| |
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). |
| |
|
|
| InChI : | InChI=1/C16H28O/c1-11-6-7-12-14(2,3)13-10-16(11,12)9-8-15(13,4)17-5/h11-13H,6-10H2,1-5H3/t11-,12+,13-,15+,16+/m1/s1 |
| InChIKey : | HRGPYCVTDOECMG-WALBABNVBF |
| SMILES : | C[C@@H]1CC[C@@H]2[C@]13CC[C@]([C@H](C3)C2(C)C)(C)OC |
| (EINECS) number : | 243-384-7 |
| cas number : | 19870-74-7 |
| molar refractivity : | 71.69 ± 0.4 cm3 |
| parachor : | 585.4 ± 6.0 cm3 |
| index of refraction : | 1.496 ± 0.03 |
| surface tension : | 32.4 ± 5.0 dyne/cm |
| density : | 0.96 ± 0.1 g/cm3 |
| polarizability : | 28.42 ± 0.5 10-24cm3 |
| xlogp : | 5.70 |
| molecular weight : | 236.3929200 |
| formula : | C16 H28 O |
|
|
| |
| |
| fda reg : | unspecified |
h. number : | 2909.20.0000 |
| organoleptics : | |
| odor type : | woody |
| odor strength : | medium |
odor description :
at 100.00 %. | woody dry ambergris |
| substantivity : | 124 Hour(s) |
| properties : | |
| appearence : | colorless to pale yellow clear liquid |
| assay : | 92.00 - 100.00 %
|
| Food Chemicals Codex Listed : | No |
| specific gravity : | 0.97100 - 0.97900 @ 25.00 °C.
|
| pounds per gallon - calc. : | 8.080 to 8.146
|
| refractive index : | 1.49400 - 1.49800 @ 20.00 °C.
|
| boiling point : | 268.00 - 269.00 °C. @ 760.00 mm Hg
|
| logp : | 6.16 |
| safety : | |
| most important hazard(s) : |
Xi - Irritant |
| | |
| Oral Toxicity(LD50) : |
Not determined
|
| Dermal Toxicity(LD50) : |
Not determined
|
| | |
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. )
|
| | |
| recommendation for cedrol methyl ether usage levels up to : | | | 2.0000 % in the fragrance concentrate.
|
| | |
| recommendation for cedrol methyl ether usage levels up to : | | | not for flavor use.
|
| | |
| safety links : | |
| (EINECS) number : | 243-384-7 |
| chemidplus : | 019870747 |
| epa-srs : | 19870-74-7 |
| | |
| other : | |
| |
|
| references : | |
| pubchem : | 665091 |
| | |
|
| synonyms : |
| | cedrol methyl ether | | | cedryl methyl ether | | (3R-(3alpha,3abeta,6beta,7beta,8aalpha))- | octahydro-6-methoxy-3,6,8,8-tetramethyl-1H-3a,7-methanoazulene | | (3R,3aS,6S,7R,8aS)- | octahydro-6-methoxy-3,6,8,8-tetramethyl-1H-3a,7-methanoazulene |
| soluble in : |
| | alcohol |
| insoluble in : |
| | water |
| stability : |
| | acid cleaner | | | alcoholic lotion | | | antiperspirant | | | bleach | | | deo stick | | | detergent | | | fabric softener | | | hard surface cleaner | | | shampoo | | | soap |
| (odor and/or flavor) blends with : |
| | agarwood oil |
| | amber furan |
| | ambergris |
| | ambra oxide |
| | ambrarome |
| | ambreine |
| | ambrettolide |
| alpha- | ambrinol |
| | ambrinol epoxide |
| | ambroxan |
| | ambroxide |
| iso | amyl salicylate |
| | angelica root oil |
| | animal carbolactone |
| | benzoin resinoid |
| | benzyl acetate |
| | bergamot oil |
| | calarene epoxide |
| | carrot seed oil |
| | castoreum absolute |
| | cedarwood oil |
| | chaulmooga oil |
| | cistus oil |
| | citronellone |
| | civet absolute |
| | civettone |
| | clary sage oil |
| | costus root oil |
| | costus valerolactone |
| | cypress oil |
| | decahydro-beta-naphthaldehyde |
| | dihydro-gamma-ionone |
| | dihydrocoumarin |
| | dihydrolinalool |
| | dodecanal |
| | grisambrene |
| | grisambria |
| | grisambrol |
| | heptalactones |
| | hexalactones |
| | indole |
| | ionones |
| | juniper lactone |
| | labdanum resinoid |
| | lilyall |
| | linalool oxide |
| | marjoram oil |
| | methyl ionones |
| 2- | methyl undecanal |
| | musks |
| | nonadienal acetate |
| | oakmoss absolute |
| | olibanum oil |
| | patchouli ethanone |
| | patchouli oil |
| | peru balsam oil |
| | rhodinol |
| | rose absolute |
| | rosewood oil |
| | sandalwood oil |
| | santall |
| | sclareol |
| 5,6,7,8- | tetrahydro-1-naphthyl acetaldehyde |
| | tetrahydromethyl quinoleine |
| | tolu balsam |
| | tonka bean absolute |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| | vanilla absolute |
| | vanillin |
| | versalide |
| | vetiver acetate |
| | vetiver oil |
| (odor and/or flavor) used in : |
| | amber | | | ambergris | | | ambreine | | | ambrette | | | animal | | | baby powder | | | balsam | | | bay rum | | | bayberry | | | blue grass | | | bouquet | | | cabreuva | | | castoreum | | | cedar | | | cedar forest | | | chypre | | | cigar box | | | clary sage | | | cloth clean cloths | | | coronilla | | | deertongue | | | dry | | | earth humus | | | fantasy blends | | | fern fougere | | | fir balsam | | | floral | | | forest pine forest | | | grass sweet grass | | | guaiacwood | | | habuba | | | hay new mown hay foin coupe | | | heather | | | herbal | | | hollyberry | | | incense | | | juniperberry | | | labdanum | | | leather | | | leather russian leather | | | maja | | | moss | | | musk | | | ocean sea | | | oriental | | | orris iris | | | patchouli | | | powder | | | rain | | | rain spring rain | | | spice | | | tonka | | | vanilla | | | vetiver | | | woodruff asperula | | | woody |
| natural occurrence in : |
| not found in nature |
|