7)15(18)19/h1-6H3 | |||||||||||||||||||||||||||
| InChIKey : | WXCMHFPAUCOJIG-UHFFFAOYAE | |||||||||||||||||||||||||||
| SMILES : | CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-])C)C(=O)C | |||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||
| Fleurchem : | musk ketone | |||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Musk ketone | |||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||
| odor description : at 10.00 % in benzyl benzoate. | natural musk | |||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||
| appearence : | yellow powder | |||||||||||||||||||||||||||
| assay : | 98.00 to 100.00 % | |||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||
| melting point : | 135.00 to 139.00 °C. @ 760.00 mm Hg | |||||||||||||||||||||||||||
| boiling point : | 395.00 °C. @ 0.00 mm Hg | |||||||||||||||||||||||||||
| logp : | 3.86 | |||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||
| most important hazard(s) : | Xn N - Harmful, Dangerous for the environment. | |||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >10.00 gm/kg FCTXAV 13,877,1975 | |||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >10.00 gm/kg FCTXAV 13,877,1975 | |||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 212.00 °F. TCC ( 100.00 °C. ) | |||||||||||||||||||||||||||
| recommendation for musk ketone usage levels up to : | ||||||||||||||||||||||||||||
| not for fragrance use. | ||||||||||||||||||||||||||||
| recommendation for musk ketone usage levels up to : | ||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||
| 1-(4-tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone | ||||||||||||||||||||||||||||
| (EINECS) number : | 201-328-9 | |||||||||||||||||||||||||||
| RTECS : | KM5775841 for 81-14-1 | |||||||||||||||||||||||||||
| chemidplus : | 000081141 | |||||||||||||||||||||||||||
| EPA Substance Registry Services : | 81-14-1 | |||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 81-14-1 | |||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 81-14-1 | |||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 81-14-1 | |||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 81-14-1 | |||||||||||||||||||||||||||
| dtp/nci : | 15339 | |||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||
| 1-(4-tert-butyl-2,6-dimethyl-3,5-dinitrophenyl)ethanone | ||||||||||||||||||||||||||||
| pubchem : | 149648 | |||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 2718561442 | |||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||
| synonyms : | |
| 4'-tert- | butyl-2',6'-dimethyl-3',3'-dinitroacetophenone |
| 4-tert- | butyl-3,5-dinitro-2,6-dimethyl acetophenone |
| 1-(4-(1,1- | dimethyl ethyl)-2,6-dimethyl-3,5-dinitrophenyl) ethanone |
| 3,5- | dinitro-2,6-dimethyl-4-tert-butyl acetophenone |
| 2,6- | dinitro-3,5-dimethyl-4-acetyl-tert-butyl benzene |
| musk ketone | |
soluble in : | |
| alcohol | |
| paraffin oil | |
| water, 1.9 mg/L @ 25C | |
| 8.9 gms to 100 gms methyl carbitol | |
| 25.4 gms to 100 gms benzyl benzoate | |
| 16.5 gms to 100 gms diethyl phthalate | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| abies alba mill oil | |
| abies sibirica oil | |
| atractylis absolute | |
| iso | butyl salicylate |
| calamus oil | |
| cangerana root bark oil | |
| cedarwood oil | |
| civet absolute | |
| clary sage oil | |
| copaiba balsam oil | |
| costus root oil | |
| coumarin | |
| labdanum resinoid | |
| lavender absolute | |
| oxysesquine | |
| turmeric root oil | |
(odor and/or flavor) used in : | |
| a suma | |
| abronia | |
| acacia | |
| amber | |
| ambrene | |
| amour-amour | |
| animal | |
| arpege | |
| baby powder | |
| balsam | |
| bellodgia | |
| broom genet genista | |
| cabochard | |
| carnation dianthus oeillet | |
| cassie acacia farnesiana | |
| cedar | |
| chanel #5 | |
| chypre | |
| cinq fleurs forvil | |
| crabapple blossom | |
| dillenia | |
| elder blossom | |
| emeraude | |
| fern fougere | |
| floral | |
| gardenia | |
| honeysuckle chevrefeuille | |
| hugonia | |
| japan flowers | |
| jasmin | |
| jicky | |
| joy | |
| juniperberry | |
| l'air du temps | |
| leather | |
| mimosa wattle | |
| moss | |
| musk | |
| my sin | |
| narcissus narcisse | |
| nemesia | |
| orange blossom fleur d'oranger | |
| oriental | |
| poppy red poppy | |
| powder | |
| presence | |
| rose red rose | |
| sandalwood | |
| scandal | |
| shalimar | |
| tabu | |
| violet | |
| vol de nuit | |
| wallflower giroflee | |
| windsor soap | |
| wistaria wisteria glycine | |
| woody | |
| ylang ylang cananga | |
| zibeline | |
natural occurrence in : | |
| not found in nature | |