Notes :
Of wide potential application from concentrates and toilet waters to modern soap and detergent fragrances. It is of particular value in woody, spicy and oriental types and has considerable potential for men's toiletries. It is compatible with a wide range of perfumery component materials and has marked fixative properties.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||
| InChI : | InChI=1/C18H28O2/c1-11(19)20-10-12-6-7-15(2,3)17-9-13-8-14(17)18(12,17)16(13,4)5/h12-14H,6-10H2,1-5H3 | |||||||||||||||||||||||
| InChIKey : | ANPXCNWSCGYEMA-UHFFFAOYAR | |||||||||||||||||||||||
| SMILES : | CC(=O)OCC1CCC(C23C14C2CC(C3)C4(C)C)(C)C | |||||||||||||||||||||||
|
| |||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2915.39.9050 | |||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||
| odor type : | amber | |||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||
| odor description : at 100.00 %. | woody amber vetiver acetate sandalwood clary sage | |||||||||||||||||||||||
| substantivity : | 280 hour(s) at 100.00 % | |||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||
| appearence : | pale yellow clear liquid | |||||||||||||||||||||||
| assay : | 90.00 - 100.00 % | |||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||
| specific gravity : | 1.01200 - 1.01700 @ 25.00 °C. | |||||||||||||||||||||||
| pounds per gallon - calc. : | 8.421 to 8.462 | |||||||||||||||||||||||
| refractive index : | 1.49400 - 1.49800 @ 20.00 °C. | |||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||
| logp : | 5.46 | |||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||
| recommendation for acetoxymethyl isolongifolene usage levels up to : | ||||||||||||||||||||||||
| 50.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||
| recommendation for acetoxymethyl isolongifolene usage levels up to : | ||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||
| (EINECS) number : | 261-579-5 | |||||||||||||||||||||||
| toxnet : | 59056-62-1 | |||||||||||||||||||||||
| epa-srs : | 59056-62-1 | |||||||||||||||||||||||
| pubchem : | 59056-62-1 | |||||||||||||||||||||||
| other : | ||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||
| synonyms : | |
| acetoxymethyl isolongifolene | |
| amboryl acetate | |
| octahydro-7,7,8,8-tetramethyl-2,3b-methano-3bH-cyclopenta(1,3)cyclopropa(1,2)benzene-4-methyl acetate | |
| octahydrotetramethyl methanocyclopentacyclopropabenzene-4-methanol acetate | |
| soluble in : | |
| alcohol | |
| insoluble in : | |
| water | |
| stability : | |
| air freshener | |
| antiperspirant | |
| deodorant | |
| detergent | |
| fabric softeners | |
| foam bath | |
| shampoo | |
| soap | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| ambergris | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzoin resinoid | |
| bois de rose oil | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cistus oil | |
| costus valerolactone | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl maltol | |
| iso | eugenyl acetate |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| guaiacwood oil | |
| guaiarome | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| indole | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| maltol | |
| melon heptenal | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| 2- | methyl undecanal |
| musks | |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| santall | |
| spruce oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| agate | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blue grass | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| christmas blends | |
| cigar box | |
| clary sage | |
| cloth clean cloths | |
| cool water | |
| coronilla | |
| deertongue | |
| dry | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| fixer | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| muguet lily of the valley | |
| musk | |
| ocean sea | |
| ocean sea breeze | |
| oriental | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| rounding off | |
| sandalwood | |
| spice | |
| tobacco tabac tabaco | |
| tonka | |
| tweed | |
| vanilla | |
| vetiver | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| not found in nature | |