Notes :
Ambrox replacer.
| Right Click Picture For More Options. (Safari 1.2 (v125) Compatible). | ||||||||||||||||||||||||||||||||
| IUPAC name : | 3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-naphtho[7,8-b]furan | |||||||||||||||||||||||||||||||
| InChI : | InChI=1/C16H28O/c1-14(2)8-5-9-15(3)12(14)6-10-16(4)13(15)7-11-17-16/h12-13H,5-11H2,1-4H3 | |||||||||||||||||||||||||||||||
| InChIKey : | YPZUZOLGGMJZJO-UHFFFAOYAI | |||||||||||||||||||||||||||||||
| SMILES : | CC1(CCCC2(C1CCC3(C2CCO3)C)C)C | |||||||||||||||||||||||||||||||
|
| |||||||||||||||||||||||||||||||
| fda reg : | unspecified | h. number : | 2932.19.0000 | |||||||||||||||||||||||||||||
| organoleptics : | ||||||||||||||||||||||||||||||||
| odor type : | amber | |||||||||||||||||||||||||||||||
| odor strength : | high , recommend smelling in a 10.00 % solution or less | |||||||||||||||||||||||||||||||
| odor description : at 10.00 % in dipropylene glycol. | dry woody amber ambergris musk sweet | |||||||||||||||||||||||||||||||
| substantivity : | > 400 hour(s) at 10.00 % in dipropylene glycol | |||||||||||||||||||||||||||||||
| properties : | ||||||||||||||||||||||||||||||||
| appearence : | colorless to pale yellow liquid to solid | |||||||||||||||||||||||||||||||
| assay : | 96.00 - 100.00 % | |||||||||||||||||||||||||||||||
| Food Chemicals Codex Listed : | No | |||||||||||||||||||||||||||||||
| boiling point : | 102.00 - 106.00 °C. @ 25.00 mm Hg | |||||||||||||||||||||||||||||||
| acid value : | 1.00 max. KOH/g | |||||||||||||||||||||||||||||||
| logp : | 5.41 | |||||||||||||||||||||||||||||||
| safety : | ||||||||||||||||||||||||||||||||
| most important hazard(s) : | Xi - Irritant | |||||||||||||||||||||||||||||||
| Oral Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| Dermal Toxicity(LD50) : | Not determined | |||||||||||||||||||||||||||||||
| flash point ( Deg. F. ) : | > 212.00 °F. TCC ( > 100.00 °C. ) | |||||||||||||||||||||||||||||||
| recommendation for amber naphthofuran usage levels up to : | ||||||||||||||||||||||||||||||||
| 1.0000 % in the fragrance concentrate. | ||||||||||||||||||||||||||||||||
| safety links : | ||||||||||||||||||||||||||||||||
| (EINECS) number : | 223-118-6 | |||||||||||||||||||||||||||||||
| chemidplus : | 003738009 | |||||||||||||||||||||||||||||||
| epa-srs : | 3738-00-9 | |||||||||||||||||||||||||||||||
| other : | ||||||||||||||||||||||||||||||||
| references : | ||||||||||||||||||||||||||||||||
| pubchem : | 684373 | |||||||||||||||||||||||||||||||
| NIST Chemistry WebBook : | 3625528226 | |||||||||||||||||||||||||||||||
| synonyms : | |
| amber naphthofuran | |
| ambrox dl | |
| ambroxide | |
| cetalox | |
| dodecahydro-3a,6,6,9a-tetramethyl naphtho(2,1-beta)furan | |
| dodecahydrotetramethyl naphthofuran | |
| synambran | |
| tetramethyl dodecahydro-3a,6,6,9a-naphtho(2,1-b)furan | |
| tetramethyl perhydronaphthofurane | |
| 1,5,5,9- | tetramethyl-13-oxatricyclo(8.3.0.0.(4.9))tridecane |
| soluble in : | |
| alcohol | |
| water, slightly | |
| insoluble in : | |
| water | |
| stability : | |
| very stable in most media | |
| (odor and/or flavor) blends with : | |
| acetophenone | |
| ambergris | |
| iso | amyl salicylate |
| amyris wood oil | |
| angelica root oil | |
| animal carbolactone | |
| beeswax absolute | |
| benzoin resinoid | |
| bois de rose oil | |
| iso | butyl salicylate |
| caramel furanone | |
| carrot seed oil | |
| cassia bark oil | |
| cedarwood oils | |
| cistus oil | |
| costus valerolactone | |
| currant bud absolute black | |
| cyclamen aldehyde | |
| gamma- | decalactone |
| decanol | |
| dihydrojasmone | |
| diphenyl oxide | |
| dodecanal | |
| dodecanol | |
| ethyl laurate | |
| ethyl maltol | |
| iso | eugenyl acetate |
| floral pyranol | |
| frankincense oil | |
| galbanum oil | |
| guaiacwood oil | |
| gurjun balsam oil | |
| heliotropyl acetone | |
| alpha- | hexyl cinnamaldehyde |
| immortelle absolute | |
| indole | |
| labdanum resinoid | |
| lilyall | |
| laevo- | linalool |
| maltol | |
| melon heptenal | |
| methyl cedryl ketone | |
| methyl dihydrojasmonate | |
| methyl heptine carbonate | |
| 2- | methyl undecanal |
| musks | |
| nerolidol | |
| (E,Z)-2,6- | nonadien-1-ol |
| gamma- | nonalactone |
| nonanol | |
| (Z)-6- | nonen-1-al |
| ocean propanal | |
| gamma- | octalactone |
| patchouli ethanone | |
| patchouli oil | |
| phenethyl phenyl acetate | |
| raspberry ketone | |
| santall | |
| spruce oil | |
| tonka bean absolute | |
| gamma- | undecalactone |
| 10- | undecen-1-al |
| verymoss | |
| violet leaf absolute | |
| watermelon ketone | |
| woody acetate | |
| (odor and/or flavor) used in : | |
| agate | |
| amber | |
| ambergris | |
| ambreine | |
| ambrette | |
| animal | |
| baby powder | |
| balsam | |
| bay rum | |
| bayberry | |
| blackberry | |
| blue grass | |
| blueberry | |
| bouquet | |
| cabreuva | |
| castoreum | |
| cedar forest | |
| christmas blends | |
| cigar box | |
| cloth clean cloths | |
| coronilla | |
| deertongue | |
| dry | |
| earth humus | |
| fantasy blends | |
| fern fougere | |
| fir balsam | |
| floral | |
| forest pine forest | |
| grass sweet grass | |
| guaiacwood | |
| habuba | |
| hay new mown hay foin coupe | |
| heather | |
| herbal | |
| hollyberry | |
| incense | |
| juniperberry | |
| labdanum | |
| leather | |
| leather russian leather | |
| maja | |
| moss | |
| musk | |
| ocean sea | |
| ocean sea breeze | |
| oriental | |
| patchouli | |
| powder | |
| rain | |
| rain spring rain | |
| raspberry | |
| sandalwood | |
| spice | |
| tea | |
| tobacco tabac tabaco | |
| tonka | |
| tweed | |
| vanilla | |
| woodruff asperula | |
| woody | |
| natural occurrence in : | |
| found in nature | |