| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||
| IUPAC name : | 1-tert-butyl-3,5-dimethyl-2,4,6-trinitrobenzene | |||||||||||||||||||||||||||||
| InChI : | InChI=1/C12H15N3O6/c1-6-9(13(16)17)7(2)11(15(20)21)8(12(3,4)5)10(6)14(18)19/h1-5H3 | |||||||||||||||||||||||||||||
| InChIKey : | XMWRWTSZNLOZFN-UHFFFAOYAO | |||||||||||||||||||||||||||||
| SMILES : | CC1=C(C(=C(C(=C1[N+](=O)[O-])C(C)(C)C)[N+](=O)[O-])C)[N+](=O)[O-] | |||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||
| export tariff code : | unspecified | |||||||||||||||||||||||||||||
| fda reg : | unspecified | |||||||||||||||||||||||||||||
Suppliers : | ||||||||||||||||||||||||||||||
| Fleurchem : | musk xylol | |||||||||||||||||||||||||||||
| Sigma-Aldrich-SAFC : | Musk zylol | |||||||||||||||||||||||||||||
organoleptics : | ||||||||||||||||||||||||||||||
| odor type : | musk | |||||||||||||||||||||||||||||
| odor strength : | medium | |||||||||||||||||||||||||||||
| odor description : at 10.00 % in benzyl benzoate. | fatty dry sweet musk | |||||||||||||||||||||||||||||
| substantivity : | 400 Hour(s) | |||||||||||||||||||||||||||||
properties : | ||||||||||||||||||||||||||||||
| appearence : | pale yellow crystals | |||||||||||||||||||||||||||||
| assay : | 99.00 to 100.00 % | |||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||
| melting point : | 235.40 °C. @ 0.00 mm Hg | |||||||||||||||||||||||||||||
| logp : | 3.83 | |||||||||||||||||||||||||||||
safety : | ||||||||||||||||||||||||||||||
| most important hazard(s) : | Xn N - Harmful, Dangerous for the environment. | |||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : |
Oral-Rat >10.00 gm/kg | |||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : |
Skin-Rabbit >15.00 gm/kg | |||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | 200.00 °F. TCC ( 93.33 °C. ) | |||||||||||||||||||||||||||||
| recommendation for musk xylol usage levels up to : | ||||||||||||||||||||||||||||||
| not for fragrance use. | ||||||||||||||||||||||||||||||
| recommendation for musk xylol usage levels up to : | ||||||||||||||||||||||||||||||
| not for flavor use. | ||||||||||||||||||||||||||||||
safety references : | ||||||||||||||||||||||||||||||
| EPI System : | view | |||||||||||||||||||||||||||||
| 1-tert-butyl-3,5-dimethyl-2,4,6-trinitrobenzene | ||||||||||||||||||||||||||||||
| (EINECS) number : | 201-329-4 | |||||||||||||||||||||||||||||
| chemidplus : | 000081152 | |||||||||||||||||||||||||||||
| EPA Substance Registry Services : | 81-15-2 | |||||||||||||||||||||||||||||
| NLM Chemical Carcinogenesis Research Information System : | 81-15-2 | |||||||||||||||||||||||||||||
| NLM Developmental and Reproductive Toxicity : | 81-15-2 | |||||||||||||||||||||||||||||
| NLM Env. Mutagen Info. Center : | 81-15-2 | |||||||||||||||||||||||||||||
| NLM GENetic TOXicology : | 81-15-2 | |||||||||||||||||||||||||||||
| dtp/nci : | 59844 | |||||||||||||||||||||||||||||
references : | ||||||||||||||||||||||||||||||
| 1-tert-butyl-3,5-dimethyl-2,4,6-trinitrobenzene | ||||||||||||||||||||||||||||||
| pubchem : | 203605 | |||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 859393608 | |||||||||||||||||||||||||||||
other : | ||||||||||||||||||||||||||||||
| synonyms : | |
| 5-tert- | butyl-2,4,6-trinitro-meta-xylene |
| 5-tert- | butyl-2,4,6-trinitroxylene |
| 1-(1,1- | dimethyl ethyl)-3,5-dimethyl-2,4,6-trinitrobenzene |
| ( | dimethyl-1,1-ethyl)-1-dimethyl-3,5-trinitro-2,4,6-benzene |
| musk xylol | |
| musk zylene | |
| 2,4,6- | trinitro-1,3-dimethyl-5-tert-butyl benzene |
| 2,4,6- | trinitro-3,5-dimethyl-1-tert-butyl benzene |
soluble in : | |
| ethyl alcohol, slightly | |
| paraffin oil | |
| water, 0.49 mg/L @ 25C | |
| 5.5 gms to 100 gms methyl carbitol | |
| 25.2 gms to 100 gms benzyl benzoate | |
| 14.4 gms to 100 gms diethyl phthalate | |
insoluble in : | |
| water | |
(odor and/or flavor) blends with : | |
| abies alba mill oil | |
| abies sibirica oil | |
| atractylis absolute | |
| iso | butyl salicylate |
| calamus oil | |
| cangerana root bark oil | |
| cedarwood oil | |
| civet absolute | |
| clary sage oil | |
| copaiba balsam oil | |
| costus root oil | |
| coumarin | |
| labdanum resinoid | |
| lavandin oil | |
| oxysesquine | |
(odor and/or flavor) used in : | |
| acacia | |
| aldehydic | |
| almond | |
| alpine bouquet | |
| amber | |
| ambrene | |
| amour-amour | |
| anais anais | |
| baby powder | |
| balsam | |
| bluebell | |
| bouquet | |
| carnation dianthus oeillet | |
| charlie | |
| cherry blossom | |
| chloe | |
| christmas blends | |
| chypre | |
| coconut | |
| cologne | |
| estee | |
| evergreen | |
| fern fougere | |
| fidji | |
| floral | |
| forest pine forest | |
| gardenia | |
| ginger white ginger | |
| grass sweet grass | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| honeysuckle chevrefeuille | |
| jasmin | |
| jockey club | |
| l'air du temps | |
| lavender | |
| lux beauty shower soap | |
| millefleurs | |
| mint | |
| moss | |
| musk | |
| norell | |
| orange blossom fleur d'oranger | |
| oriental | |
| paris | |
| patchouli | |
| pine | |
| rain | |
| rose | |
| rose moss rose | |
| sandalwood | |
| sassafras | |
| sherry | |
| vanilla | |
| violet | |
| wine | |
| ylang ylang cananga | |
natural occurrence in : | |
| not found in nature | |